Lothario
/
axmol
mirror of https://github.com/axmolengine/axmol.git
1
0
Fork 0
Code Issues Packages Projects Releases Wiki Activity

Merge pull request #3085 from minggo/iss2129-remove_prefix 

issue #2129:remove prefix of types in ccTypes.h
This commit is contained in:
minggo 2013-07-08 01:03:29 -07:00
parent 4f5c5b20c8 cf96ec079e
commit cd1801d324
243 changed files with 2976 additions and 2888 deletions
Show Stats Download Patch File Download Diff File Expand all files Collapse all files

2
cocos2d_libs.xcodeproj/project.pbxproj.REMOVED.git-id
View File

@ -1 +1 @@
a99b08b2ffceb676a19dbcca403053c395c80351 047da0e8442426e83230e33a5ce40c8d3ae8059e

1
cocos2dx/Android.mk
View File

@ -11,6 +11,7 @@ CCConfiguration.cpp \
CCScheduler.cpp \ CCScheduler.cpp \
CCCamera.cpp \ CCCamera.cpp \
ccFPSImages.c \ ccFPSImages.c \
ccTypes.cpp \
actions/CCAction.cpp \ actions/CCAction.cpp \
actions/CCActionCamera.cpp \ actions/CCActionCamera.cpp \
actions/CCActionCatmullRom.cpp \ actions/CCActionCatmullRom.cpp \

30
cocos2dx/actions/CCActionGrid.cpp
View File

@ -95,19 +95,29 @@ GridBase* Grid3DAction::getGrid(void)
return Grid3D::create(_gridSize); return Grid3D::create(_gridSize);
} }
ccVertex3F Grid3DAction::vertex(const Point& position) Vertex3F Grid3DAction::vertex(const Point& position)
{ {
Grid3D *g = (Grid3D*)_target->getGrid(); return getVertex(position);
return g->vertex(position);
} }
ccVertex3F Grid3DAction::originalVertex(const Point& position) Vertex3F Grid3DAction::originalVertex(const Point& position)
{ {
Grid3D *g = (Grid3D*)_target->getGrid(); return getOriginalVertex(position);
return g->originalVertex(position);
} }
void Grid3DAction::setVertex(const Point& position, const ccVertex3F& vertex) Vertex3F Grid3DAction::getVertex(const Point& position)
{
Grid3D *g = (Grid3D*)_target->getGrid();
return g->getVertex(position);
}
Vertex3F Grid3DAction::getOriginalVertex(const Point& position)
{
Grid3D *g = (Grid3D*)_target->getGrid();
return g->getOriginalVertex(position);
}
void Grid3DAction::setVertex(const Point& position, const Vertex3F& vertex)
{ {
Grid3D *g = (Grid3D*)_target->getGrid(); Grid3D *g = (Grid3D*)_target->getGrid();
g->setVertex(position, vertex); g->setVertex(position, vertex);
@ -120,19 +130,19 @@ GridBase* TiledGrid3DAction::getGrid(void)
return TiledGrid3D::create(_gridSize); return TiledGrid3D::create(_gridSize);
} }
ccQuad3 TiledGrid3DAction::tile(const Point& pos) Quad3 TiledGrid3DAction::tile(const Point& pos)
{ {
TiledGrid3D *g = (TiledGrid3D*)_target->getGrid(); TiledGrid3D *g = (TiledGrid3D*)_target->getGrid();
return g->tile(pos); return g->tile(pos);
} }
ccQuad3 TiledGrid3DAction::originalTile(const Point& pos) Quad3 TiledGrid3DAction::originalTile(const Point& pos)
{ {
TiledGrid3D *g = (TiledGrid3D*)_target->getGrid(); TiledGrid3D *g = (TiledGrid3D*)_target->getGrid();
return g->originalTile(pos); return g->originalTile(pos);
} }
void TiledGrid3DAction::setTile(const Point& pos, const ccQuad3& coords) void TiledGrid3DAction::setTile(const Point& pos, const Quad3& coords)
{ {
TiledGrid3D *g = (TiledGrid3D*)_target->getGrid(); TiledGrid3D *g = (TiledGrid3D*)_target->getGrid();
return g->setTile(pos, coords); return g->setTile(pos, coords);

24
cocos2dx/actions/CCActionGrid.h
View File

@ -74,11 +74,17 @@ public:
/** returns the grid */ /** returns the grid */
virtual GridBase* getGrid(void); virtual GridBase* getGrid(void);
/** returns the vertex than belongs to certain position in the grid */ /** returns the vertex than belongs to certain position in the grid */
ccVertex3F vertex(const Point& position); CC_DEPRECATED_ATTRIBUTE Vertex3F vertex(const Point& position);
/** returns the non-transformed vertex than belongs to certain position in the grid */ /** returns the non-transformed vertex than belongs to certain position in the grid */
ccVertex3F originalVertex(const Point& position); CC_DEPRECATED_ATTRIBUTE Vertex3F originalVertex(const Point& position);
/** returns the vertex than belongs to certain position in the grid */
Vertex3F getVertex(const Point& position);
/** returns the non-transformed vertex than belongs to certain position in the grid */
Vertex3F getOriginalVertex(const Point& position);
/** sets a new vertex to a certain position of the grid */ /** sets a new vertex to a certain position of the grid */
void setVertex(const Point& position, const ccVertex3F& vertex); void setVertex(const Point& position, const Vertex3F& vertex);
}; };
/** @brief Base class for TiledGrid3D actions */ /** @brief Base class for TiledGrid3D actions */
@ -89,11 +95,17 @@ public:
virtual TiledGrid3DAction * clone() const = 0; virtual TiledGrid3DAction * clone() const = 0;
/** returns the tile that belongs to a certain position of the grid */ /** returns the tile that belongs to a certain position of the grid */
ccQuad3 tile(const Point& position); CC_DEPRECATED_ATTRIBUTE Quad3 tile(const Point& position);
/** returns the non-transformed tile that belongs to a certain position of the grid */ /** returns the non-transformed tile that belongs to a certain position of the grid */
ccQuad3 originalTile(const Point& position); CC_DEPRECATED_ATTRIBUTE Quad3 originalTile(const Point& position);
/** returns the tile that belongs to a certain position of the grid */
Quad3 getTile(const Point& position);
/** returns the non-transformed tile that belongs to a certain position of the grid */
Quad3 getOriginalTile(const Point& position);
/** sets a new tile to a certain position of the grid */ /** sets a new tile to a certain position of the grid */
void setTile(const Point& position, const ccQuad3& coords); void setTile(const Point& position, const Quad3& coords);
/** returns the grid */ /** returns the grid */
virtual GridBase* getGrid(void); virtual GridBase* getGrid(void);

18
cocos2dx/actions/CCActionGrid3D.cpp
View File

@ -104,7 +104,7 @@ void Waves3D::update(float time)
{ {
for (j = 0; j < _gridSize.height + 1; ++j) for (j = 0; j < _gridSize.height + 1; ++j)
{ {
ccVertex3F v = originalVertex(ccp(i ,j)); Vertex3F v = originalVertex(ccp(i ,j));
v.z += (sinf((float)M_PI * time * _waves * 2 + (v.y+v.x) * 0.01f) * _amplitude * _amplitudeRate); v.z += (sinf((float)M_PI * time * _waves * 2 + (v.y+v.x) * 0.01f) * _amplitude * _amplitudeRate);
//CCLOG("v.z offset is %f\n", (sinf((float)M_PI * time * _waves * 2 + (v.y+v.x) * .01f) * _amplitude * _amplitudeRate)); //CCLOG("v.z offset is %f\n", (sinf((float)M_PI * time * _waves * 2 + (v.y+v.x) * .01f) * _amplitude * _amplitudeRate));
setVertex(ccp(i, j), v); setVertex(ccp(i, j), v);
@ -190,7 +190,7 @@ void FlipX3D::update(float time)
angle = angle / 2.0f; // x calculates degrees from 0 to 90 angle = angle / 2.0f; // x calculates degrees from 0 to 90
float mx = cosf(angle); float mx = cosf(angle);
ccVertex3F v0, v1, v, diff; Vertex3F v0, v1, v, diff;
v0 = originalVertex(ccp(1, 1)); v0 = originalVertex(ccp(1, 1));
v1 = originalVertex(ccp(0, 0)); v1 = originalVertex(ccp(0, 0));
@ -298,7 +298,7 @@ void FlipY3D::update(float time)
angle = angle / 2.0f; // x calculates degrees from 0 to 90 angle = angle / 2.0f; // x calculates degrees from 0 to 90
float my = cosf(angle); float my = cosf(angle);
ccVertex3F v0, v1, v, diff; Vertex3F v0, v1, v, diff;
v0 = originalVertex(ccp(1, 1)); v0 = originalVertex(ccp(1, 1));
v1 = originalVertex(ccp(0, 0)); v1 = originalVertex(ccp(0, 0));
@ -446,7 +446,7 @@ void Lens3D::update(float time)
{ {
for (j = 0; j < _gridSize.height + 1; ++j) for (j = 0; j < _gridSize.height + 1; ++j)
{ {
ccVertex3F v = originalVertex(ccp(i, j)); Vertex3F v = originalVertex(ccp(i, j));
Point vect = ccpSub(_position, ccp(v.x, v.y)); Point vect = ccpSub(_position, ccp(v.x, v.y));
float r = ccpLength(vect); float r = ccpLength(vect);
@ -561,7 +561,7 @@ void Ripple3D::update(float time)
{ {
for (j = 0; j < (_gridSize.height+1); ++j) for (j = 0; j < (_gridSize.height+1); ++j)
{ {
ccVertex3F v = originalVertex(ccp(i, j)); Vertex3F v = originalVertex(ccp(i, j));
Point vect = ccpSub(_position, ccp(v.x,v.y)); Point vect = ccpSub(_position, ccp(v.x,v.y));
float r = ccpLength(vect); float r = ccpLength(vect);
@ -652,7 +652,7 @@ void Shaky3D::update(float time)
{ {
for (j = 0; j < (_gridSize.height+1); ++j) for (j = 0; j < (_gridSize.height+1); ++j)
{ {
ccVertex3F v = originalVertex(ccp(i ,j)); Vertex3F v = originalVertex(ccp(i ,j));
v.x += (rand() % (_randrange*2)) - _randrange; v.x += (rand() % (_randrange*2)) - _randrange;
v.y += (rand() % (_randrange*2)) - _randrange; v.y += (rand() % (_randrange*2)) - _randrange;
if (_shakeZ) if (_shakeZ)
@ -740,7 +740,7 @@ void Liquid::update(float time)
{ {
for (j = 1; j < _gridSize.height; ++j) for (j = 1; j < _gridSize.height; ++j)
{ {
ccVertex3F v = originalVertex(ccp(i, j)); Vertex3F v = originalVertex(ccp(i, j));
v.x = (v.x + (sinf(time * (float)M_PI * _waves * 2 + v.x * .01f) * _amplitude * _amplitudeRate)); v.x = (v.x + (sinf(time * (float)M_PI * _waves * 2 + v.x * .01f) * _amplitude * _amplitudeRate));
v.y = (v.y + (sinf(time * (float)M_PI * _waves * 2 + v.y * .01f) * _amplitude * _amplitudeRate)); v.y = (v.y + (sinf(time * (float)M_PI * _waves * 2 + v.y * .01f) * _amplitude * _amplitudeRate));
setVertex(ccp(i, j), v); setVertex(ccp(i, j), v);
@ -825,7 +825,7 @@ void Waves::update(float time)
{ {
for (j = 0; j < _gridSize.height + 1; ++j) for (j = 0; j < _gridSize.height + 1; ++j)
{ {
ccVertex3F v = originalVertex(ccp(i, j)); Vertex3F v = originalVertex(ccp(i, j));
if (_vertical) if (_vertical)
{ {
@ -925,7 +925,7 @@ void Twirl::update(float time)
{ {
for (j = 0; j < (_gridSize.height+1); ++j) for (j = 0; j < (_gridSize.height+1); ++j)
{ {
ccVertex3F v = originalVertex(ccp(i ,j)); Vertex3F v = originalVertex(ccp(i ,j));
Point avg = ccp(i-(_gridSize.width/2.0f), j-(_gridSize.height/2.0f)); Point avg = ccp(i-(_gridSize.width/2.0f), j-(_gridSize.height/2.0f));
float r = ccpLength(avg); float r = ccpLength(avg);

8
cocos2dx/actions/CCActionInterval.cpp
View File

@ -2199,7 +2199,7 @@ bool TintTo::initWithDuration(float duration, GLubyte red, GLubyte green, GLubyt
{ {
if (ActionInterval::initWithDuration(duration)) if (ActionInterval::initWithDuration(duration))
{ {
_to = ccc3(red, green, blue); _to = Color3B(red, green, blue);
return true; return true;
} }
@ -2260,7 +2260,7 @@ void TintTo::update(float time)
RGBAProtocol *pRGBAProtocol = dynamic_cast<RGBAProtocol*>(_target); RGBAProtocol *pRGBAProtocol = dynamic_cast<RGBAProtocol*>(_target);
if (pRGBAProtocol) if (pRGBAProtocol)
{ {
pRGBAProtocol->setColor(ccc3(GLubyte(_from.r + (_to.r - _from.r) * time), pRGBAProtocol->setColor(Color3B(GLubyte(_from.r + (_to.r - _from.r) * time),
(GLbyte)(_from.g + (_to.g - _from.g) * time), (GLbyte)(_from.g + (_to.g - _from.g) * time),
(GLbyte)(_from.b + (_to.b - _from.b) * time))); (GLbyte)(_from.b + (_to.b - _from.b) * time)));
} }
@ -2332,7 +2332,7 @@ void TintBy::startWithTarget(Node *pTarget)
RGBAProtocol *pRGBAProtocol = dynamic_cast<RGBAProtocol*>(pTarget); RGBAProtocol *pRGBAProtocol = dynamic_cast<RGBAProtocol*>(pTarget);
if (pRGBAProtocol) if (pRGBAProtocol)
{ {
ccColor3B color = pRGBAProtocol->getColor(); Color3B color = pRGBAProtocol->getColor();
_fromR = color.r; _fromR = color.r;
_fromG = color.g; _fromG = color.g;
_fromB = color.b; _fromB = color.b;
@ -2344,7 +2344,7 @@ void TintBy::update(float time)
RGBAProtocol *pRGBAProtocol = dynamic_cast<RGBAProtocol*>(_target); RGBAProtocol *pRGBAProtocol = dynamic_cast<RGBAProtocol*>(_target);
if (pRGBAProtocol) if (pRGBAProtocol)
{ {
pRGBAProtocol->setColor(ccc3((GLubyte)(_fromR + _deltaR * time), pRGBAProtocol->setColor(Color3B((GLubyte)(_fromR + _deltaR * time),
(GLubyte)(_fromG + _deltaG * time), (GLubyte)(_fromG + _deltaG * time),
(GLubyte)(_fromB + _deltaB * time))); (GLubyte)(_fromB + _deltaB * time)));
} }

4
cocos2dx/actions/CCActionInterval.h
View File

@ -727,8 +727,8 @@ public:
/** creates an action with duration and color */ /** creates an action with duration and color */
static TintTo* create(float duration, GLubyte red, GLubyte green, GLubyte blue); static TintTo* create(float duration, GLubyte red, GLubyte green, GLubyte blue);
protected: protected:
ccColor3B _to; Color3B _to;
ccColor3B _from; Color3B _from;
}; };
/** @brief Tints a Node that implements the NodeRGB protocol from current tint to a custom one. /** @brief Tints a Node that implements the NodeRGB protocol from current tint to a custom one.

2
cocos2dx/actions/CCActionPageTurn3D.cpp
View File

@ -77,7 +77,7 @@ void PageTurn3D::update(float time)
for (int j = 0; j <= _gridSize.height; ++j) for (int j = 0; j <= _gridSize.height; ++j)
{ {
// Get original vertex // Get original vertex
ccVertex3F p = originalVertex(ccp(i ,j)); Vertex3F p = originalVertex(ccp(i ,j));
float R = sqrtf((p.x * p.x) + ((p.y - ay) * (p.y - ay))); float R = sqrtf((p.x * p.x) + ((p.y - ay) * (p.y - ay)));
float r = R * sinTheta; float r = R * sinTheta;

26
cocos2dx/actions/CCActionTiledGrid.cpp
View File

@ -114,7 +114,7 @@ void ShakyTiles3D::update(float time)
{ {
for (j = 0; j < _gridSize.height; ++j) for (j = 0; j < _gridSize.height; ++j)
{ {
ccQuad3 coords = originalTile(ccp(i, j)); Quad3 coords = originalTile(ccp(i, j));
// X // X
coords.bl.x += ( rand() % (_randrange*2) ) - _randrange; coords.bl.x += ( rand() % (_randrange*2) ) - _randrange;
@ -219,7 +219,7 @@ void ShatteredTiles3D::update(float time)
{ {
for (j = 0; j < _gridSize.height; ++j) for (j = 0; j < _gridSize.height; ++j)
{ {
ccQuad3 coords = originalTile(ccp(i ,j)); Quad3 coords = originalTile(ccp(i ,j));
// X // X
coords.bl.x += ( rand() % (_randrange*2) ) - _randrange; coords.bl.x += ( rand() % (_randrange*2) ) - _randrange;
@ -347,7 +347,7 @@ Size ShuffleTiles::getDelta(const Size& pos) const
void ShuffleTiles::placeTile(const Point& pos, Tile *t) void ShuffleTiles::placeTile(const Point& pos, Tile *t)
{ {
ccQuad3 coords = originalTile(pos); Quad3 coords = originalTile(pos);
Point step = _target->getGrid()->getStep(); Point step = _target->getGrid()->getStep();
coords.bl.x += (int)(t->position.x * step.x); coords.bl.x += (int)(t->position.x * step.x);
@ -470,14 +470,14 @@ void FadeOutTRTiles::turnOnTile(const Point& pos)
void FadeOutTRTiles::turnOffTile(const Point& pos) void FadeOutTRTiles::turnOffTile(const Point& pos)
{ {
ccQuad3 coords; Quad3 coords;
memset(&coords, 0, sizeof(ccQuad3)); memset(&coords, 0, sizeof(Quad3));
setTile(pos, coords); setTile(pos, coords);
} }
void FadeOutTRTiles::transformTile(const Point& pos, float distance) void FadeOutTRTiles::transformTile(const Point& pos, float distance)
{ {
ccQuad3 coords = originalTile(pos); Quad3 coords = originalTile(pos);
Point step = _target->getGrid()->getStep(); Point step = _target->getGrid()->getStep();
coords.bl.x += (step.x / 2) * (1.0f - distance); coords.bl.x += (step.x / 2) * (1.0f - distance);
@ -604,7 +604,7 @@ float FadeOutUpTiles::testFunc(const Size& pos, float time)
void FadeOutUpTiles::transformTile(const Point& pos, float distance) void FadeOutUpTiles::transformTile(const Point& pos, float distance)
{ {
ccQuad3 coords = originalTile(pos); Quad3 coords = originalTile(pos);
Point step = _target->getGrid()->getStep(); Point step = _target->getGrid()->getStep();
coords.bl.y += (step.y / 2) * (1.0f - distance); coords.bl.y += (step.y / 2) * (1.0f - distance);
@ -759,9 +759,9 @@ void TurnOffTiles::turnOnTile(const Point& pos)
void TurnOffTiles::turnOffTile(const Point& pos) void TurnOffTiles::turnOffTile(const Point& pos)
{ {
ccQuad3 coords; Quad3 coords;
memset(&coords, 0, sizeof(ccQuad3)); memset(&coords, 0, sizeof(Quad3));
setTile(pos, coords); setTile(pos, coords);
} }
@ -883,7 +883,7 @@ void WavesTiles3D::update(float time)
{ {
for( j = 0; j < _gridSize.height; j++ ) for( j = 0; j < _gridSize.height; j++ )
{ {
ccQuad3 coords = originalTile(ccp(i, j)); Quad3 coords = originalTile(ccp(i, j));
coords.bl.z = (sinf(time * (float)M_PI *_waves * 2 + coords.bl.z = (sinf(time * (float)M_PI *_waves * 2 +
(coords.bl.y+coords.bl.x) * .01f) * _amplitude * _amplitudeRate ); (coords.bl.y+coords.bl.x) * .01f) * _amplitude * _amplitudeRate );
@ -972,7 +972,7 @@ void JumpTiles3D::update(float time)
{ {
for( j = 0; j < _gridSize.height; j++ ) for( j = 0; j < _gridSize.height; j++ )
{ {
ccQuad3 coords = originalTile(ccp(i, j)); Quad3 coords = originalTile(ccp(i, j));
if ( ((i+j) % 2) == 0 ) if ( ((i+j) % 2) == 0 )
{ {
@ -1065,7 +1065,7 @@ void SplitRows::update(float time)
for (j = 0; j < _gridSize.height; ++j) for (j = 0; j < _gridSize.height; ++j)
{ {
ccQuad3 coords = originalTile(ccp(0, j)); Quad3 coords = originalTile(ccp(0, j));
float direction = 1; float direction = 1;
if ( (j % 2 ) == 0 ) if ( (j % 2 ) == 0 )
@ -1151,7 +1151,7 @@ void SplitCols::update(float time)
for (i = 0; i < _gridSize.width; ++i) for (i = 0; i < _gridSize.width; ++i)
{ {
ccQuad3 coords = originalTile(ccp(i, 0)); Quad3 coords = originalTile(ccp(i, 0));
float direction = 1; float direction = 1;
if ( (i % 2 ) == 0 ) if ( (i % 2 ) == 0 )

14
cocos2dx/base_nodes/CCAtlasNode.cpp
View File

@ -87,7 +87,7 @@ bool AtlasNode::initWithTexture(Texture2D* texture, unsigned int tileWidth, unsi
_itemWidth = tileWidth; _itemWidth = tileWidth;
_itemHeight = tileHeight; _itemHeight = tileHeight;
_colorUnmodified = ccWHITE; _colorUnmodified = Color3B::white;
_isOpacityModifyRGB = true; _isOpacityModifyRGB = true;
_blendFunc.src = CC_BLEND_SRC; _blendFunc.src = CC_BLEND_SRC;
@ -152,7 +152,7 @@ void AtlasNode::draw(void)
// AtlasNode - RGBA protocol // AtlasNode - RGBA protocol
const ccColor3B& AtlasNode::getColor() const const Color3B& AtlasNode::getColor() const
{ {
if(_isOpacityModifyRGB) if(_isOpacityModifyRGB)
{ {
@ -161,9 +161,9 @@ const ccColor3B& AtlasNode::getColor() const
return NodeRGBA::getColor(); return NodeRGBA::getColor();
} }
void AtlasNode::setColor(const ccColor3B& color3) void AtlasNode::setColor(const Color3B& color3)
{ {
ccColor3B tmp = color3; Color3B tmp = color3;
_colorUnmodified = color3; _colorUnmodified = color3;
if( _isOpacityModifyRGB ) if( _isOpacityModifyRGB )
@ -186,7 +186,7 @@ void AtlasNode::setOpacity(GLubyte opacity)
void AtlasNode::setOpacityModifyRGB(bool bValue) void AtlasNode::setOpacityModifyRGB(bool bValue)
{ {
ccColor3B oldColor = this->getColor(); Color3B oldColor = this->getColor();
_isOpacityModifyRGB = bValue; _isOpacityModifyRGB = bValue;
this->setColor(oldColor); this->setColor(oldColor);
} }
@ -208,12 +208,12 @@ void AtlasNode::setIgnoreContentScaleFactor(bool bIgnoreContentScaleFactor)
// AtlasNode - CocosNodeTexture protocol // AtlasNode - CocosNodeTexture protocol
const ccBlendFunc& AtlasNode::getBlendFunc() const const BlendFunc& AtlasNode::getBlendFunc() const
{ {
return _blendFunc; return _blendFunc;
} }
void AtlasNode::setBlendFunc(const ccBlendFunc &blendFunc) void AtlasNode::setBlendFunc(const BlendFunc &blendFunc)
{ {
_blendFunc = blendFunc; _blendFunc = blendFunc;
} }

8
cocos2dx/base_nodes/CCAtlasNode.h
View File

@ -62,14 +62,14 @@ protected:
//! height of each char //! height of each char
unsigned int _itemHeight; unsigned int _itemHeight;
ccColor3B _colorUnmodified; Color3B _colorUnmodified;
CC_PROPERTY(TextureAtlas*, _textureAtlas, TextureAtlas); CC_PROPERTY(TextureAtlas*, _textureAtlas, TextureAtlas);
// protocol variables // protocol variables
bool _isOpacityModifyRGB; bool _isOpacityModifyRGB;
CC_PROPERTY_PASS_BY_REF(ccBlendFunc, _blendFunc, BlendFunc); CC_PROPERTY_PASS_BY_REF(BlendFunc, _blendFunc, BlendFunc);
// quads to draw // quads to draw
CC_PROPERTY(unsigned int, _quadsToDraw, QuadsToDraw); CC_PROPERTY(unsigned int, _quadsToDraw, QuadsToDraw);
@ -109,8 +109,8 @@ public:
virtual bool isOpacityModifyRGB() const; virtual bool isOpacityModifyRGB() const;
virtual void setOpacityModifyRGB(bool isOpacityModifyRGB); virtual void setOpacityModifyRGB(bool isOpacityModifyRGB);
virtual const ccColor3B& getColor(void) const; virtual const Color3B& getColor(void) const;
virtual void setColor(const ccColor3B& color); virtual void setColor(const Color3B& color);
virtual void setOpacity(GLubyte opacity); virtual void setOpacity(GLubyte opacity);
private : private :

16
cocos2dx/base_nodes/CCNode.cpp
View File

@ -1349,8 +1349,8 @@ void Node::removeAllComponents()
NodeRGBA::NodeRGBA() NodeRGBA::NodeRGBA()
: _displayedOpacity(255) : _displayedOpacity(255)
, _realOpacity(255) , _realOpacity(255)
, _displayedColor(ccWHITE) , _displayedColor(Color3B::white)
, _realColor(ccWHITE) , _realColor(Color3B::white)
, _cascadeColorEnabled(false) , _cascadeColorEnabled(false)
, _cascadeOpacityEnabled(false) , _cascadeOpacityEnabled(false)
{} {}
@ -1362,7 +1362,7 @@ bool NodeRGBA::init()
if (Node::init()) if (Node::init())
{ {
_displayedOpacity = _realOpacity = 255; _displayedOpacity = _realOpacity = 255;
_displayedColor = _realColor = ccWHITE; _displayedColor = _realColor = Color3B::white;
_cascadeOpacityEnabled = _cascadeColorEnabled = false; _cascadeOpacityEnabled = _cascadeColorEnabled = false;
return true; return true;
} }
@ -1423,23 +1423,23 @@ void NodeRGBA::setCascadeOpacityEnabled(bool cascadeOpacityEnabled)
_cascadeOpacityEnabled = cascadeOpacityEnabled; _cascadeOpacityEnabled = cascadeOpacityEnabled;
} }
const ccColor3B& NodeRGBA::getColor(void) const const Color3B& NodeRGBA::getColor(void) const
{ {
return _realColor; return _realColor;
} }
const ccColor3B& NodeRGBA::getDisplayedColor() const const Color3B& NodeRGBA::getDisplayedColor() const
{ {
return _displayedColor; return _displayedColor;
} }
void NodeRGBA::setColor(const ccColor3B& color) void NodeRGBA::setColor(const Color3B& color)
{ {
_displayedColor = _realColor = color; _displayedColor = _realColor = color;
if (_cascadeColorEnabled) if (_cascadeColorEnabled)
{ {
ccColor3B parentColor = ccWHITE; Color3B parentColor = Color3B::white;
RGBAProtocol *parent = dynamic_cast<RGBAProtocol*>(_parent); RGBAProtocol *parent = dynamic_cast<RGBAProtocol*>(_parent);
if (parent && parent->isCascadeColorEnabled()) if (parent && parent->isCascadeColorEnabled())
{ {
@ -1450,7 +1450,7 @@ void NodeRGBA::setColor(const ccColor3B& color)
} }
} }
void NodeRGBA::updateDisplayedColor(const ccColor3B& parentColor) void NodeRGBA::updateDisplayedColor(const Color3B& parentColor)
{ {
_displayedColor.r = _realColor.r * parentColor.r/255.0; _displayedColor.r = _realColor.r * parentColor.r/255.0;
_displayedColor.g = _realColor.g * parentColor.g/255.0; _displayedColor.g = _realColor.g * parentColor.g/255.0;

12
cocos2dx/base_nodes/CCNode.h
View File

@ -1435,10 +1435,10 @@ public:
virtual bool isCascadeOpacityEnabled() const; virtual bool isCascadeOpacityEnabled() const;
virtual void setCascadeOpacityEnabled(bool cascadeOpacityEnabled); virtual void setCascadeOpacityEnabled(bool cascadeOpacityEnabled);
virtual const ccColor3B& getColor(void) const; virtual const Color3B& getColor(void) const;
virtual const ccColor3B& getDisplayedColor() const; virtual const Color3B& getDisplayedColor() const;
virtual void setColor(const ccColor3B& color); virtual void setColor(const Color3B& color);
virtual void updateDisplayedColor(const ccColor3B& parentColor); virtual void updateDisplayedColor(const Color3B& parentColor);
virtual bool isCascadeColorEnabled() const; virtual bool isCascadeColorEnabled() const;
virtual void setCascadeColorEnabled(bool cascadeColorEnabled); virtual void setCascadeColorEnabled(bool cascadeColorEnabled);
@ -1448,8 +1448,8 @@ public:
protected: protected:
GLubyte _displayedOpacity; GLubyte _displayedOpacity;
GLubyte _realOpacity; GLubyte _realOpacity;
ccColor3B _displayedColor; Color3B _displayedColor;
ccColor3B _realColor; Color3B _realColor;
bool _cascadeColorEnabled; bool _cascadeColorEnabled;
bool _cascadeOpacityEnabled; bool _cascadeOpacityEnabled;
}; };

48
cocos2dx/ccTypes.cpp Normal file
View File

@ -0,0 +1,48 @@
/****************************************************************************
Copyright (c) 2013 cocos2d-x.org
http://www.cocos2d-x.org
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in
all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
THE SOFTWARE.
****************************************************************************/
#include "include/ccTypes.h"
NS_CC_BEGIN
const Color3B Color3B::white(255,255,255);
const Color3B Color3B::yellow(255,255,0);
const Color3B Color3B::green(0,255,0);
const Color3B Color3B::blue(0,0,255);
const Color3B Color3B::red(255,0,0);
const Color3B Color3B::magenta(255,0,255);
const Color3B Color3B::black(0,0,0);
const Color3B Color3B::orange(255,127,0);
const Color3B Color3B::gray(166,166,166);
Color4B::Color4B(const Color4F &color4F)
: r((GLubyte)(color4F.r * 255.0f)),
g((GLubyte)(color4F.g * 255.0f)),
b((GLubyte)(color4F.b * 255.0f)),
a((GLubyte)(color4F.a * 255.0f))
{}
const BlendFunc BlendFunc::blendFuncDisable = {GL_ONE, GL_ZERO};
NS_CC_END

242
cocos2dx/draw_nodes/CCDrawNode.cpp
View File

@ -27,69 +27,69 @@
NS_CC_BEGIN NS_CC_BEGIN
// ccVertex2F == CGPoint in 32-bits, but not in 64-bits (OS X) // Vertex2F == CGPoint in 32-bits, but not in 64-bits (OS X)
// that's why the "v2f" functions are needed // that's why the "v2f" functions are needed
static ccVertex2F v2fzero = {0.0f,0.0f}; static Vertex2F v2fzero(0.0f,0.0f);
static inline ccVertex2F v2f(float x, float y) static inline Vertex2F v2f(float x, float y)
{ {
ccVertex2F ret = {x, y}; Vertex2F ret(x, y);
return ret; return ret;
} }
static inline ccVertex2F v2fadd(const ccVertex2F &v0, const ccVertex2F &v1) static inline Vertex2F v2fadd(const Vertex2F &v0, const Vertex2F &v1)
{ {
return v2f(v0.x+v1.x, v0.y+v1.y); return v2f(v0.x+v1.x, v0.y+v1.y);
} }
static inline ccVertex2F v2fsub(const ccVertex2F &v0, const ccVertex2F &v1) static inline Vertex2F v2fsub(const Vertex2F &v0, const Vertex2F &v1)
{ {
return v2f(v0.x-v1.x, v0.y-v1.y); return v2f(v0.x-v1.x, v0.y-v1.y);
} }
static inline ccVertex2F v2fmult(const ccVertex2F &v, float s) static inline Vertex2F v2fmult(const Vertex2F &v, float s)
{ {
return v2f(v.x * s, v.y * s); return v2f(v.x * s, v.y * s);
} }
static inline ccVertex2F v2fperp(const ccVertex2F &p0) static inline Vertex2F v2fperp(const Vertex2F &p0)
{ {
return v2f(-p0.y, p0.x); return v2f(-p0.y, p0.x);
} }
static inline ccVertex2F v2fneg(const ccVertex2F &p0) static inline Vertex2F v2fneg(const Vertex2F &p0)
{ {
return v2f(-p0.x, - p0.y); return v2f(-p0.x, - p0.y);
} }
static inline float v2fdot(const ccVertex2F &p0, const ccVertex2F &p1) static inline float v2fdot(const Vertex2F &p0, const Vertex2F &p1)
{ {
return p0.x * p1.x + p0.y * p1.y; return p0.x * p1.x + p0.y * p1.y;
} }
static inline ccVertex2F v2fforangle(float _a_) static inline Vertex2F v2fforangle(float _a_)
{ {
return v2f(cosf(_a_), sinf(_a_)); return v2f(cosf(_a_), sinf(_a_));
} }
static inline ccVertex2F v2fnormalize(const ccVertex2F &p) static inline Vertex2F v2fnormalize(const Vertex2F &p)
{ {
Point r = ccpNormalize(ccp(p.x, p.y)); Point r = ccpNormalize(ccp(p.x, p.y));
return v2f(r.x, r.y); return v2f(r.x, r.y);
} }
static inline ccVertex2F __v2f(const Point &v) static inline Vertex2F __v2f(const Point &v)
{ {
//#ifdef __LP64__ //#ifdef __LP64__
return v2f(v.x, v.y); return v2f(v.x, v.y);
// #else // #else
// return * ((ccVertex2F*) &v); // return * ((Vertex2F*) &v);
// #endif // #endif
} }
static inline ccTex2F __t(const ccVertex2F &v) static inline Tex2F __t(const Vertex2F &v)
{ {
return *(ccTex2F*)&v; return *(Tex2F*)&v;
} }
// implementation of DrawNode // implementation of DrawNode
@ -140,7 +140,7 @@ void DrawNode::ensureCapacity(unsigned int count)
if(_bufferCount + count > _bufferCapacity) if(_bufferCount + count > _bufferCapacity)
{ {
_bufferCapacity += MAX(_bufferCapacity, count); _bufferCapacity += MAX(_bufferCapacity, count);
_buffer = (ccV2F_C4B_T2F*)realloc(_buffer, _bufferCapacity*sizeof(ccV2F_C4B_T2F)); _buffer = (V2F_C4B_T2F*)realloc(_buffer, _bufferCapacity*sizeof(V2F_C4B_T2F));
} }
} }
@ -160,16 +160,16 @@ bool DrawNode::init()
glGenBuffers(1, &_vbo); glGenBuffers(1, &_vbo);
glBindBuffer(GL_ARRAY_BUFFER, _vbo); glBindBuffer(GL_ARRAY_BUFFER, _vbo);
glBufferData(GL_ARRAY_BUFFER, sizeof(ccV2F_C4B_T2F)* _bufferCapacity, _buffer, GL_STREAM_DRAW); glBufferData(GL_ARRAY_BUFFER, sizeof(V2F_C4B_T2F)* _bufferCapacity, _buffer, GL_STREAM_DRAW);
glEnableVertexAttribArray(kVertexAttrib_Position); glEnableVertexAttribArray(kVertexAttrib_Position);
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, sizeof(ccV2F_C4B_T2F), (GLvoid *)offsetof(ccV2F_C4B_T2F, vertices)); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, sizeof(V2F_C4B_T2F), (GLvoid *)offsetof(V2F_C4B_T2F, vertices));
glEnableVertexAttribArray(kVertexAttrib_Color); glEnableVertexAttribArray(kVertexAttrib_Color);
glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, sizeof(ccV2F_C4B_T2F), (GLvoid *)offsetof(ccV2F_C4B_T2F, colors)); glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, sizeof(V2F_C4B_T2F), (GLvoid *)offsetof(V2F_C4B_T2F, colors));
glEnableVertexAttribArray(kVertexAttrib_TexCoords); glEnableVertexAttribArray(kVertexAttrib_TexCoords);
glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, sizeof(ccV2F_C4B_T2F), (GLvoid *)offsetof(ccV2F_C4B_T2F, texCoords)); glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, sizeof(V2F_C4B_T2F), (GLvoid *)offsetof(V2F_C4B_T2F, texCoords));
glBindBuffer(GL_ARRAY_BUFFER, 0); glBindBuffer(GL_ARRAY_BUFFER, 0);
@ -189,7 +189,7 @@ void DrawNode::render()
if (_dirty) if (_dirty)
{ {
glBindBuffer(GL_ARRAY_BUFFER, _vbo); glBindBuffer(GL_ARRAY_BUFFER, _vbo);
glBufferData(GL_ARRAY_BUFFER, sizeof(ccV2F_C4B_T2F)*_bufferCapacity, _buffer, GL_STREAM_DRAW); glBufferData(GL_ARRAY_BUFFER, sizeof(V2F_C4B_T2F)*_bufferCapacity, _buffer, GL_STREAM_DRAW);
_dirty = false; _dirty = false;
} }
#if CC_TEXTURE_ATLAS_USE_VAO #if CC_TEXTURE_ATLAS_USE_VAO
@ -198,13 +198,13 @@ void DrawNode::render()
ccGLEnableVertexAttribs(kVertexAttribFlag_PosColorTex); ccGLEnableVertexAttribs(kVertexAttribFlag_PosColorTex);
glBindBuffer(GL_ARRAY_BUFFER, _vbo); glBindBuffer(GL_ARRAY_BUFFER, _vbo);
// vertex // vertex
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, sizeof(ccV2F_C4B_T2F), (GLvoid *)offsetof(ccV2F_C4B_T2F, vertices)); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, sizeof(V2F_C4B_T2F), (GLvoid *)offsetof(V2F_C4B_T2F, vertices));
// color // color
glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, sizeof(ccV2F_C4B_T2F), (GLvoid *)offsetof(ccV2F_C4B_T2F, colors)); glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, sizeof(V2F_C4B_T2F), (GLvoid *)offsetof(V2F_C4B_T2F, colors));
// texcood // texcood
glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, sizeof(ccV2F_C4B_T2F), (GLvoid *)offsetof(ccV2F_C4B_T2F, texCoords)); glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, sizeof(V2F_C4B_T2F), (GLvoid *)offsetof(V2F_C4B_T2F, texCoords));
#endif #endif
glDrawArrays(GL_TRIANGLES, 0, _bufferCount); glDrawArrays(GL_TRIANGLES, 0, _bufferCount);
@ -224,19 +224,19 @@ void DrawNode::draw()
render(); render();
} }
void DrawNode::drawDot(const Point &pos, float radius, const ccColor4F &color) void DrawNode::drawDot(const Point &pos, float radius, const Color4F &color)
{ {
unsigned int vertex_count = 2*3; unsigned int vertex_count = 2*3;
ensureCapacity(vertex_count); ensureCapacity(vertex_count);
ccV2F_C4B_T2F a = {{pos.x - radius, pos.y - radius}, ccc4BFromccc4F(color), {-1.0, -1.0} }; V2F_C4B_T2F a = {Vertex2F(pos.x - radius, pos.y - radius), Color4B(color), Tex2F(-1.0, -1.0) };
ccV2F_C4B_T2F b = {{pos.x - radius, pos.y + radius}, ccc4BFromccc4F(color), {-1.0, 1.0} }; V2F_C4B_T2F b = {Vertex2F(pos.x - radius, pos.y + radius), Color4B(color), Tex2F(-1.0, 1.0) };
ccV2F_C4B_T2F c = {{pos.x + radius, pos.y + radius}, ccc4BFromccc4F(color), { 1.0, 1.0} }; V2F_C4B_T2F c = {Vertex2F(pos.x + radius, pos.y + radius), Color4B(color), Tex2F( 1.0, 1.0) };
ccV2F_C4B_T2F d = {{pos.x + radius, pos.y - radius}, ccc4BFromccc4F(color), { 1.0, -1.0} }; V2F_C4B_T2F d = {Vertex2F(pos.x + radius, pos.y - radius), Color4B(color), Tex2F( 1.0, -1.0) };
ccV2F_C4B_T2F_Triangle *triangles = (ccV2F_C4B_T2F_Triangle *)(_buffer + _bufferCount); V2F_C4B_T2F_Triangle *triangles = (V2F_C4B_T2F_Triangle *)(_buffer + _bufferCount);
ccV2F_C4B_T2F_Triangle triangle0 = {a, b, c}; V2F_C4B_T2F_Triangle triangle0 = {a, b, c};
ccV2F_C4B_T2F_Triangle triangle1 = {a, c, d}; V2F_C4B_T2F_Triangle triangle1 = {a, c, d};
triangles[0] = triangle0; triangles[0] = triangle0;
triangles[1] = triangle1; triangles[1] = triangle1;
@ -245,71 +245,71 @@ void DrawNode::drawDot(const Point &pos, float radius, const ccColor4F &color)
_dirty = true; _dirty = true;
} }
void DrawNode::drawSegment(const Point &from, const Point &to, float radius, const ccColor4F &color) void DrawNode::drawSegment(const Point &from, const Point &to, float radius, const Color4F &color)
{ {
unsigned int vertex_count = 6*3; unsigned int vertex_count = 6*3;
ensureCapacity(vertex_count); ensureCapacity(vertex_count);
ccVertex2F a = __v2f(from); Vertex2F a = __v2f(from);
ccVertex2F b = __v2f(to); Vertex2F b = __v2f(to);
ccVertex2F n = v2fnormalize(v2fperp(v2fsub(b, a))); Vertex2F n = v2fnormalize(v2fperp(v2fsub(b, a)));
ccVertex2F t = v2fperp(n); Vertex2F t = v2fperp(n);
ccVertex2F nw = v2fmult(n, radius); Vertex2F nw = v2fmult(n, radius);
ccVertex2F tw = v2fmult(t, radius); Vertex2F tw = v2fmult(t, radius);
ccVertex2F v0 = v2fsub(b, v2fadd(nw, tw)); Vertex2F v0 = v2fsub(b, v2fadd(nw, tw));
ccVertex2F v1 = v2fadd(b, v2fsub(nw, tw)); Vertex2F v1 = v2fadd(b, v2fsub(nw, tw));
ccVertex2F v2 = v2fsub(b, nw); Vertex2F v2 = v2fsub(b, nw);
ccVertex2F v3 = v2fadd(b, nw); Vertex2F v3 = v2fadd(b, nw);
ccVertex2F v4 = v2fsub(a, nw); Vertex2F v4 = v2fsub(a, nw);
ccVertex2F v5 = v2fadd(a, nw); Vertex2F v5 = v2fadd(a, nw);
ccVertex2F v6 = v2fsub(a, v2fsub(nw, tw)); Vertex2F v6 = v2fsub(a, v2fsub(nw, tw));
ccVertex2F v7 = v2fadd(a, v2fadd(nw, tw)); Vertex2F v7 = v2fadd(a, v2fadd(nw, tw));
ccV2F_C4B_T2F_Triangle *triangles = (ccV2F_C4B_T2F_Triangle *)(_buffer + _bufferCount); V2F_C4B_T2F_Triangle *triangles = (V2F_C4B_T2F_Triangle *)(_buffer + _bufferCount);
ccV2F_C4B_T2F_Triangle triangles0 = { V2F_C4B_T2F_Triangle triangles0 = {
{v0, ccc4BFromccc4F(color), __t(v2fneg(v2fadd(n, t)))}, {v0, Color4B(color), __t(v2fneg(v2fadd(n, t)))},
{v1, ccc4BFromccc4F(color), __t(v2fsub(n, t))}, {v1, Color4B(color), __t(v2fsub(n, t))},
{v2, ccc4BFromccc4F(color), __t(v2fneg(n))}, {v2, Color4B(color), __t(v2fneg(n))},
}; };
triangles[0] = triangles0; triangles[0] = triangles0;
ccV2F_C4B_T2F_Triangle triangles1 = { V2F_C4B_T2F_Triangle triangles1 = {
{v3, ccc4BFromccc4F(color), __t(n)}, {v3, Color4B(color), __t(n)},
{v1, ccc4BFromccc4F(color), __t(v2fsub(n, t))}, {v1, Color4B(color), __t(v2fsub(n, t))},
{v2, ccc4BFromccc4F(color), __t(v2fneg(n))}, {v2, Color4B(color), __t(v2fneg(n))},
}; };
triangles[1] = triangles1; triangles[1] = triangles1;
ccV2F_C4B_T2F_Triangle triangles2 = { V2F_C4B_T2F_Triangle triangles2 = {
{v3, ccc4BFromccc4F(color), __t(n)}, {v3, Color4B(color), __t(n)},
{v4, ccc4BFromccc4F(color), __t(v2fneg(n))}, {v4, Color4B(color), __t(v2fneg(n))},
{v2, ccc4BFromccc4F(color), __t(v2fneg(n))}, {v2, Color4B(color), __t(v2fneg(n))},
}; };
triangles[2] = triangles2; triangles[2] = triangles2;
ccV2F_C4B_T2F_Triangle triangles3 = { V2F_C4B_T2F_Triangle triangles3 = {
{v3, ccc4BFromccc4F(color), __t(n)}, {v3, Color4B(color), __t(n)},
{v4, ccc4BFromccc4F(color), __t(v2fneg(n))}, {v4, Color4B(color), __t(v2fneg(n))},
{v5, ccc4BFromccc4F(color), __t(n) }, {v5, Color4B(color), __t(n) },
}; };
triangles[3] = triangles3; triangles[3] = triangles3;
ccV2F_C4B_T2F_Triangle triangles4 = { V2F_C4B_T2F_Triangle triangles4 = {
{v6, ccc4BFromccc4F(color), __t(v2fsub(t, n))}, {v6, Color4B(color), __t(v2fsub(t, n))},
{v4, ccc4BFromccc4F(color), __t(v2fneg(n)) }, {v4, Color4B(color), __t(v2fneg(n)) },
{v5, ccc4BFromccc4F(color), __t(n)}, {v5, Color4B(color), __t(n)},
}; };
triangles[4] = triangles4; triangles[4] = triangles4;
ccV2F_C4B_T2F_Triangle triangles5 = { V2F_C4B_T2F_Triangle triangles5 = {
{v6, ccc4BFromccc4F(color), __t(v2fsub(t, n))}, {v6, Color4B(color), __t(v2fsub(t, n))},
{v7, ccc4BFromccc4F(color), __t(v2fadd(n, t))}, {v7, Color4B(color), __t(v2fadd(n, t))},
{v5, ccc4BFromccc4F(color), __t(n)}, {v5, Color4B(color), __t(n)},
}; };
triangles[5] = triangles5; triangles[5] = triangles5;
@ -318,22 +318,22 @@ void DrawNode::drawSegment(const Point &from, const Point &to, float radius, con
_dirty = true; _dirty = true;
} }
void DrawNode::drawPolygon(Point *verts, unsigned int count, const ccColor4F &fillColor, float borderWidth, const ccColor4F &borderColor) void DrawNode::drawPolygon(Point *verts, unsigned int count, const Color4F &fillColor, float borderWidth, const Color4F &borderColor)
{ {
struct ExtrudeVerts {ccVertex2F offset, n;}; struct ExtrudeVerts {Vertex2F offset, n;};
struct ExtrudeVerts* extrude = (struct ExtrudeVerts*)malloc(sizeof(struct ExtrudeVerts)*count); struct ExtrudeVerts* extrude = (struct ExtrudeVerts*)malloc(sizeof(struct ExtrudeVerts)*count);
memset(extrude, 0, sizeof(struct ExtrudeVerts)*count); memset(extrude, 0, sizeof(struct ExtrudeVerts)*count);
for(unsigned int i = 0; i < count; i++) for(unsigned int i = 0; i < count; i++)
{ {
ccVertex2F v0 = __v2f(verts[(i-1+count)%count]); Vertex2F v0 = __v2f(verts[(i-1+count)%count]);
ccVertex2F v1 = __v2f(verts[i]); Vertex2F v1 = __v2f(verts[i]);
ccVertex2F v2 = __v2f(verts[(i+1)%count]); Vertex2F v2 = __v2f(verts[(i+1)%count]);
ccVertex2F n1 = v2fnormalize(v2fperp(v2fsub(v1, v0))); Vertex2F n1 = v2fnormalize(v2fperp(v2fsub(v1, v0)));
ccVertex2F n2 = v2fnormalize(v2fperp(v2fsub(v2, v1))); Vertex2F n2 = v2fnormalize(v2fperp(v2fsub(v2, v1)));
ccVertex2F offset = v2fmult(v2fadd(n1, n2), 1.0/(v2fdot(n1, n2) + 1.0)); Vertex2F offset = v2fmult(v2fadd(n1, n2), 1.0/(v2fdot(n1, n2) + 1.0));
struct ExtrudeVerts tmp = {offset, n2}; struct ExtrudeVerts tmp = {offset, n2};
extrude[i] = tmp; extrude[i] = tmp;
} }
@ -344,20 +344,20 @@ void DrawNode::drawPolygon(Point *verts, unsigned int count, const ccColor4F &fi
unsigned int vertex_count = 3*triangle_count; unsigned int vertex_count = 3*triangle_count;
ensureCapacity(vertex_count); ensureCapacity(vertex_count);
ccV2F_C4B_T2F_Triangle *triangles = (ccV2F_C4B_T2F_Triangle *)(_buffer + _bufferCount); V2F_C4B_T2F_Triangle *triangles = (V2F_C4B_T2F_Triangle *)(_buffer + _bufferCount);
ccV2F_C4B_T2F_Triangle *cursor = triangles; V2F_C4B_T2F_Triangle *cursor = triangles;
float inset = (outline == 0.0 ? 0.5 : 0.0); float inset = (outline == 0.0 ? 0.5 : 0.0);
for(unsigned int i = 0; i < count-2; i++) for(unsigned int i = 0; i < count-2; i++)
{ {
ccVertex2F v0 = v2fsub(__v2f(verts[0 ]), v2fmult(extrude[0 ].offset, inset)); Vertex2F v0 = v2fsub(__v2f(verts[0 ]), v2fmult(extrude[0 ].offset, inset));
ccVertex2F v1 = v2fsub(__v2f(verts[i+1]), v2fmult(extrude[i+1].offset, inset)); Vertex2F v1 = v2fsub(__v2f(verts[i+1]), v2fmult(extrude[i+1].offset, inset));
ccVertex2F v2 = v2fsub(__v2f(verts[i+2]), v2fmult(extrude[i+2].offset, inset)); Vertex2F v2 = v2fsub(__v2f(verts[i+2]), v2fmult(extrude[i+2].offset, inset));
ccV2F_C4B_T2F_Triangle tmp = { V2F_C4B_T2F_Triangle tmp = {
{v0, ccc4BFromccc4F(fillColor), __t(v2fzero)}, {v0, Color4B(fillColor), __t(v2fzero)},
{v1, ccc4BFromccc4F(fillColor), __t(v2fzero)}, {v1, Color4B(fillColor), __t(v2fzero)},
{v2, ccc4BFromccc4F(fillColor), __t(v2fzero)}, {v2, Color4B(fillColor), __t(v2fzero)},
}; };
*cursor++ = tmp; *cursor++ = tmp;
@ -366,52 +366,52 @@ void DrawNode::drawPolygon(Point *verts, unsigned int count, const ccColor4F &fi
for(unsigned int i = 0; i < count; i++) for(unsigned int i = 0; i < count; i++)
{ {
int j = (i+1)%count; int j = (i+1)%count;
ccVertex2F v0 = __v2f(verts[i]); Vertex2F v0 = __v2f(verts[i]);
ccVertex2F v1 = __v2f(verts[j]); Vertex2F v1 = __v2f(verts[j]);
ccVertex2F n0 = extrude[i].n; Vertex2F n0 = extrude[i].n;
ccVertex2F offset0 = extrude[i].offset; Vertex2F offset0 = extrude[i].offset;
ccVertex2F offset1 = extrude[j].offset; Vertex2F offset1 = extrude[j].offset;
if(outline) if(outline)
{ {
ccVertex2F inner0 = v2fsub(v0, v2fmult(offset0, borderWidth)); Vertex2F inner0 = v2fsub(v0, v2fmult(offset0, borderWidth));
ccVertex2F inner1 = v2fsub(v1, v2fmult(offset1, borderWidth)); Vertex2F inner1 = v2fsub(v1, v2fmult(offset1, borderWidth));
ccVertex2F outer0 = v2fadd(v0, v2fmult(offset0, borderWidth)); Vertex2F outer0 = v2fadd(v0, v2fmult(offset0, borderWidth));
ccVertex2F outer1 = v2fadd(v1, v2fmult(offset1, borderWidth)); Vertex2F outer1 = v2fadd(v1, v2fmult(offset1, borderWidth));
ccV2F_C4B_T2F_Triangle tmp1 = { V2F_C4B_T2F_Triangle tmp1 = {
{inner0, ccc4BFromccc4F(borderColor), __t(v2fneg(n0))}, {inner0, Color4B(borderColor), __t(v2fneg(n0))},
{inner1, ccc4BFromccc4F(borderColor), __t(v2fneg(n0))}, {inner1, Color4B(borderColor), __t(v2fneg(n0))},
{outer1, ccc4BFromccc4F(borderColor), __t(n0)} {outer1, Color4B(borderColor), __t(n0)}
}; };
*cursor++ = tmp1; *cursor++ = tmp1;
ccV2F_C4B_T2F_Triangle tmp2 = { V2F_C4B_T2F_Triangle tmp2 = {
{inner0, ccc4BFromccc4F(borderColor), __t(v2fneg(n0))}, {inner0, Color4B(borderColor), __t(v2fneg(n0))},
{outer0, ccc4BFromccc4F(borderColor), __t(n0)}, {outer0, Color4B(borderColor), __t(n0)},
{outer1, ccc4BFromccc4F(borderColor), __t(n0)} {outer1, Color4B(borderColor), __t(n0)}
}; };
*cursor++ = tmp2; *cursor++ = tmp2;
} }
else { else {
ccVertex2F inner0 = v2fsub(v0, v2fmult(offset0, 0.5)); Vertex2F inner0 = v2fsub(v0, v2fmult(offset0, 0.5));
ccVertex2F inner1 = v2fsub(v1, v2fmult(offset1, 0.5)); Vertex2F inner1 = v2fsub(v1, v2fmult(offset1, 0.5));
ccVertex2F outer0 = v2fadd(v0, v2fmult(offset0, 0.5)); Vertex2F outer0 = v2fadd(v0, v2fmult(offset0, 0.5));
ccVertex2F outer1 = v2fadd(v1, v2fmult(offset1, 0.5)); Vertex2F outer1 = v2fadd(v1, v2fmult(offset1, 0.5));
ccV2F_C4B_T2F_Triangle tmp1 = { V2F_C4B_T2F_Triangle tmp1 = {
{inner0, ccc4BFromccc4F(fillColor), __t(v2fzero)}, {inner0, Color4B(fillColor), __t(v2fzero)},
{inner1, ccc4BFromccc4F(fillColor), __t(v2fzero)}, {inner1, Color4B(fillColor), __t(v2fzero)},
{outer1, ccc4BFromccc4F(fillColor), __t(n0)} {outer1, Color4B(fillColor), __t(n0)}
}; };
*cursor++ = tmp1; *cursor++ = tmp1;
ccV2F_C4B_T2F_Triangle tmp2 = { V2F_C4B_T2F_Triangle tmp2 = {
{inner0, ccc4BFromccc4F(fillColor), __t(v2fzero)}, {inner0, Color4B(fillColor), __t(v2fzero)},
{outer0, ccc4BFromccc4F(fillColor), __t(n0)}, {outer0, Color4B(fillColor), __t(n0)},
{outer1, ccc4BFromccc4F(fillColor), __t(n0)} {outer1, Color4B(fillColor), __t(n0)}
}; };
*cursor++ = tmp2; *cursor++ = tmp2;
} }
@ -430,12 +430,12 @@ void DrawNode::clear()
_dirty = true; _dirty = true;
} }
const ccBlendFunc& DrawNode::getBlendFunc() const const BlendFunc& DrawNode::getBlendFunc() const
{ {
return _blendFunc; return _blendFunc;
} }
void DrawNode::setBlendFunc(const ccBlendFunc &blendFunc) void DrawNode::setBlendFunc(const BlendFunc &blendFunc)
{ {
_blendFunc = blendFunc; _blendFunc = blendFunc;
} }

14
cocos2dx/draw_nodes/CCDrawNode.h
View File

@ -49,9 +49,9 @@ protected:
unsigned int _bufferCapacity; unsigned int _bufferCapacity;
GLsizei _bufferCount; GLsizei _bufferCount;
ccV2F_C4B_T2F *_buffer; V2F_C4B_T2F *_buffer;
ccBlendFunc _blendFunc; BlendFunc _blendFunc;
bool _dirty; bool _dirty;
@ -63,19 +63,19 @@ public:
virtual void draw(); virtual void draw();
/** draw a dot at a position, with a given radius and color */ /** draw a dot at a position, with a given radius and color */
void drawDot(const Point &pos, float radius, const ccColor4F &color); void drawDot(const Point &pos, float radius, const Color4F &color);
/** draw a segment with a radius and color */ /** draw a segment with a radius and color */
void drawSegment(const Point &from, const Point &to, float radius, const ccColor4F &color); void drawSegment(const Point &from, const Point &to, float radius, const Color4F &color);
/** draw a polygon with a fill color and line color */ /** draw a polygon with a fill color and line color */
void drawPolygon(Point *verts, unsigned int count, const ccColor4F &fillColor, float borderWidth, const ccColor4F &borderColor); void drawPolygon(Point *verts, unsigned int count, const Color4F &fillColor, float borderWidth, const Color4F &borderColor);
/** Clear the geometry in the node's buffer. */ /** Clear the geometry in the node's buffer. */
void clear(); void clear();
const ccBlendFunc& getBlendFunc() const; const BlendFunc& getBlendFunc() const;
void setBlendFunc(const ccBlendFunc &blendFunc); void setBlendFunc(const BlendFunc &blendFunc);
DrawNode(); DrawNode();

46
cocos2dx/draw_nodes/CCDrawingPrimitives.cpp
View File

@ -56,7 +56,7 @@ NS_CC_BEGIN
static bool s_bInitialized = false; static bool s_bInitialized = false;
static GLProgram* s_pShader = NULL; static GLProgram* s_pShader = NULL;
static int s_nColorLocation = -1; static int s_nColorLocation = -1;
static ccColor4F s_tColor = {1.0f,1.0f,1.0f,1.0f}; static Color4F s_tColor(1.0f,1.0f,1.0f,1.0f);
static int s_nPointSizeLocation = -1; static int s_nPointSizeLocation = -1;
static GLfloat s_fPointSize = 1.0f; static GLfloat s_fPointSize = 1.0f;
@ -122,7 +122,7 @@ void ccDrawPoint( const Point& point )
{ {
lazy_init(); lazy_init();
ccVertex2F p; Vertex2F p;
p.x = point.x; p.x = point.x;
p.y = point.y; p.y = point.y;
@ -156,10 +156,10 @@ void ccDrawPoints( const Point *points, unsigned int numberOfPoints )
s_pShader->setUniformLocationWith1f(s_nPointSizeLocation, s_fPointSize); s_pShader->setUniformLocationWith1f(s_nPointSizeLocation, s_fPointSize);
// XXX: Mac OpenGL error. arrays can't go out of scope before draw is executed // XXX: Mac OpenGL error. arrays can't go out of scope before draw is executed
ccVertex2F* newPoints = new ccVertex2F[numberOfPoints]; Vertex2F* newPoints = new Vertex2F[numberOfPoints];
// iPhone and 32-bit machines optimization // iPhone and 32-bit machines optimization
if( sizeof(Point) == sizeof(ccVertex2F) ) if( sizeof(Point) == sizeof(Vertex2F) )
{ {
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
setGLBufferData((void*) points, numberOfPoints * sizeof(Point)); setGLBufferData((void*) points, numberOfPoints * sizeof(Point));
@ -178,7 +178,7 @@ void ccDrawPoints( const Point *points, unsigned int numberOfPoints )
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
// Suspect Emscripten won't be emitting 64-bit code for a while yet, // Suspect Emscripten won't be emitting 64-bit code for a while yet,
// but want to make sure this continues to work even if they do. // but want to make sure this continues to work even if they do.
setGLBufferData(newPoints, numberOfPoints * sizeof(ccVertex2F)); setGLBufferData(newPoints, numberOfPoints * sizeof(Vertex2F));
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0);
#else #else
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, newPoints); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, newPoints);
@ -197,9 +197,9 @@ void ccDrawLine( const Point& origin, const Point& destination )
{ {
lazy_init(); lazy_init();
ccVertex2F vertices[2] = { Vertex2F vertices[2] = {
{origin.x, origin.y}, Vertex2F(origin.x, origin.y),
{destination.x, destination.y} Vertex2F(destination.x, destination.y)
}; };
s_pShader->use(); s_pShader->use();
@ -226,7 +226,7 @@ void ccDrawRect( Point origin, Point destination )
ccDrawLine(CCPointMake(origin.x, destination.y), CCPointMake(origin.x, origin.y)); ccDrawLine(CCPointMake(origin.x, destination.y), CCPointMake(origin.x, origin.y));
} }
void ccDrawSolidRect( Point origin, Point destination, ccColor4F color ) void ccDrawSolidRect( Point origin, Point destination, Color4F color )
{ {
Point vertices[] = { Point vertices[] = {
origin, origin,
@ -249,7 +249,7 @@ void ccDrawPoly( const Point *poli, unsigned int numberOfPoints, bool closePolyg
ccGLEnableVertexAttribs( kVertexAttribFlag_Position ); ccGLEnableVertexAttribs( kVertexAttribFlag_Position );
// iPhone and 32-bit machines optimization // iPhone and 32-bit machines optimization
if( sizeof(Point) == sizeof(ccVertex2F) ) if( sizeof(Point) == sizeof(Vertex2F) )
{ {
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
setGLBufferData((void*) poli, numberOfPoints * sizeof(Point)); setGLBufferData((void*) poli, numberOfPoints * sizeof(Point));
@ -267,13 +267,13 @@ void ccDrawPoly( const Point *poli, unsigned int numberOfPoints, bool closePolyg
{ {
// Mac on 64-bit // Mac on 64-bit
// XXX: Mac OpenGL error. arrays can't go out of scope before draw is executed // XXX: Mac OpenGL error. arrays can't go out of scope before draw is executed
ccVertex2F* newPoli = new ccVertex2F[numberOfPoints]; Vertex2F* newPoli = new Vertex2F[numberOfPoints];
for( unsigned int i=0; i<numberOfPoints;i++) { for( unsigned int i=0; i<numberOfPoints;i++) {
newPoli[i].x = poli[i].x; newPoli[i].x = poli[i].x;
newPoli[i].y = poli[i].y; newPoli[i].y = poli[i].y;
} }
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
setGLBufferData(newPoli, numberOfPoints * sizeof(ccVertex2F)); setGLBufferData(newPoli, numberOfPoints * sizeof(Vertex2F));
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0);
#else #else
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, newPoli); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, newPoli);
@ -290,7 +290,7 @@ void ccDrawPoly( const Point *poli, unsigned int numberOfPoints, bool closePolyg
CC_INCREMENT_GL_DRAWS(1); CC_INCREMENT_GL_DRAWS(1);
} }
void ccDrawSolidPoly( const Point *poli, unsigned int numberOfPoints, ccColor4F color ) void ccDrawSolidPoly( const Point *poli, unsigned int numberOfPoints, Color4F color )
{ {
lazy_init(); lazy_init();
@ -301,10 +301,10 @@ void ccDrawSolidPoly( const Point *poli, unsigned int numberOfPoints, ccColor4F
ccGLEnableVertexAttribs( kVertexAttribFlag_Position ); ccGLEnableVertexAttribs( kVertexAttribFlag_Position );
// XXX: Mac OpenGL error. arrays can't go out of scope before draw is executed // XXX: Mac OpenGL error. arrays can't go out of scope before draw is executed
ccVertex2F* newPoli = new ccVertex2F[numberOfPoints]; Vertex2F* newPoli = new Vertex2F[numberOfPoints];
// iPhone and 32-bit machines optimization // iPhone and 32-bit machines optimization
if( sizeof(Point) == sizeof(ccVertex2F) ) if( sizeof(Point) == sizeof(Vertex2F) )
{ {
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
setGLBufferData((void*) poli, numberOfPoints * sizeof(Point)); setGLBufferData((void*) poli, numberOfPoints * sizeof(Point));
@ -318,10 +318,10 @@ void ccDrawSolidPoly( const Point *poli, unsigned int numberOfPoints, ccColor4F
// Mac on 64-bit // Mac on 64-bit
for( unsigned int i=0; i<numberOfPoints;i++) for( unsigned int i=0; i<numberOfPoints;i++)
{ {
newPoli[i] = vertex2( poli[i].x, poli[i].y ); newPoli[i] = Vertex2F( poli[i].x, poli[i].y );
} }
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
setGLBufferData(newPoli, numberOfPoints * sizeof(ccVertex2F)); setGLBufferData(newPoli, numberOfPoints * sizeof(Vertex2F));
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0);
#else #else
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, newPoli); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, newPoli);
@ -433,7 +433,7 @@ void ccDrawQuadBezier(const Point& origin, const Point& control, const Point& de
{ {
lazy_init(); lazy_init();
ccVertex2F* vertices = new ccVertex2F[segments + 1]; Vertex2F* vertices = new Vertex2F[segments + 1];
float t = 0.0f; float t = 0.0f;
for(unsigned int i = 0; i < segments; i++) for(unsigned int i = 0; i < segments; i++)
@ -452,7 +452,7 @@ void ccDrawQuadBezier(const Point& origin, const Point& control, const Point& de
ccGLEnableVertexAttribs( kVertexAttribFlag_Position ); ccGLEnableVertexAttribs( kVertexAttribFlag_Position );
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
setGLBufferData(vertices, (segments + 1) * sizeof(ccVertex2F)); setGLBufferData(vertices, (segments + 1) * sizeof(Vertex2F));
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0);
#else #else
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, vertices); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, vertices);
@ -472,7 +472,7 @@ void ccDrawCardinalSpline( PointArray *config, float tension, unsigned int segm
{ {
lazy_init(); lazy_init();
ccVertex2F* vertices = new ccVertex2F[segments + 1]; Vertex2F* vertices = new Vertex2F[segments + 1];
unsigned int p; unsigned int p;
float lt; float lt;
@ -509,7 +509,7 @@ void ccDrawCardinalSpline( PointArray *config, float tension, unsigned int segm
ccGLEnableVertexAttribs( kVertexAttribFlag_Position ); ccGLEnableVertexAttribs( kVertexAttribFlag_Position );
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
setGLBufferData(vertices, (segments + 1) * sizeof(ccVertex2F)); setGLBufferData(vertices, (segments + 1) * sizeof(Vertex2F));
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0);
#else #else
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, vertices); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, vertices);
@ -524,7 +524,7 @@ void ccDrawCubicBezier(const Point& origin, const Point& control1, const Point&
{ {
lazy_init(); lazy_init();
ccVertex2F* vertices = new ccVertex2F[segments + 1]; Vertex2F* vertices = new Vertex2F[segments + 1];
float t = 0; float t = 0;
for(unsigned int i = 0; i < segments; i++) for(unsigned int i = 0; i < segments; i++)
@ -543,7 +543,7 @@ void ccDrawCubicBezier(const Point& origin, const Point& control1, const Point&
ccGLEnableVertexAttribs( kVertexAttribFlag_Position ); ccGLEnableVertexAttribs( kVertexAttribFlag_Position );
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
setGLBufferData(vertices, (segments + 1) * sizeof(ccVertex2F)); setGLBufferData(vertices, (segments + 1) * sizeof(Vertex2F));
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0);
#else #else
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, vertices); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, vertices);

4
cocos2dx/draw_nodes/CCDrawingPrimitives.h
View File

@ -98,7 +98,7 @@ void CC_DLL ccDrawRect( Point origin, Point destination );
/** draws a solid rectangle given the origin and destination point measured in points. /** draws a solid rectangle given the origin and destination point measured in points.
@since 1.1 @since 1.1
*/ */
void CC_DLL ccDrawSolidRect( Point origin, Point destination, ccColor4F color ); void CC_DLL ccDrawSolidRect( Point origin, Point destination, Color4F color );
/** draws a polygon given a pointer to Point coordinates and the number of vertices measured in points. /** draws a polygon given a pointer to Point coordinates and the number of vertices measured in points.
The polygon can be closed or open The polygon can be closed or open
@ -107,7 +107,7 @@ void CC_DLL ccDrawPoly( const Point *vertices, unsigned int numOfVertices, bool
/** draws a solid polygon given a pointer to CGPoint coordinates, the number of vertices measured in points, and a color. /** draws a solid polygon given a pointer to CGPoint coordinates, the number of vertices measured in points, and a color.
*/ */
void CC_DLL ccDrawSolidPoly( const Point *poli, unsigned int numberOfPoints, ccColor4F color ); void CC_DLL ccDrawSolidPoly( const Point *poli, unsigned int numberOfPoints, Color4F color );
/** draws a circle given the center, radius and number of segments. */ /** draws a circle given the center, radius and number of segments. */
void CC_DLL ccDrawCircle( const Point& center, float radius, float angle, unsigned int segments, bool drawLineToCenter, float scaleX, float scaleY); void CC_DLL ccDrawCircle( const Point& center, float radius, float angle, unsigned int segments, bool drawLineToCenter, float scaleX, float scaleY);

78
cocos2dx/effects/CCGrid.cpp
View File

@ -328,11 +328,11 @@ void Grid3D::blit(void)
unsigned int numOfPoints = (_gridSize.width+1) * (_gridSize.height+1); unsigned int numOfPoints = (_gridSize.width+1) * (_gridSize.height+1);
// position // position
setGLBufferData(_vertices, numOfPoints * sizeof(ccVertex3F), 0); setGLBufferData(_vertices, numOfPoints * sizeof(Vertex3F), 0);
glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, 0, 0);
// texCoords // texCoords
setGLBufferData(_texCoordinates, numOfPoints * sizeof(ccVertex2F), 1); setGLBufferData(_texCoordinates, numOfPoints * sizeof(Vertex2F), 1);
glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, 0, 0);
setGLIndexData(_indices, n * 12, 0); setGLIndexData(_indices, n * 12, 0);
@ -363,9 +363,9 @@ void Grid3D::calculateVertexPoints(void)
unsigned int numOfPoints = (_gridSize.width+1) * (_gridSize.height+1); unsigned int numOfPoints = (_gridSize.width+1) * (_gridSize.height+1);
_vertices = malloc(numOfPoints * sizeof(ccVertex3F)); _vertices = malloc(numOfPoints * sizeof(Vertex3F));
_originalVertices = malloc(numOfPoints * sizeof(ccVertex3F)); _originalVertices = malloc(numOfPoints * sizeof(Vertex3F));
_texCoordinates = malloc(numOfPoints * sizeof(ccVertex2F)); _texCoordinates = malloc(numOfPoints * sizeof(Vertex2F));
_indices = (GLushort*)malloc(_gridSize.width * _gridSize.height * sizeof(GLushort) * 6); _indices = (GLushort*)malloc(_gridSize.width * _gridSize.height * sizeof(GLushort) * 6);
GLfloat *vertArray = (GLfloat*)_vertices; GLfloat *vertArray = (GLfloat*)_vertices;
@ -393,15 +393,15 @@ void Grid3D::calculateVertexPoints(void)
memcpy(&idxArray[6*idx], tempidx, 6*sizeof(GLushort)); memcpy(&idxArray[6*idx], tempidx, 6*sizeof(GLushort));
int l1[4] = {a*3, b*3, c*3, d*3}; int l1[4] = {a*3, b*3, c*3, d*3};
ccVertex3F e = {x1, y1, 0}; Vertex3F e(x1, y1, 0);
ccVertex3F f = {x2, y1, 0}; Vertex3F f(x2, y1, 0);
ccVertex3F g = {x2, y2, 0}; Vertex3F g(x2, y2, 0);
ccVertex3F h = {x1, y2, 0}; Vertex3F h(x1, y2, 0);
ccVertex3F l2[4] = {e, f, g, h}; Vertex3F l2[4] = {e, f, g, h};
int tex1[4] = {a*2, b*2, c*2, d*2}; int tex1[4] = {a*2, b*2, c*2, d*2};
Point tex2[4] = {ccp(x1, y1), ccp(x2, y1), ccp(x2, y2), ccp(x1, y2)}; Point Tex2F[4] = {ccp(x1, y1), ccp(x2, y1), ccp(x2, y2), ccp(x1, y2)};
for (i = 0; i < 4; ++i) for (i = 0; i < 4; ++i)
{ {
@ -409,47 +409,57 @@ void Grid3D::calculateVertexPoints(void)
vertArray[l1[i] + 1] = l2[i].y; vertArray[l1[i] + 1] = l2[i].y;
vertArray[l1[i] + 2] = l2[i].z; vertArray[l1[i] + 2] = l2[i].z;
texArray[tex1[i]] = tex2[i].x / width; texArray[tex1[i]] = Tex2F[i].x / width;
if (_isTextureFlipped) if (_isTextureFlipped)
{ {
texArray[tex1[i] + 1] = (imageH - tex2[i].y) / height; texArray[tex1[i] + 1] = (imageH - Tex2F[i].y) / height;
} }
else else
{ {
texArray[tex1[i] + 1] = tex2[i].y / height; texArray[tex1[i] + 1] = Tex2F[i].y / height;
} }
} }
} }
} }
memcpy(_originalVertices, _vertices, (_gridSize.width+1) * (_gridSize.height+1) * sizeof(ccVertex3F)); memcpy(_originalVertices, _vertices, (_gridSize.width+1) * (_gridSize.height+1) * sizeof(Vertex3F));
} }
ccVertex3F Grid3D::vertex(const Point& pos) Vertex3F Grid3D::vertex(const Point& pos)
{
return getVertex(pos);
}
Vertex3F Grid3D::getVertex(const Point& pos)
{ {
CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers"); CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers");
int index = (pos.x * (_gridSize.height+1) + pos.y) * 3; int index = (pos.x * (_gridSize.height+1) + pos.y) * 3;
float *vertArray = (float*)_vertices; float *vertArray = (float*)_vertices;
ccVertex3F vert = {vertArray[index], vertArray[index+1], vertArray[index+2]}; Vertex3F vert(vertArray[index], vertArray[index+1], vertArray[index+2]);
return vert; return vert;
} }
ccVertex3F Grid3D::originalVertex(const Point& pos) Vertex3F Grid3D::originalVertex(const Point& pos)
{
return getOriginalVertex(pos);
}
Vertex3F Grid3D::getOriginalVertex(const Point& pos)
{ {
CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers"); CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers");
int index = (pos.x * (_gridSize.height+1) + pos.y) * 3; int index = (pos.x * (_gridSize.height+1) + pos.y) * 3;
float *vertArray = (float*)_originalVertices; float *vertArray = (float*)_originalVertices;
ccVertex3F vert = {vertArray[index], vertArray[index+1], vertArray[index+2]}; Vertex3F vert(vertArray[index], vertArray[index+1], vertArray[index+2]);
return vert; return vert;
} }
void Grid3D::setVertex(const Point& pos, const ccVertex3F& vertex) void Grid3D::setVertex(const Point& pos, const Vertex3F& vertex)
{ {
CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers"); CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers");
int index = (pos.x * (_gridSize.height + 1) + pos.y) * 3; int index = (pos.x * (_gridSize.height + 1) + pos.y) * 3;
@ -463,7 +473,7 @@ void Grid3D::reuse(void)
{ {
if (_reuseGrid > 0) if (_reuseGrid > 0)
{ {
memcpy(_originalVertices, _vertices, (_gridSize.width+1) * (_gridSize.height+1) * sizeof(ccVertex3F)); memcpy(_originalVertices, _vertices, (_gridSize.width+1) * (_gridSize.height+1) * sizeof(Vertex3F));
--_reuseGrid; --_reuseGrid;
} }
} }
@ -543,11 +553,11 @@ void TiledGrid3D::blit(void)
int numQuads = _gridSize.width * _gridSize.height; int numQuads = _gridSize.width * _gridSize.height;
// position // position
setGLBufferData(_vertices, (numQuads*4*sizeof(ccVertex3F)), 0); setGLBufferData(_vertices, (numQuads*4*sizeof(Vertex3F)), 0);
glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, 0, 0);
// texCoords // texCoords
setGLBufferData(_texCoordinates, (numQuads*4*sizeof(ccVertex2F)), 1); setGLBufferData(_texCoordinates, (numQuads*4*sizeof(Vertex2F)), 1);
glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, 0, 0);
setGLIndexData(_indices, n * 12, 0); setGLIndexData(_indices, n * 12, 0);
@ -578,9 +588,9 @@ void TiledGrid3D::calculateVertexPoints(void)
CC_SAFE_FREE(_texCoordinates); CC_SAFE_FREE(_texCoordinates);
CC_SAFE_FREE(_indices); CC_SAFE_FREE(_indices);
_vertices = malloc(numQuads*4*sizeof(ccVertex3F)); _vertices = malloc(numQuads*4*sizeof(Vertex3F));
_originalVertices = malloc(numQuads*4*sizeof(ccVertex3F)); _originalVertices = malloc(numQuads*4*sizeof(Vertex3F));
_texCoordinates = malloc(numQuads*4*sizeof(ccVertex2F)); _texCoordinates = malloc(numQuads*4*sizeof(Vertex2F));
_indices = (GLushort*)malloc(numQuads*6*sizeof(GLushort)); _indices = (GLushort*)malloc(numQuads*6*sizeof(GLushort));
GLfloat *vertArray = (GLfloat*)_vertices; GLfloat *vertArray = (GLfloat*)_vertices;
@ -645,34 +655,34 @@ void TiledGrid3D::calculateVertexPoints(void)
memcpy(_originalVertices, _vertices, numQuads * 12 * sizeof(GLfloat)); memcpy(_originalVertices, _vertices, numQuads * 12 * sizeof(GLfloat));
} }
void TiledGrid3D::setTile(const Point& pos, const ccQuad3& coords) void TiledGrid3D::setTile(const Point& pos, const Quad3& coords)
{ {
CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers"); CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers");
int idx = (_gridSize.height * pos.x + pos.y) * 4 * 3; int idx = (_gridSize.height * pos.x + pos.y) * 4 * 3;
float *vertArray = (float*)_vertices; float *vertArray = (float*)_vertices;
memcpy(&vertArray[idx], &coords, sizeof(ccQuad3)); memcpy(&vertArray[idx], &coords, sizeof(Quad3));
} }
ccQuad3 TiledGrid3D::originalTile(const Point& pos) Quad3 TiledGrid3D::originalTile(const Point& pos)
{ {
CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers"); CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers");
int idx = (_gridSize.height * pos.x + pos.y) * 4 * 3; int idx = (_gridSize.height * pos.x + pos.y) * 4 * 3;
float *vertArray = (float*)_originalVertices; float *vertArray = (float*)_originalVertices;
ccQuad3 ret; Quad3 ret;
memcpy(&ret, &vertArray[idx], sizeof(ccQuad3)); memcpy(&ret, &vertArray[idx], sizeof(Quad3));
return ret; return ret;
} }
ccQuad3 TiledGrid3D::tile(const Point& pos) Quad3 TiledGrid3D::tile(const Point& pos)
{ {
CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers"); CCAssert( pos.x == (unsigned int)pos.x && pos.y == (unsigned int) pos.y , "Numbers must be integers");
int idx = (_gridSize.height * pos.x + pos.y) * 4 * 3; int idx = (_gridSize.height * pos.x + pos.y) * 4 * 3;
float *vertArray = (float*)_vertices; float *vertArray = (float*)_vertices;
ccQuad3 ret; Quad3 ret;
memcpy(&ret, &vertArray[idx], sizeof(ccQuad3)); memcpy(&ret, &vertArray[idx], sizeof(Quad3));
return ret; return ret;
} }

18
cocos2dx/effects/CCGrid.h
View File

@ -117,11 +117,17 @@ public:
~Grid3D(void); ~Grid3D(void);
/** returns the vertex at a given position */ /** returns the vertex at a given position */
ccVertex3F vertex(const Point& pos); CC_DEPRECATED_ATTRIBUTE Vertex3F vertex(const Point& pos);
/** returns the original (non-transformed) vertex at a given position */ /** returns the original (non-transformed) vertex at a given position */
ccVertex3F originalVertex(const Point& pos); CC_DEPRECATED_ATTRIBUTE Vertex3F originalVertex(const Point& pos);
/** returns the vertex at a given position */
Vertex3F getVertex(const Point& pos);
/** returns the original (non-transformed) vertex at a given position */
Vertex3F getOriginalVertex(const Point& pos);
/** sets a new vertex at a given position */ /** sets a new vertex at a given position */
void setVertex(const Point& pos, const ccVertex3F& vertex); void setVertex(const Point& pos, const Vertex3F& vertex);
virtual void blit(void); virtual void blit(void);
virtual void reuse(void); virtual void reuse(void);
@ -154,11 +160,11 @@ public:
~TiledGrid3D(void); ~TiledGrid3D(void);
/** returns the tile at the given position */ /** returns the tile at the given position */
ccQuad3 tile(const Point& pos); Quad3 tile(const Point& pos);
/** returns the original tile (untransformed) at the given position */ /** returns the original tile (untransformed) at the given position */
ccQuad3 originalTile(const Point& pos); Quad3 originalTile(const Point& pos);
/** sets a new tile */ /** sets a new tile */
void setTile(const Point& pos, const ccQuad3& coords); void setTile(const Point& pos, const Quad3& coords);
virtual void blit(void); virtual void blit(void);
virtual void reuse(void); virtual void reuse(void);

20
cocos2dx/include/CCProtocols.h
View File

@ -41,23 +41,23 @@ public:
/** /**
* Changes the color with R,G,B bytes * Changes the color with R,G,B bytes
* *
* @param color Example: ccc3(255,100,0) means R=255, G=100, B=0 * @param color Example: Color3B(255,100,0) means R=255, G=100, B=0
*/ */
virtual void setColor(const ccColor3B& color) = 0; virtual void setColor(const Color3B& color) = 0;
/** /**
* Returns color that is currently used. * Returns color that is currently used.
* *
* @return The ccColor3B contains R,G,B bytes. * @return The Color3B contains R,G,B bytes.
*/ */
virtual const ccColor3B& getColor(void) const = 0; virtual const Color3B& getColor(void) const = 0;
/** /**
* Returns the displayed color. * Returns the displayed color.
* *
* @return The ccColor3B contains R,G,B bytes. * @return The Color3B contains R,G,B bytes.
*/ */
virtual const ccColor3B& getDisplayedColor(void) const = 0; virtual const Color3B& getDisplayedColor(void) const = 0;
/** /**
* Returns the displayed opacity. * Returns the displayed opacity.
@ -111,7 +111,7 @@ public:
/** /**
* recursive method that updates display color * recursive method that updates display color
*/ */
virtual void updateDisplayedColor(const ccColor3B& color) = 0; virtual void updateDisplayedColor(const Color3B& color) = 0;
/** /**
* whether or not opacity should be propagated to its children. * whether or not opacity should be propagated to its children.
@ -140,14 +140,14 @@ public:
* e.g. {GL_ONE, GL_ONE}, {GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA}. * e.g. {GL_ONE, GL_ONE}, {GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA}.
* *
*/ */
virtual void setBlendFunc(const ccBlendFunc &blendFunc) = 0; virtual void setBlendFunc(const BlendFunc &blendFunc) = 0;
/** /**
* Returns the blending function that is currently being used. * Returns the blending function that is currently being used.
* *
* @return A ccBlendFunc structure with source and destination factor which specified pixel arithmetic. * @return A BlendFunc structure with source and destination factor which specified pixel arithmetic.
*/ */
virtual const ccBlendFunc &getBlendFunc(void) const = 0; virtual const BlendFunc &getBlendFunc(void) const = 0;
}; };
/** /**

406
cocos2dx/include/ccTypes.h
View File

@ -35,289 +35,274 @@ THE SOFTWARE.
NS_CC_BEGIN NS_CC_BEGIN
/** RGB color composed of bytes 3 bytes /** RGB color composed of bytes 3 bytes
@since v0.8 @since v3.0
*/ */
typedef struct _ccColor3B struct Color3B
{ {
Color3B(): r(0), g(0), b(0) {}
Color3B(GLubyte _r, GLubyte _g, GLubyte _b)
:r(_r),
g(_g),
b(_b)
{}
bool equals(const Color3B &other)
{
return (this->r == other.r &&
this->g == other.g &&
this->b == other.b);
}
GLubyte r; GLubyte r;
GLubyte g; GLubyte g;
GLubyte b; GLubyte b;
} ccColor3B;
//! helper macro that creates an ccColor3B type const static Color3B white;
static inline ccColor3B const static Color3B yellow;
ccc3(const GLubyte r, const GLubyte g, const GLubyte b) const static Color3B blue;
{ const static Color3B green;
ccColor3B c = {r, g, b}; const static Color3B red;
return c; const static Color3B magenta;
} const static Color3B black;
const static Color3B orange;
const static Color3B gray;
};
/** returns true if both ccColor3B are equal. Otherwise it returns false. struct Color4F;
*/
static inline bool ccc3BEqual(const ccColor3B &col1, const ccColor3B &col2)
{
return col1.r == col2.r && col1.g == col2.g && col1.b == col2.b;
}
//ccColor3B predefined colors
//! White color (255,255,255)
static const ccColor3B ccWHITE={255,255,255};
//! Yellow color (255,255,0)
static const ccColor3B ccYELLOW={255,255,0};
//! Blue color (0,0,255)
static const ccColor3B ccBLUE={0,0,255};
//! Green Color (0,255,0)
static const ccColor3B ccGREEN={0,255,0};
//! Red Color (255,0,0,)
static const ccColor3B ccRED={255,0,0};
//! Magenta Color (255,0,255)
static const ccColor3B ccMAGENTA={255,0,255};
//! Black Color (0,0,0)
static const ccColor3B ccBLACK={0,0,0};
//! Orange Color (255,127,0)
static const ccColor3B ccORANGE={255,127,0};
//! Gray Color (166,166,166)
static const ccColor3B ccGRAY={166,166,166};
/** RGBA color composed of 4 bytes /** RGBA color composed of 4 bytes
@since v0.8 @since v3.0
*/ */
typedef struct _ccColor4B struct Color4B
{ {
Color4B(GLubyte _r, GLubyte _g, GLubyte _b, GLubyte _a)
:r(_r),
g(_g),
b(_b),
a(_a)
{}
Color4B(): r(0.f), g(0.f), b(0.f), a(0.f) {}
// This function should use Color4F, so implement it in .cpp file.
explicit Color4B(const Color4F &color4F);
GLubyte r; GLubyte r;
GLubyte g; GLubyte g;
GLubyte b; GLubyte b;
GLubyte a; GLubyte a;
} ccColor4B; };
//! helper macro that creates an ccColor4B type
static inline ccColor4B
ccc4(const GLubyte r, const GLubyte g, const GLubyte b, const GLubyte o)
{
ccColor4B c = {r, g, b, o};
return c;
}
/** RGBA color composed of 4 floats /** RGBA color composed of 4 floats
@since v0.8 @since v3.0
*/ */
typedef struct _ccColor4F { struct Color4F
{
Color4F(float _r, float _g, float _b, float _a)
:r(_r),
g(_g),
b(_b),
a(_a)
{}
explicit Color4F(const Color3B &color3B)
:r(color3B.r)
,g(color3B.g)
,b(color3B.b)
,a(1.f)
{}
explicit Color4F(const Color4B &color4B)
:r(color4B.r / 255.0f),
g(color4B.g / 255.0f),
b(color4B.b / 255.0f),
a(color4B.a / 255.0f)
{}
Color4F(): r(0.f), g(0.f), b(0.f), a(0.f) {}
bool equals(const Color4F &other)
{
return (this->r == other.r &&
this->g == other.g &&
this->b == other.b &&
this->a == other.a);
}
GLfloat r; GLfloat r;
GLfloat g; GLfloat g;
GLfloat b; GLfloat b;
GLfloat a; GLfloat a;
} ccColor4F; };
/** Returns a ccColor4F from a ccColor3B. Alpha will be 1.
@since v0.99.1
*/
static inline ccColor4F ccc4FFromccc3B(ccColor3B c)
{
ccColor4F c4 = {c.r/255.f, c.g/255.f, c.b/255.f, 1.f};
return c4;
}
//! helper that creates a ccColor4f type
static inline ccColor4F
ccc4f(const GLfloat r, const GLfloat g, const GLfloat b, const GLfloat a)
{
ccColor4F c4 = {r, g, b, a};
return c4;
}
/** Returns a ccColor4F from a ccColor4B.
@since v0.99.1
*/
static inline ccColor4F ccc4FFromccc4B(ccColor4B c)
{
ccColor4F c4 = {c.r/255.f, c.g/255.f, c.b/255.f, c.a/255.f};
return c4;
}
static inline ccColor4B ccc4BFromccc4F(ccColor4F c)
{
ccColor4B ret = {(GLubyte)(c.r*255), (GLubyte)(c.g*255), (GLubyte)(c.b*255), (GLubyte)(c.a*255)};
return ret;
}
/** returns YES if both ccColor4F are equal. Otherwise it returns NO.
@since v0.99.1
*/
static inline bool ccc4FEqual(ccColor4F a, ccColor4F b)
{
return a.r == b.r && a.g == b.g && a.b == b.b && a.a == b.a;
}
/** A vertex composed of 2 floats: x, y /** A vertex composed of 2 floats: x, y
@since v0.8 @since v3.0
*/ */
typedef struct _ccVertex2F struct Vertex2F
{ {
Vertex2F(float _x, float _y) :x(_x), y(_y) {}
Vertex2F(): x(0.f), y(0.f) {}
GLfloat x; GLfloat x;
GLfloat y; GLfloat y;
} ccVertex2F; };
static inline ccVertex2F vertex2(const float x, const float y)
{
ccVertex2F c = {x, y};
return c;
}
/** A vertex composed of 2 floats: x, y /** A vertex composed of 2 floats: x, y
@since v0.8 @since v3.0
*/ */
typedef struct _ccVertex3F struct Vertex3F
{ {
Vertex3F(float _x, float _y, float _z)
:x(_x),
y(_y),
z(_z)
{}
Vertex3F(): x(0.f), y(0.f), z(0.f) {}
GLfloat x; GLfloat x;
GLfloat y; GLfloat y;
GLfloat z; GLfloat z;
} ccVertex3F; };
static inline ccVertex3F vertex3(const float x, const float y, const float z)
{
ccVertex3F c = {x, y, z};
return c;
}
/** A texcoord composed of 2 floats: u, y /** A texcoord composed of 2 floats: u, y
@since v0.8 @since v3.0
*/ */
typedef struct _ccTex2F { struct Tex2F {
GLfloat u; Tex2F(float _u, float _v): u(_u), v(_v) {}
GLfloat v;
} ccTex2F;
static inline ccTex2F tex2(const float u, const float v) Tex2F(): u(0.f), v(0.f) {}
{
ccTex2F t = {u , v}; GLfloat u;
return t; GLfloat v;
} };
//! Point Sprite component //! Point Sprite component
typedef struct _ccPointSprite struct PointSprite
{ {
ccVertex2F pos; // 8 bytes Vertex2F pos; // 8 bytes
ccColor4B color; // 4 bytes Color4B color; // 4 bytes
GLfloat size; // 4 bytes GLfloat size; // 4 bytes
} ccPointSprite; };
//! A 2D Quad. 4 * 2 floats //! A 2D Quad. 4 * 2 floats
typedef struct _ccQuad2 { struct Quad2
ccVertex2F tl; {
ccVertex2F tr; Vertex2F tl;
ccVertex2F bl; Vertex2F tr;
ccVertex2F br; Vertex2F bl;
} ccQuad2; Vertex2F br;
};
//! A 3D Quad. 4 * 3 floats //! A 3D Quad. 4 * 3 floats
typedef struct _ccQuad3 { struct Quad3 {
ccVertex3F bl; Vertex3F bl;
ccVertex3F br; Vertex3F br;
ccVertex3F tl; Vertex3F tl;
ccVertex3F tr; Vertex3F tr;
} ccQuad3; };
//! a Point with a vertex point, a tex coord point and a color 4B //! a Point with a vertex point, a tex coord point and a color 4B
typedef struct _ccV2F_C4B_T2F struct V2F_C4B_T2F
{ {
//! vertices (2F) //! vertices (2F)
ccVertex2F vertices; Vertex2F vertices;
//! colors (4B) //! colors (4B)
ccColor4B colors; Color4B colors;
//! tex coords (2F) //! tex coords (2F)
ccTex2F texCoords; Tex2F texCoords;
} ccV2F_C4B_T2F; };
//! a Point with a vertex point, a tex coord point and a color 4F //! a Point with a vertex point, a tex coord point and a color 4F
typedef struct _ccV2F_C4F_T2F struct V2F_C4F_T2F
{ {
//! vertices (2F) //! vertices (2F)
ccVertex2F vertices; Vertex2F vertices;
//! colors (4F) //! colors (4F)
ccColor4F colors; Color4F colors;
//! tex coords (2F) //! tex coords (2F)
ccTex2F texCoords; Tex2F texCoords;
} ccV2F_C4F_T2F; };
//! a Point with a vertex point, a tex coord point and a color 4B //! a Point with a vertex point, a tex coord point and a color 4B
typedef struct _ccV3F_C4B_T2F struct V3F_C4B_T2F
{ {
//! vertices (3F) //! vertices (3F)
ccVertex3F vertices; // 12 bytes Vertex3F vertices; // 12 bytes
// char __padding__[4];
//! colors (4B) //! colors (4B)
ccColor4B colors; // 4 bytes Color4B colors; // 4 bytes
// char __padding2__[4];
// tex coords (2F) // tex coords (2F)
ccTex2F texCoords; // 8 bytes Tex2F texCoords; // 8 bytes
} ccV3F_C4B_T2F; };
//! A Triangle of ccV2F_C4B_T2F //! A Triangle of V2F_C4B_T2F
typedef struct _ccV2F_C4B_T2F_Triangle struct V2F_C4B_T2F_Triangle
{ {
//! Point A //! Point A
ccV2F_C4B_T2F a; V2F_C4B_T2F a;
//! Point B //! Point B
ccV2F_C4B_T2F b; V2F_C4B_T2F b;
//! Point B //! Point B
ccV2F_C4B_T2F c; V2F_C4B_T2F c;
} ccV2F_C4B_T2F_Triangle; };
//! A Quad of ccV2F_C4B_T2F //! A Quad of V2F_C4B_T2F
typedef struct _ccV2F_C4B_T2F_Quad struct V2F_C4B_T2F_Quad
{ {
//! bottom left //! bottom left
ccV2F_C4B_T2F bl; V2F_C4B_T2F bl;
//! bottom right //! bottom right
ccV2F_C4B_T2F br; V2F_C4B_T2F br;
//! top left //! top left
ccV2F_C4B_T2F tl; V2F_C4B_T2F tl;
//! top right //! top right
ccV2F_C4B_T2F tr; V2F_C4B_T2F tr;
} ccV2F_C4B_T2F_Quad; };
//! 4 ccVertex3FTex2FColor4B //! 4 Vertex3FTex2FColor4B
typedef struct _ccV3F_C4B_T2F_Quad struct V3F_C4B_T2F_Quad
{ {
//! top left //! top left
ccV3F_C4B_T2F tl; V3F_C4B_T2F tl;
//! bottom left //! bottom left
ccV3F_C4B_T2F bl; V3F_C4B_T2F bl;
//! top right //! top right
ccV3F_C4B_T2F tr; V3F_C4B_T2F tr;
//! bottom right //! bottom right
ccV3F_C4B_T2F br; V3F_C4B_T2F br;
} ccV3F_C4B_T2F_Quad; };
//! 4 ccVertex2FTex2FColor4F Quad //! 4 Vertex2FTex2FColor4F Quad
typedef struct _ccV2F_C4F_T2F_Quad struct V2F_C4F_T2F_Quad
{ {
//! bottom left //! bottom left
ccV2F_C4F_T2F bl; V2F_C4F_T2F bl;
//! bottom right //! bottom right
ccV2F_C4F_T2F br; V2F_C4F_T2F br;
//! top left //! top left
ccV2F_C4F_T2F tl; V2F_C4F_T2F tl;
//! top right //! top right
ccV2F_C4F_T2F tr; V2F_C4F_T2F tr;
} ccV2F_C4F_T2F_Quad; };
//! Blend Function used for textures //! Blend Function used for textures
typedef struct _ccBlendFunc struct BlendFunc
{ {
//! source blend function //! source blend function
GLenum src; GLenum src;
//! destination blend function //! destination blend function
GLenum dst; GLenum dst;
} ccBlendFunc;
static const ccBlendFunc kBlendFuncDisable = {GL_ONE, GL_ZERO}; const static BlendFunc blendFuncDisable;
};
// XXX: If any of these enums are edited and/or reordered, update Texture2D.m // XXX: If any of these enums are edited and/or reordered, update Texture2D.m
//! Vertical text alignment type //! Vertical text alignment type
@ -340,25 +325,25 @@ typedef enum
// types for animation in particle systems // types for animation in particle systems
// texture coordinates for a quad // texture coordinates for a quad
typedef struct _ccT2F_Quad struct T2F_Quad
{ {
//! bottom left //! bottom left
ccTex2F bl; Tex2F bl;
//! bottom right //! bottom right
ccTex2F br; Tex2F br;
//! top left //! top left
ccTex2F tl; Tex2F tl;
//! top right //! top right
ccTex2F tr; Tex2F tr;
} ccT2F_Quad; };
// struct that holds the size in pixels, texture coordinates and delays for animated ParticleSystemQuad // struct that holds the size in pixels, texture coordinates and delays for animated ParticleSystemQuad
typedef struct struct AnimationFrameData
{ {
ccT2F_Quad texCoords; T2F_Quad texCoords;
float delay; float delay;
Size size; Size size;
} ccAnimationFrameData; };
@ -367,55 +352,54 @@ typedef struct
*/ */
// shadow attributes // shadow attributes
typedef struct _ccFontShadow struct FontShadow
{ {
public: public:
// shadow is not enabled by default // shadow is not enabled by default
_ccFontShadow(): _shadowEnabled(false) {} FontShadow(): _shadowEnabled(false) {}
// true if shadow enabled // true if shadow enabled
bool _shadowEnabled; bool _shadowEnabled;
// shadow x and y offset // shadow x and y offset
Size _shadowOffset; Size _shadowOffset;
// shadow blurrines // shadow blurrines
float _shadowBlur; float _shadowBlur;
// shadow opacity // shadow opacity
float _shadowOpacity; float _shadowOpacity;
};
} ccFontShadow;
// stroke attributes // stroke attributes
typedef struct _ccFontStroke struct FontStroke
{ {
public: public:
// stroke is disabled by default // stroke is disabled by default
_ccFontStroke(): _strokeEnabled(false) {} FontStroke(): _strokeEnabled(false) {}
// true if stroke enabled // true if stroke enabled
bool _strokeEnabled; bool _strokeEnabled;
// stroke color // stroke color
ccColor3B _strokeColor; Color3B _strokeColor;
// stroke size // stroke size
float _strokeSize; float _strokeSize;
} ccFontStroke; };
// font attributes // font attributes
typedef struct _ccFontDefinition struct FontDefinition
{ {
public: public:
_ccFontDefinition(): _alignment(kTextAlignmentCenter), FontDefinition(): _alignment(kTextAlignmentCenter),
_vertAlignment(kVerticalTextAlignmentTop), _vertAlignment(kVerticalTextAlignmentTop),
_fontFillColor(ccWHITE) _fontFillColor(Color3B::white)
{ _dimensions = CCSizeMake(0,0); } { _dimensions = CCSizeMake(0,0); }
// font name // font name
std::string _fontName; std::string _fontName;
// font size // font size
int _fontSize; int _fontSize;
// horizontal alignment // horizontal alignment
TextAlignment _alignment; TextAlignment _alignment;
// vertical alignment // vertical alignment
@ -423,13 +407,13 @@ public:
// renering box // renering box
Size _dimensions; Size _dimensions;
// font color // font color
ccColor3B _fontFillColor; Color3B _fontFillColor;
// font shadow // font shadow
ccFontShadow _shadow; FontShadow _shadow;
// font stroke // font stroke
ccFontStroke _stroke; FontStroke _stroke;
} ccFontDefinition; };
NS_CC_END NS_CC_END

4
cocos2dx/label_nodes/CCLabelAtlas.cpp
View File

@ -130,7 +130,7 @@ void LabelAtlas::updateAtlasValues()
} }
CCAssert( n <= _textureAtlas->getCapacity(), "updateAtlasValues: Invalid String length"); CCAssert( n <= _textureAtlas->getCapacity(), "updateAtlasValues: Invalid String length");
ccV3F_C4B_T2F_Quad* quads = _textureAtlas->getQuads(); V3F_C4B_T2F_Quad* quads = _textureAtlas->getQuads();
for(unsigned int i = 0; i < n; i++) { for(unsigned int i = 0; i < n; i++) {
unsigned char a = s[i] - _mapStartChar; unsigned char a = s[i] - _mapStartChar;
@ -171,7 +171,7 @@ void LabelAtlas::updateAtlasValues()
quads[i].tr.vertices.x = (float)(i * _itemWidth + _itemWidth); quads[i].tr.vertices.x = (float)(i * _itemWidth + _itemWidth);
quads[i].tr.vertices.y = (float)(_itemHeight); quads[i].tr.vertices.y = (float)(_itemHeight);
quads[i].tr.vertices.z = 0.0f; quads[i].tr.vertices.z = 0.0f;
ccColor4B c = { _displayedColor.r, _displayedColor.g, _displayedColor.b, _displayedOpacity }; Color4B c(_displayedColor.r, _displayedColor.g, _displayedColor.b, _displayedOpacity);
quads[i].tl.colors = c; quads[i].tl.colors = c;
quads[i].tr.colors = c; quads[i].tr.colors = c;
quads[i].bl.colors = c; quads[i].bl.colors = c;

16
cocos2dx/label_nodes/CCLabelBMFont.cpp
View File

@ -507,7 +507,7 @@ bool LabelBMFont::initWithString(const char *theString, const char *fntFile, flo
_alignment = alignment; _alignment = alignment;
_displayedOpacity = _realOpacity = 255; _displayedOpacity = _realOpacity = 255;
_displayedColor = _realColor = ccWHITE; _displayedColor = _realColor = Color3B::white;
_cascadeOpacityEnabled = true; _cascadeOpacityEnabled = true;
_cascadeColorEnabled = true; _cascadeColorEnabled = true;
@ -540,8 +540,8 @@ LabelBMFont::LabelBMFont()
, _reusedChar(NULL) , _reusedChar(NULL)
, _displayedOpacity(255) , _displayedOpacity(255)
, _realOpacity(255) , _realOpacity(255)
, _displayedColor(ccWHITE) , _displayedColor(Color3B::white)
, _realColor(ccWHITE) , _realColor(Color3B::white)
, _cascadeColorEnabled(true) , _cascadeColorEnabled(true)
, _cascadeOpacityEnabled(true) , _cascadeOpacityEnabled(true)
, _isOpacityModifyRGB(false) , _isOpacityModifyRGB(false)
@ -788,22 +788,22 @@ void LabelBMFont::setCString(const char *label)
} }
//LabelBMFont - RGBAProtocol protocol //LabelBMFont - RGBAProtocol protocol
const ccColor3B& LabelBMFont::getColor() const const Color3B& LabelBMFont::getColor() const
{ {
return _realColor; return _realColor;
} }
const ccColor3B& LabelBMFont::getDisplayedColor() const const Color3B& LabelBMFont::getDisplayedColor() const
{ {
return _displayedColor; return _displayedColor;
} }
void LabelBMFont::setColor(const ccColor3B& color) void LabelBMFont::setColor(const Color3B& color)
{ {
_displayedColor = _realColor = color; _displayedColor = _realColor = color;
if( _cascadeColorEnabled ) { if( _cascadeColorEnabled ) {
ccColor3B parentColor = ccWHITE; Color3B parentColor = Color3B::white;
RGBAProtocol* pParent = dynamic_cast<RGBAProtocol*>(_parent); RGBAProtocol* pParent = dynamic_cast<RGBAProtocol*>(_parent);
if (pParent && pParent->isCascadeColorEnabled()) if (pParent && pParent->isCascadeColorEnabled())
{ {
@ -876,7 +876,7 @@ void LabelBMFont::updateDisplayedOpacity(GLubyte parentOpacity)
} }
} }
void LabelBMFont::updateDisplayedColor(const ccColor3B& parentColor) void LabelBMFont::updateDisplayedColor(const Color3B& parentColor)
{ {
_displayedColor.r = _realColor.r * parentColor.r/255.0; _displayedColor.r = _realColor.r * parentColor.r/255.0;
_displayedColor.g = _realColor.g * parentColor.g/255.0; _displayedColor.g = _realColor.g * parentColor.g/255.0;

12
cocos2dx/label_nodes/CCLabelBMFont.h
View File

@ -234,10 +234,10 @@ public:
virtual void updateDisplayedOpacity(GLubyte parentOpacity); virtual void updateDisplayedOpacity(GLubyte parentOpacity);
virtual bool isCascadeOpacityEnabled() const; virtual bool isCascadeOpacityEnabled() const;
virtual void setCascadeOpacityEnabled(bool cascadeOpacityEnabled); virtual void setCascadeOpacityEnabled(bool cascadeOpacityEnabled);
virtual const ccColor3B& getColor(void) const; virtual const Color3B& getColor(void) const;
virtual const ccColor3B& getDisplayedColor() const; virtual const Color3B& getDisplayedColor() const;
virtual void setColor(const ccColor3B& color); virtual void setColor(const Color3B& color);
virtual void updateDisplayedColor(const ccColor3B& parentColor); virtual void updateDisplayedColor(const Color3B& parentColor);
virtual bool isCascadeColorEnabled() const; virtual bool isCascadeColorEnabled() const;
virtual void setCascadeColorEnabled(bool cascadeColorEnabled); virtual void setCascadeColorEnabled(bool cascadeColorEnabled);
@ -281,8 +281,8 @@ protected:
// texture RGBA // texture RGBA
GLubyte _displayedOpacity; GLubyte _displayedOpacity;
GLubyte _realOpacity; GLubyte _realOpacity;
ccColor3B _displayedColor; Color3B _displayedColor;
ccColor3B _realColor; Color3B _realColor;
bool _cascadeColorEnabled; bool _cascadeColorEnabled;
bool _cascadeOpacityEnabled; bool _cascadeOpacityEnabled;
/** conforms to RGBAProtocol protocol */ /** conforms to RGBAProtocol protocol */

33
cocos2dx/label_nodes/CCLabelTTF.cpp
View File

@ -47,7 +47,7 @@ LabelTTF::LabelTTF()
, _string("") , _string("")
, _shadowEnabled(false) , _shadowEnabled(false)
, _strokeEnabled(false) , _strokeEnabled(false)
, _textFillColor(ccWHITE) , _textFillColor(Color3B::white)
{ {
} }
@ -96,7 +96,7 @@ LabelTTF* LabelTTF::create(const char *string, const char *fontName, float fontS
return NULL; return NULL;
} }
LabelTTF * LabelTTF::createWithFontDefinition(const char *string, ccFontDefinition &textDefinition) LabelTTF * LabelTTF::createWithFontDefinition(const char *string, FontDefinition &textDefinition)
{ {
LabelTTF *pRet = new LabelTTF(); LabelTTF *pRet = new LabelTTF();
if(pRet && pRet->initWithStringAndTextDefinition(string, textDefinition)) if(pRet && pRet->initWithStringAndTextDefinition(string, textDefinition))
@ -148,7 +148,7 @@ bool LabelTTF::initWithString(const char *string, const char *fontName, float fo
return false; return false;
} }
bool LabelTTF::initWithStringAndTextDefinition(const char *string, ccFontDefinition &textDefinition) bool LabelTTF::initWithStringAndTextDefinition(const char *string, FontDefinition &textDefinition)
{ {
if (Sprite::init()) if (Sprite::init())
{ {
@ -300,8 +300,8 @@ bool LabelTTF::updateTexture()
#if (CC_TARGET_PLATFORM == CC_PLATFORM_ANDROID) || (CC_TARGET_PLATFORM == CC_PLATFORM_IOS) #if (CC_TARGET_PLATFORM == CC_PLATFORM_ANDROID) || (CC_TARGET_PLATFORM == CC_PLATFORM_IOS)
ccFontDefinition texDef = _prepareTextDefinition(true); FontDefinition texDef = _prepareTextDefinition(true);
tex->initWithString( _string.c_str(), &texDef ); tex->initWithString( _string.c_str(), texDef );
#else #else
@ -390,7 +390,7 @@ void LabelTTF::disableShadow(bool updateTexture)
#endif #endif
} }
void LabelTTF::enableStroke(const ccColor3B &strokeColor, float strokeSize, bool updateTexture) void LabelTTF::enableStroke(const Color3B &strokeColor, float strokeSize, bool updateTexture)
{ {
#if (CC_TARGET_PLATFORM == CC_PLATFORM_ANDROID) || (CC_TARGET_PLATFORM == CC_PLATFORM_IOS) #if (CC_TARGET_PLATFORM == CC_PLATFORM_ANDROID) || (CC_TARGET_PLATFORM == CC_PLATFORM_IOS)
@ -443,7 +443,7 @@ void LabelTTF::disableStroke(bool updateTexture)
} }
void LabelTTF::setFontFillColor(const ccColor3B &tintColor, bool updateTexture) void LabelTTF::setFontFillColor(const Color3B &tintColor, bool updateTexture)
{ {
#if (CC_TARGET_PLATFORM == CC_PLATFORM_ANDROID) || (CC_TARGET_PLATFORM == CC_PLATFORM_IOS) #if (CC_TARGET_PLATFORM == CC_PLATFORM_ANDROID) || (CC_TARGET_PLATFORM == CC_PLATFORM_IOS)
if (_textFillColor.r != tintColor.r || _textFillColor.g != tintColor.g || _textFillColor.b != tintColor.b) if (_textFillColor.r != tintColor.r || _textFillColor.g != tintColor.g || _textFillColor.b != tintColor.b)
@ -458,22 +458,17 @@ void LabelTTF::setFontFillColor(const ccColor3B &tintColor, bool updateTexture)
#endif #endif
} }
void LabelTTF::setTextDefinition(ccFontDefinition *theDefinition) void LabelTTF::setTextDefinition(const FontDefinition& theDefinition)
{ {
if (theDefinition) _updateWithTextDefinition(theDefinition, true);
{
_updateWithTextDefinition(*theDefinition, true);
}
} }
ccFontDefinition *LabelTTF::getTextDefinition() FontDefinition LabelTTF::getTextDefinition()
{ {
ccFontDefinition *tempDefinition = new ccFontDefinition; return _prepareTextDefinition(false);
*tempDefinition = _prepareTextDefinition(false);
return tempDefinition;
} }
void LabelTTF::_updateWithTextDefinition(ccFontDefinition & textDefinition, bool mustUpdateTexture) void LabelTTF::_updateWithTextDefinition(const FontDefinition& textDefinition, bool mustUpdateTexture)
{ {
_dimensions = CCSizeMake(textDefinition._dimensions.width, textDefinition._dimensions.height); _dimensions = CCSizeMake(textDefinition._dimensions.width, textDefinition._dimensions.height);
_alignment = textDefinition._alignment; _alignment = textDefinition._alignment;
@ -502,9 +497,9 @@ void LabelTTF::_updateWithTextDefinition(ccFontDefinition & textDefinition, bool
updateTexture(); updateTexture();
} }
ccFontDefinition LabelTTF::_prepareTextDefinition(bool adjustForResolution) FontDefinition LabelTTF::_prepareTextDefinition(bool adjustForResolution)
{ {
ccFontDefinition texDef; FontDefinition texDef;
if (adjustForResolution) if (adjustForResolution)
texDef._fontSize = _fontSize * CC_CONTENT_SCALE_FACTOR(); texDef._fontSize = _fontSize * CC_CONTENT_SCALE_FACTOR();

22
cocos2dx/label_nodes/CCLabelTTF.h
View File

@ -81,7 +81,7 @@ public:
/** Create a lable with string and a font definition*/ /** Create a lable with string and a font definition*/
static LabelTTF * createWithFontDefinition(const char *string, ccFontDefinition &textDefinition); static LabelTTF * createWithFontDefinition(const char *string, FontDefinition &textDefinition);
/** initializes the LabelTTF with a font name and font size */ /** initializes the LabelTTF with a font name and font size */
bool initWithString(const char *string, const char *fontName, float fontSize); bool initWithString(const char *string, const char *fontName, float fontSize);
@ -96,13 +96,13 @@ public:
VerticalTextAlignment vAlignment); VerticalTextAlignment vAlignment);
/** initializes the LabelTTF with a font name, alignment, dimension and font size */ /** initializes the LabelTTF with a font name, alignment, dimension and font size */
bool initWithStringAndTextDefinition(const char *string, ccFontDefinition &textDefinition); bool initWithStringAndTextDefinition(const char *string, FontDefinition &textDefinition);
/** set the text definition used by this label */ /** set the text definition used by this label */
void setTextDefinition(ccFontDefinition *theDefinition); void setTextDefinition(const FontDefinition& theDefinition);
/** get the text definition used by this label */ /** get the text definition used by this label */
ccFontDefinition * getTextDefinition(); FontDefinition getTextDefinition();
@ -113,13 +113,13 @@ public:
void disableShadow(bool mustUpdateTexture = true); void disableShadow(bool mustUpdateTexture = true);
/** enable or disable stroke */ /** enable or disable stroke */
void enableStroke(const ccColor3B &strokeColor, float strokeSize, bool mustUpdateTexture = true); void enableStroke(const Color3B &strokeColor, float strokeSize, bool mustUpdateTexture = true);
/** disable stroke */ /** disable stroke */
void disableStroke(bool mustUpdateTexture = true); void disableStroke(bool mustUpdateTexture = true);
/** set text tinting */ /** set text tinting */
void setFontFillColor(const ccColor3B &tintColor, bool mustUpdateTexture = true); void setFontFillColor(const Color3B &tintColor, bool mustUpdateTexture = true);
@ -156,8 +156,8 @@ private:
protected: protected:
/** set the text definition for this label */ /** set the text definition for this label */
void _updateWithTextDefinition(ccFontDefinition & textDefinition, bool mustUpdateTexture = true); void _updateWithTextDefinition(const FontDefinition& textDefinition, bool mustUpdateTexture = true);
ccFontDefinition _prepareTextDefinition(bool adjustForResolution = false); FontDefinition _prepareTextDefinition(bool adjustForResolution = false);
/** Dimensions of the label in Points */ /** Dimensions of the label in Points */
Size _dimensions; Size _dimensions;
@ -174,18 +174,18 @@ protected:
/** font shadow */ /** font shadow */
bool _shadowEnabled; bool _shadowEnabled;
Size _shadowOffset; Size _shadowOffset;
float _shadowOpacity; float _shadowOpacity;
float _shadowBlur; float _shadowBlur;
/** font stroke */ /** font stroke */
bool _strokeEnabled; bool _strokeEnabled;
ccColor3B _strokeColor; Color3B _strokeColor;
float _strokeSize; float _strokeSize;
/** font tint */ /** font tint */
ccColor3B _textFillColor; Color3B _textFillColor;
}; };

64
cocos2dx/layers_scenes_transitions_nodes/CCLayer.cpp
View File

@ -557,8 +557,8 @@ void Layer::ccTouchesCancelled(Set *pTouches, Event *pEvent)
LayerRGBA::LayerRGBA() LayerRGBA::LayerRGBA()
: _displayedOpacity(255) : _displayedOpacity(255)
, _realOpacity (255) , _realOpacity (255)
, _displayedColor(ccWHITE) , _displayedColor(Color3B::white)
, _realColor(ccWHITE) , _realColor(Color3B::white)
, _cascadeOpacityEnabled(false) , _cascadeOpacityEnabled(false)
, _cascadeColorEnabled(false) , _cascadeColorEnabled(false)
{} {}
@ -570,7 +570,7 @@ bool LayerRGBA::init()
if (Layer::init()) if (Layer::init())
{ {
_displayedOpacity = _realOpacity = 255; _displayedOpacity = _realOpacity = 255;
_displayedColor = _realColor = ccWHITE; _displayedColor = _realColor = Color3B::white;
setCascadeOpacityEnabled(false); setCascadeOpacityEnabled(false);
setCascadeColorEnabled(false); setCascadeColorEnabled(false);
@ -609,23 +609,23 @@ void LayerRGBA::setOpacity(GLubyte opacity)
} }
} }
const ccColor3B& LayerRGBA::getColor() const const Color3B& LayerRGBA::getColor() const
{ {
return _realColor; return _realColor;
} }
const ccColor3B& LayerRGBA::getDisplayedColor() const const Color3B& LayerRGBA::getDisplayedColor() const
{ {
return _displayedColor; return _displayedColor;
} }
void LayerRGBA::setColor(const ccColor3B& color) void LayerRGBA::setColor(const Color3B& color)
{ {
_displayedColor = _realColor = color; _displayedColor = _realColor = color;
if (_cascadeColorEnabled) if (_cascadeColorEnabled)
{ {
ccColor3B parentColor = ccWHITE; Color3B parentColor = Color3B::white;
RGBAProtocol* parent = dynamic_cast<RGBAProtocol*>(_parent); RGBAProtocol* parent = dynamic_cast<RGBAProtocol*>(_parent);
if (parent && parent->isCascadeColorEnabled()) if (parent && parent->isCascadeColorEnabled())
{ {
@ -654,7 +654,7 @@ void LayerRGBA::updateDisplayedOpacity(GLubyte parentOpacity)
} }
} }
void LayerRGBA::updateDisplayedColor(const ccColor3B& parentColor) void LayerRGBA::updateDisplayedColor(const Color3B& parentColor)
{ {
_displayedColor.r = _realColor.r * parentColor.r/255.0; _displayedColor.r = _realColor.r * parentColor.r/255.0;
_displayedColor.g = _realColor.g * parentColor.g/255.0; _displayedColor.g = _realColor.g * parentColor.g/255.0;
@ -708,12 +708,12 @@ LayerColor::~LayerColor()
} }
/// blendFunc getter /// blendFunc getter
const ccBlendFunc &LayerColor::getBlendFunc() const const BlendFunc &LayerColor::getBlendFunc() const
{ {
return _blendFunc; return _blendFunc;
} }
/// blendFunc setter /// blendFunc setter
void LayerColor::setBlendFunc(const ccBlendFunc &var) void LayerColor::setBlendFunc(const BlendFunc &var)
{ {
_blendFunc = var; _blendFunc = var;
} }
@ -732,7 +732,7 @@ LayerColor* LayerColor::create()
return pRet; return pRet;
} }
LayerColor * LayerColor::create(const ccColor4B& color, GLfloat width, GLfloat height) LayerColor * LayerColor::create(const Color4B& color, GLfloat width, GLfloat height)
{ {
LayerColor * pLayer = new LayerColor(); LayerColor * pLayer = new LayerColor();
if( pLayer && pLayer->initWithColor(color,width,height)) if( pLayer && pLayer->initWithColor(color,width,height))
@ -744,7 +744,7 @@ LayerColor * LayerColor::create(const ccColor4B& color, GLfloat width, GLfloat h
return NULL; return NULL;
} }
LayerColor * LayerColor::create(const ccColor4B& color) LayerColor * LayerColor::create(const Color4B& color)
{ {
LayerColor * pLayer = new LayerColor(); LayerColor * pLayer = new LayerColor();
if(pLayer && pLayer->initWithColor(color)) if(pLayer && pLayer->initWithColor(color))
@ -759,10 +759,10 @@ LayerColor * LayerColor::create(const ccColor4B& color)
bool LayerColor::init() bool LayerColor::init()
{ {
Size s = Director::sharedDirector()->getWinSize(); Size s = Director::sharedDirector()->getWinSize();
return initWithColor(ccc4(0,0,0,0), s.width, s.height); return initWithColor(Color4B(0,0,0,0), s.width, s.height);
} }
bool LayerColor::initWithColor(const ccColor4B& color, GLfloat w, GLfloat h) bool LayerColor::initWithColor(const Color4B& color, GLfloat w, GLfloat h)
{ {
if (Layer::init()) if (Layer::init())
{ {
@ -791,7 +791,7 @@ bool LayerColor::initWithColor(const ccColor4B& color, GLfloat w, GLfloat h)
return false; return false;
} }
bool LayerColor::initWithColor(const ccColor4B& color) bool LayerColor::initWithColor(const Color4B& color)
{ {
Size s = Director::sharedDirector()->getWinSize(); Size s = Director::sharedDirector()->getWinSize();
this->initWithColor(color, s.width, s.height); this->initWithColor(color, s.width, s.height);
@ -845,10 +845,10 @@ void LayerColor::draw()
// Attributes // Attributes
// //
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
setGLBufferData(_squareVertices, 4 * sizeof(ccVertex2F), 0); setGLBufferData(_squareVertices, 4 * sizeof(Vertex2F), 0);
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0);
setGLBufferData(_squareColors, 4 * sizeof(ccColor4F), 1); setGLBufferData(_squareColors, 4 * sizeof(Color4F), 1);
glVertexAttribPointer(kVertexAttrib_Color, 4, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Color, 4, GL_FLOAT, GL_FALSE, 0, 0);
#else #else
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, _squareVertices); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, _squareVertices);
@ -862,7 +862,7 @@ void LayerColor::draw()
CC_INCREMENT_GL_DRAWS(1); CC_INCREMENT_GL_DRAWS(1);
} }
void LayerColor::setColor(const ccColor3B &color) void LayerColor::setColor(const Color3B &color)
{ {
LayerRGBA::setColor(color); LayerRGBA::setColor(color);
updateColor(); updateColor();
@ -877,7 +877,7 @@ void LayerColor::setOpacity(GLubyte opacity)
// //
// LayerGradient // LayerGradient
// //
LayerGradient* LayerGradient::create(const ccColor4B& start, const ccColor4B& end) LayerGradient* LayerGradient::create(const Color4B& start, const Color4B& end)
{ {
LayerGradient * pLayer = new LayerGradient(); LayerGradient * pLayer = new LayerGradient();
if( pLayer && pLayer->initWithColor(start, end)) if( pLayer && pLayer->initWithColor(start, end))
@ -889,7 +889,7 @@ LayerGradient* LayerGradient::create(const ccColor4B& start, const ccColor4B& en
return NULL; return NULL;
} }
LayerGradient* LayerGradient::create(const ccColor4B& start, const ccColor4B& end, const Point& v) LayerGradient* LayerGradient::create(const Color4B& start, const Color4B& end, const Point& v)
{ {
LayerGradient * pLayer = new LayerGradient(); LayerGradient * pLayer = new LayerGradient();
if( pLayer && pLayer->initWithColor(start, end, v)) if( pLayer && pLayer->initWithColor(start, end, v))
@ -917,15 +917,15 @@ LayerGradient* LayerGradient::create()
bool LayerGradient::init() bool LayerGradient::init()
{ {
return initWithColor(ccc4(0, 0, 0, 255), ccc4(0, 0, 0, 255)); return initWithColor(Color4B(0, 0, 0, 255), Color4B(0, 0, 0, 255));
} }
bool LayerGradient::initWithColor(const ccColor4B& start, const ccColor4B& end) bool LayerGradient::initWithColor(const Color4B& start, const Color4B& end)
{ {
return initWithColor(start, end, ccp(0, -1)); return initWithColor(start, end, ccp(0, -1));
} }
bool LayerGradient::initWithColor(const ccColor4B& start, const ccColor4B& end, const Point& v) bool LayerGradient::initWithColor(const Color4B& start, const Color4B& end, const Point& v)
{ {
_endColor.r = end.r; _endColor.r = end.r;
_endColor.g = end.g; _endColor.g = end.g;
@ -937,7 +937,7 @@ bool LayerGradient::initWithColor(const ccColor4B& start, const ccColor4B& end,
_compressedInterpolation = true; _compressedInterpolation = true;
return LayerColor::initWithColor(ccc4(start.r, start.g, start.b, 255)); return LayerColor::initWithColor(Color4B(start.r, start.g, start.b, 255));
} }
void LayerGradient::updateColor() void LayerGradient::updateColor()
@ -960,19 +960,19 @@ void LayerGradient::updateColor()
float opacityf = (float)_displayedOpacity / 255.0f; float opacityf = (float)_displayedOpacity / 255.0f;
ccColor4F S = { Color4F S(
_displayedColor.r / 255.0f, _displayedColor.r / 255.0f,
_displayedColor.g / 255.0f, _displayedColor.g / 255.0f,
_displayedColor.b / 255.0f, _displayedColor.b / 255.0f,
_startOpacity * opacityf / 255.0f _startOpacity * opacityf / 255.0f
}; );
ccColor4F E = { Color4F E(
_endColor.r / 255.0f, _endColor.r / 255.0f,
_endColor.g / 255.0f, _endColor.g / 255.0f,
_endColor.b / 255.0f, _endColor.b / 255.0f,
_endOpacity * opacityf / 255.0f _endOpacity * opacityf / 255.0f
}; );
// (-1, -1) // (-1, -1)
_squareColors[0].r = E.r + (S.r - E.r) * ((c + u.x + u.y) / (2.0f * c)); _squareColors[0].r = E.r + (S.r - E.r) * ((c + u.x + u.y) / (2.0f * c));
@ -996,23 +996,23 @@ void LayerGradient::updateColor()
_squareColors[3].a = E.a + (S.a - E.a) * ((c - u.x - u.y) / (2.0f * c)); _squareColors[3].a = E.a + (S.a - E.a) * ((c - u.x - u.y) / (2.0f * c));
} }
const ccColor3B& LayerGradient::getStartColor() const const Color3B& LayerGradient::getStartColor() const
{ {
return _realColor; return _realColor;
} }
void LayerGradient::setStartColor(const ccColor3B& color) void LayerGradient::setStartColor(const Color3B& color)
{ {
setColor(color); setColor(color);
} }
void LayerGradient::setEndColor(const ccColor3B& color) void LayerGradient::setEndColor(const Color3B& color)
{ {
_endColor = color; _endColor = color;
updateColor(); updateColor();
} }
const ccColor3B& LayerGradient::getEndColor() const const Color3B& LayerGradient::getEndColor() const
{ {
return _endColor; return _endColor;
} }

38
cocos2dx/layers_scenes_transitions_nodes/CCLayer.h
View File

@ -202,10 +202,10 @@ public:
virtual bool isCascadeOpacityEnabled() const; virtual bool isCascadeOpacityEnabled() const;
virtual void setCascadeOpacityEnabled(bool cascadeOpacityEnabled); virtual void setCascadeOpacityEnabled(bool cascadeOpacityEnabled);
virtual const ccColor3B& getColor() const; virtual const Color3B& getColor() const;
virtual const ccColor3B& getDisplayedColor() const; virtual const Color3B& getDisplayedColor() const;
virtual void setColor(const ccColor3B& color); virtual void setColor(const Color3B& color);
virtual void updateDisplayedColor(const ccColor3B& parentColor); virtual void updateDisplayedColor(const Color3B& parentColor);
virtual bool isCascadeColorEnabled() const; virtual bool isCascadeColorEnabled() const;
virtual void setCascadeColorEnabled(bool cascadeColorEnabled); virtual void setCascadeColorEnabled(bool cascadeColorEnabled);
@ -213,7 +213,7 @@ public:
virtual bool isOpacityModifyRGB() const { return false; } virtual bool isOpacityModifyRGB() const { return false; }
protected: protected:
GLubyte _displayedOpacity, _realOpacity; GLubyte _displayedOpacity, _realOpacity;
ccColor3B _displayedColor, _realColor; Color3B _displayedColor, _realColor;
bool _cascadeOpacityEnabled, _cascadeColorEnabled; bool _cascadeOpacityEnabled, _cascadeColorEnabled;
}; };
@ -232,8 +232,8 @@ class CC_DLL LayerColor : public LayerRGBA, public BlendProtocol
#endif // EMSCRIPTEN #endif // EMSCRIPTEN
{ {
protected: protected:
ccVertex2F _squareVertices[4]; Vertex2F _squareVertices[4];
ccColor4F _squareColors[4]; Color4F _squareColors[4];
public: public:
LayerColor(); LayerColor();
@ -246,15 +246,15 @@ public:
static LayerColor* create(); static LayerColor* create();
/** creates a Layer with color, width and height in Points */ /** creates a Layer with color, width and height in Points */
static LayerColor * create(const ccColor4B& color, GLfloat width, GLfloat height); static LayerColor * create(const Color4B& color, GLfloat width, GLfloat height);
/** creates a Layer with color. Width and height are the window size. */ /** creates a Layer with color. Width and height are the window size. */
static LayerColor * create(const ccColor4B& color); static LayerColor * create(const Color4B& color);
virtual bool init(); virtual bool init();
/** initializes a Layer with color, width and height in Points */ /** initializes a Layer with color, width and height in Points */
virtual bool initWithColor(const ccColor4B& color, GLfloat width, GLfloat height); virtual bool initWithColor(const Color4B& color, GLfloat width, GLfloat height);
/** initializes a Layer with color. Width and height are the window size. */ /** initializes a Layer with color. Width and height are the window size. */
virtual bool initWithColor(const ccColor4B& color); virtual bool initWithColor(const Color4B& color);
/** change width in Points*/ /** change width in Points*/
void changeWidth(GLfloat w); void changeWidth(GLfloat w);
@ -266,11 +266,11 @@ public:
void changeWidthAndHeight(GLfloat w ,GLfloat h); void changeWidthAndHeight(GLfloat w ,GLfloat h);
/** BlendFunction. Conforms to BlendProtocol protocol */ /** BlendFunction. Conforms to BlendProtocol protocol */
CC_PROPERTY_PASS_BY_REF(ccBlendFunc, _blendFunc, BlendFunc) CC_PROPERTY_PASS_BY_REF(BlendFunc, _blendFunc, BlendFunc)
virtual void setOpacityModifyRGB(bool bValue) {CC_UNUSED_PARAM(bValue);} virtual void setOpacityModifyRGB(bool bValue) {CC_UNUSED_PARAM(bValue);}
virtual bool isOpacityModifyRGB(void) const { return false;} virtual bool isOpacityModifyRGB(void) const { return false;}
virtual void setColor(const ccColor3B &color); virtual void setColor(const Color3B &color);
virtual void setOpacity(GLubyte opacity); virtual void setOpacity(GLubyte opacity);
protected: protected:
@ -307,17 +307,17 @@ public:
static LayerGradient* create(); static LayerGradient* create();
/** Creates a full-screen Layer with a gradient between start and end. */ /** Creates a full-screen Layer with a gradient between start and end. */
static LayerGradient* create(const ccColor4B& start, const ccColor4B& end); static LayerGradient* create(const Color4B& start, const Color4B& end);
/** Creates a full-screen Layer with a gradient between start and end in the direction of v. */ /** Creates a full-screen Layer with a gradient between start and end in the direction of v. */
static LayerGradient* create(const ccColor4B& start, const ccColor4B& end, const Point& v); static LayerGradient* create(const Color4B& start, const Color4B& end, const Point& v);
virtual bool init(); virtual bool init();
/** Initializes the Layer with a gradient between start and end. */ /** Initializes the Layer with a gradient between start and end. */
virtual bool initWithColor(const ccColor4B& start, const ccColor4B& end); virtual bool initWithColor(const Color4B& start, const Color4B& end);
/** Initializes the Layer with a gradient between start and end in the direction of v. */ /** Initializes the Layer with a gradient between start and end in the direction of v. */
virtual bool initWithColor(const ccColor4B& start, const ccColor4B& end, const Point& v); virtual bool initWithColor(const Color4B& start, const Color4B& end, const Point& v);
/** Whether or not the interpolation will be compressed in order to display all the colors of the gradient both in canonical and non canonical vectors /** Whether or not the interpolation will be compressed in order to display all the colors of the gradient both in canonical and non canonical vectors
Default: YES Default: YES
@ -325,8 +325,8 @@ public:
virtual void setCompressedInterpolation(bool bCompressedInterpolation); virtual void setCompressedInterpolation(bool bCompressedInterpolation);
virtual bool isCompressedInterpolation() const; virtual bool isCompressedInterpolation() const;
CC_PROPERTY_PASS_BY_REF(ccColor3B, _startColor, StartColor) CC_PROPERTY_PASS_BY_REF(Color3B, _startColor, StartColor)
CC_PROPERTY_PASS_BY_REF(ccColor3B, _endColor, EndColor) CC_PROPERTY_PASS_BY_REF(Color3B, _endColor, EndColor)
CC_PROPERTY(GLubyte, _startOpacity, StartOpacity) CC_PROPERTY(GLubyte, _startOpacity, StartOpacity)
CC_PROPERTY(GLubyte, _endOpacity, EndOpacity) CC_PROPERTY(GLubyte, _endOpacity, EndOpacity)
CC_PROPERTY_PASS_BY_REF(Point, _alongVector, Vector) CC_PROPERTY_PASS_BY_REF(Point, _alongVector, Vector)

14
cocos2dx/layers_scenes_transitions_nodes/CCTransition.cpp
View File

@ -1179,7 +1179,7 @@ TransitionFade::~TransitionFade()
{ {
} }
TransitionFade * TransitionFade::create(float duration, Scene *scene, const ccColor3B& color) TransitionFade * TransitionFade::create(float duration, Scene *scene, const Color3B& color)
{ {
TransitionFade * pTransition = new TransitionFade(); TransitionFade * pTransition = new TransitionFade();
pTransition->initWithDuration(duration, scene, color); pTransition->initWithDuration(duration, scene, color);
@ -1189,10 +1189,10 @@ TransitionFade * TransitionFade::create(float duration, Scene *scene, const ccCo
TransitionFade* TransitionFade::create(float duration,Scene* scene) TransitionFade* TransitionFade::create(float duration,Scene* scene)
{ {
return TransitionFade::create(duration, scene, ccBLACK); return TransitionFade::create(duration, scene, Color3B::black);
} }
bool TransitionFade::initWithDuration(float duration, Scene *scene, const ccColor3B& color) bool TransitionFade::initWithDuration(float duration, Scene *scene, const Color3B& color)
{ {
if (TransitionScene::initWithDuration(duration, scene)) if (TransitionScene::initWithDuration(duration, scene))
{ {
@ -1206,7 +1206,7 @@ bool TransitionFade::initWithDuration(float duration, Scene *scene, const ccColo
bool TransitionFade::initWithDuration(float t, Scene *scene) bool TransitionFade::initWithDuration(float t, Scene *scene)
{ {
this->initWithDuration(t, scene, ccBLACK); this->initWithDuration(t, scene, Color3B::black);
return true; return true;
} }
@ -1270,7 +1270,7 @@ void TransitionCrossFade::onEnter()
// create a transparent color layer // create a transparent color layer
// in which we are going to add our rendertextures // in which we are going to add our rendertextures
ccColor4B color = {0,0,0,0}; Color4B color(0,0,0,0);
Size size = Director::sharedDirector()->getWinSize(); Size size = Director::sharedDirector()->getWinSize();
LayerColor* layer = LayerColor::create(color); LayerColor* layer = LayerColor::create(color);
@ -1304,8 +1304,8 @@ void TransitionCrossFade::onEnter()
// create blend functions // create blend functions
ccBlendFunc blend1 = {GL_ONE, GL_ONE}; // inScene will lay on background and will not be used with alpha BlendFunc blend1 = {GL_ONE, GL_ONE}; // inScene will lay on background and will not be used with alpha
ccBlendFunc blend2 = {GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA}; // we are going to blend outScene via alpha BlendFunc blend2 = {GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA}; // we are going to blend outScene via alpha
// set blendfunctions // set blendfunctions
inTexture->getSprite()->setBlendFunc(blend1); inTexture->getSprite()->setBlendFunc(blend1);

8
cocos2dx/layers_scenes_transitions_nodes/CCTransition.h
View File

@ -416,7 +416,7 @@ Fade out the outgoing scene and then fade in the incoming scene.'''
class CC_DLL TransitionFade : public TransitionScene class CC_DLL TransitionFade : public TransitionScene
{ {
protected: protected:
ccColor4B _color; Color4B _color;
public: public:
@ -424,13 +424,13 @@ public:
virtual ~TransitionFade(); virtual ~TransitionFade();
/** creates the transition with a duration and with an RGB color /** creates the transition with a duration and with an RGB color
* Example: FadeTransition::create(2, scene, ccc3(255,0,0); // red color * Example: FadeTransition::create(2, scene, Color3B(255,0,0); // red color
*/ */
static TransitionFade* create(float duration,Scene* scene, const ccColor3B& color); static TransitionFade* create(float duration,Scene* scene, const Color3B& color);
static TransitionFade* create(float duration,Scene* scene); static TransitionFade* create(float duration,Scene* scene);
/** initializes the transition with a duration and with an RGB color */ /** initializes the transition with a duration and with an RGB color */
virtual bool initWithDuration(float t, Scene*scene ,const ccColor3B& color); virtual bool initWithDuration(float t, Scene*scene ,const Color3B& color);
virtual bool initWithDuration(float t,Scene* scene); virtual bool initWithDuration(float t,Scene* scene);
virtual void onEnter(); virtual void onEnter();

8
cocos2dx/menu_nodes/CCMenuItem.cpp
View File

@ -185,11 +185,11 @@ void MenuItem::setCallback(const ccMenuCallback& callback)
//CCMenuItemLabel //CCMenuItemLabel
// //
const ccColor3B& MenuItemLabel::getDisabledColor() const const Color3B& MenuItemLabel::getDisabledColor() const
{ {
return _disabledColor; return _disabledColor;
} }
void MenuItemLabel::setDisabledColor(const ccColor3B& var) void MenuItemLabel::setDisabledColor(const Color3B& var)
{ {
_disabledColor = var; _disabledColor = var;
} }
@ -251,8 +251,8 @@ bool MenuItemLabel::initWithLabel(Node* label, const ccMenuCallback& callback)
{ {
MenuItem::initWithCallback(callback); MenuItem::initWithCallback(callback);
_originalScale = 1.0f; _originalScale = 1.0f;
_colorBackup = ccWHITE; _colorBackup = Color3B::white;
setDisabledColor(ccc3(126,126,126)); setDisabledColor(Color3B(126,126,126));
this->setLabel(label); this->setLabel(label);
setCascadeColorEnabled(true); setCascadeColorEnabled(true);

6
cocos2dx/menu_nodes/CCMenuItem.h
View File

@ -125,7 +125,7 @@ protected:
class CC_DLL MenuItemLabel : public MenuItem class CC_DLL MenuItemLabel : public MenuItem
{ {
/** the color that will be used to disable the item */ /** the color that will be used to disable the item */
CC_PROPERTY_PASS_BY_REF(ccColor3B, _disabledColor, DisabledColor); CC_PROPERTY_PASS_BY_REF(Color3B, _disabledColor, DisabledColor);
/** Label that is rendered. It can be any Node that implements the LabelProtocol */ /** Label that is rendered. It can be any Node that implements the LabelProtocol */
CC_PROPERTY(Node*, _label, Label); CC_PROPERTY(Node*, _label, Label);
public: public:
@ -162,8 +162,8 @@ public:
virtual void setEnabled(bool enabled); virtual void setEnabled(bool enabled);
protected: protected:
ccColor3B _colorBackup; Color3B _colorBackup;
float _originalScale; float _originalScale;
}; };

4
cocos2dx/misc_nodes/CCClippingNode.cpp
View File

@ -255,8 +255,8 @@ void ClippingNode::visit()
glStencilOp(!_inverted ? GL_ZERO : GL_REPLACE, GL_KEEP, GL_KEEP); glStencilOp(!_inverted ? GL_ZERO : GL_REPLACE, GL_KEEP, GL_KEEP);
// draw a fullscreen solid rectangle to clear the stencil buffer // draw a fullscreen solid rectangle to clear the stencil buffer
//ccDrawSolidRect(PointZero, ccpFromSize([[Director sharedDirector] winSize]), ccc4f(1, 1, 1, 1)); //ccDrawSolidRect(PointZero, ccpFromSize([[Director sharedDirector] winSize]), Color4F(1, 1, 1, 1));
ccDrawSolidRect(PointZero, ccpFromSize(Director::sharedDirector()->getWinSize()), ccc4f(1, 1, 1, 1)); ccDrawSolidRect(PointZero, ccpFromSize(Director::sharedDirector()->getWinSize()), Color4F(1, 1, 1, 1));
/////////////////////////////////// ///////////////////////////////////
// DRAW CLIPPING STENCIL // DRAW CLIPPING STENCIL

32
cocos2dx/misc_nodes/CCMotionStreak.cpp
View File

@ -65,7 +65,7 @@ MotionStreak::~MotionStreak()
CC_SAFE_FREE(_texCoords); CC_SAFE_FREE(_texCoords);
} }
MotionStreak* MotionStreak::create(float fade, float minSeg, float stroke, const ccColor3B& color, const char* path) MotionStreak* MotionStreak::create(float fade, float minSeg, float stroke, const Color3B& color, const char* path)
{ {
MotionStreak *pRet = new MotionStreak(); MotionStreak *pRet = new MotionStreak();
if (pRet && pRet->initWithFade(fade, minSeg, stroke, color, path)) if (pRet && pRet->initWithFade(fade, minSeg, stroke, color, path))
@ -78,7 +78,7 @@ MotionStreak* MotionStreak::create(float fade, float minSeg, float stroke, const
return NULL; return NULL;
} }
MotionStreak* MotionStreak::create(float fade, float minSeg, float stroke, const ccColor3B& color, Texture2D* texture) MotionStreak* MotionStreak::create(float fade, float minSeg, float stroke, const Color3B& color, Texture2D* texture)
{ {
MotionStreak *pRet = new MotionStreak(); MotionStreak *pRet = new MotionStreak();
if (pRet && pRet->initWithFade(fade, minSeg, stroke, color, texture)) if (pRet && pRet->initWithFade(fade, minSeg, stroke, color, texture))
@ -91,7 +91,7 @@ MotionStreak* MotionStreak::create(float fade, float minSeg, float stroke, const
return NULL; return NULL;
} }
bool MotionStreak::initWithFade(float fade, float minSeg, float stroke, const ccColor3B& color, const char* path) bool MotionStreak::initWithFade(float fade, float minSeg, float stroke, const Color3B& color, const char* path)
{ {
CCAssert(path != NULL, "Invalid filename"); CCAssert(path != NULL, "Invalid filename");
@ -99,7 +99,7 @@ bool MotionStreak::initWithFade(float fade, float minSeg, float stroke, const cc
return initWithFade(fade, minSeg, stroke, color, texture); return initWithFade(fade, minSeg, stroke, color, texture);
} }
bool MotionStreak::initWithFade(float fade, float minSeg, float stroke, const ccColor3B& color, Texture2D* texture) bool MotionStreak::initWithFade(float fade, float minSeg, float stroke, const Color3B& color, Texture2D* texture)
{ {
Node::setPosition(PointZero); Node::setPosition(PointZero);
setAnchorPoint(PointZero); setAnchorPoint(PointZero);
@ -119,8 +119,8 @@ bool MotionStreak::initWithFade(float fade, float minSeg, float stroke, const cc
_pointState = (float *)malloc(sizeof(float) * _maxPoints); _pointState = (float *)malloc(sizeof(float) * _maxPoints);
_pointVertexes = (Point*)malloc(sizeof(Point) * _maxPoints); _pointVertexes = (Point*)malloc(sizeof(Point) * _maxPoints);
_vertices = (ccVertex2F*)malloc(sizeof(ccVertex2F) * _maxPoints * 2); _vertices = (Vertex2F*)malloc(sizeof(Vertex2F) * _maxPoints * 2);
_texCoords = (ccTex2F*)malloc(sizeof(ccTex2F) * _maxPoints * 2); _texCoords = (Tex2F*)malloc(sizeof(Tex2F) * _maxPoints * 2);
_colorPointer = (GLubyte*)malloc(sizeof(GLubyte) * _maxPoints * 2 * 4); _colorPointer = (GLubyte*)malloc(sizeof(GLubyte) * _maxPoints * 2 * 4);
// Set blend mode // Set blend mode
@ -143,14 +143,14 @@ void MotionStreak::setPosition(const Point& position)
_positionR = position; _positionR = position;
} }
void MotionStreak::tintWithColor(const ccColor3B& colors) void MotionStreak::tintWithColor(const Color3B& colors)
{ {
setColor(colors); setColor(colors);
// Fast assignation // Fast assignation
for(unsigned int i = 0; i<_nuPoints*2; i++) for(unsigned int i = 0; i<_nuPoints*2; i++)
{ {
*((ccColor3B*) (_colorPointer+i*4)) = colors; *((Color3B*) (_colorPointer+i*4)) = colors;
} }
} }
@ -169,12 +169,12 @@ void MotionStreak::setTexture(Texture2D *texture)
} }
} }
void MotionStreak::setBlendFunc(const ccBlendFunc &blendFunc) void MotionStreak::setBlendFunc(const BlendFunc &blendFunc)
{ {
_blendFunc = blendFunc; _blendFunc = blendFunc;
} }
const ccBlendFunc& MotionStreak::getBlendFunc(void) const const BlendFunc& MotionStreak::getBlendFunc(void) const
{ {
return _blendFunc; return _blendFunc;
} }
@ -280,8 +280,8 @@ void MotionStreak::update(float delta)
// Color assignment // Color assignment
const unsigned int offset = _nuPoints*8; const unsigned int offset = _nuPoints*8;
*((ccColor3B*)(_colorPointer + offset)) = _displayedColor; *((Color3B*)(_colorPointer + offset)) = _displayedColor;
*((ccColor3B*)(_colorPointer + offset+4)) = _displayedColor; *((Color3B*)(_colorPointer + offset+4)) = _displayedColor;
// Opacity // Opacity
_colorPointer[offset+3] = 255; _colorPointer[offset+3] = 255;
@ -312,8 +312,8 @@ void MotionStreak::update(float delta)
if( _nuPoints && _previousNuPoints != _nuPoints ) { if( _nuPoints && _previousNuPoints != _nuPoints ) {
float texDelta = 1.0f / _nuPoints; float texDelta = 1.0f / _nuPoints;
for( i=0; i < _nuPoints; i++ ) { for( i=0; i < _nuPoints; i++ ) {
_texCoords[i*2] = tex2(0, texDelta*i); _texCoords[i*2] = Tex2F(0, texDelta*i);
_texCoords[i*2+1] = tex2(1, texDelta*i); _texCoords[i*2+1] = Tex2F(1, texDelta*i);
} }
_previousNuPoints = _nuPoints; _previousNuPoints = _nuPoints;
@ -339,10 +339,10 @@ void MotionStreak::draw()
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
// Size calculations from ::initWithFade // Size calculations from ::initWithFade
setGLBufferData(_vertices, (sizeof(ccVertex2F) * _maxPoints * 2), 0); setGLBufferData(_vertices, (sizeof(Vertex2F) * _maxPoints * 2), 0);
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, 0, 0);
setGLBufferData(_texCoords, (sizeof(ccTex2F) * _maxPoints * 2), 1); setGLBufferData(_texCoords, (sizeof(Tex2F) * _maxPoints * 2), 1);
glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, 0, 0); glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, 0, 0);
setGLBufferData(_colorPointer, (sizeof(GLubyte) * _maxPoints * 2 * 4), 2); setGLBufferData(_colorPointer, (sizeof(GLubyte) * _maxPoints * 2 * 4), 2);

20
cocos2dx/misc_nodes/CCMotionStreak.h
View File

@ -53,17 +53,17 @@ public:
virtual ~MotionStreak(); virtual ~MotionStreak();
/** creates and initializes a motion streak with fade in seconds, minimum segments, stroke's width, color, texture filename */ /** creates and initializes a motion streak with fade in seconds, minimum segments, stroke's width, color, texture filename */
static MotionStreak* create(float fade, float minSeg, float stroke, const ccColor3B& color, const char* path); static MotionStreak* create(float fade, float minSeg, float stroke, const Color3B& color, const char* path);
/** creates and initializes a motion streak with fade in seconds, minimum segments, stroke's width, color, texture */ /** creates and initializes a motion streak with fade in seconds, minimum segments, stroke's width, color, texture */
static MotionStreak* create(float fade, float minSeg, float stroke, const ccColor3B& color, Texture2D* texture); static MotionStreak* create(float fade, float minSeg, float stroke, const Color3B& color, Texture2D* texture);
/** initializes a motion streak with fade in seconds, minimum segments, stroke's width, color and texture filename */ /** initializes a motion streak with fade in seconds, minimum segments, stroke's width, color and texture filename */
bool initWithFade(float fade, float minSeg, float stroke, const ccColor3B& color, const char* path); bool initWithFade(float fade, float minSeg, float stroke, const Color3B& color, const char* path);
/** initializes a motion streak with fade in seconds, minimum segments, stroke's width, color and texture */ /** initializes a motion streak with fade in seconds, minimum segments, stroke's width, color and texture */
bool initWithFade(float fade, float minSeg, float stroke, const ccColor3B& color, Texture2D* texture); bool initWithFade(float fade, float minSeg, float stroke, const Color3B& color, Texture2D* texture);
/** color used for the tint */ /** color used for the tint */
void tintWithColor(const ccColor3B& colors); void tintWithColor(const Color3B& colors);
/** Remove all living segments of the ribbon */ /** Remove all living segments of the ribbon */
void reset(); void reset();
@ -76,8 +76,8 @@ public:
/* Implement interfaces */ /* Implement interfaces */
virtual Texture2D* getTexture(void); virtual Texture2D* getTexture(void);
virtual void setTexture(Texture2D *texture); virtual void setTexture(Texture2D *texture);
virtual void setBlendFunc(const ccBlendFunc &blendFunc); virtual void setBlendFunc(const BlendFunc &blendFunc);
virtual const ccBlendFunc& getBlendFunc(void) const; virtual const BlendFunc& getBlendFunc(void) const;
virtual GLubyte getOpacity(void) const; virtual GLubyte getOpacity(void) const;
virtual void setOpacity(GLubyte opacity); virtual void setOpacity(GLubyte opacity);
virtual void setOpacityModifyRGB(bool bValue); virtual void setOpacityModifyRGB(bool bValue);
@ -98,7 +98,7 @@ protected:
private: private:
/** texture used for the motion streak */ /** texture used for the motion streak */
Texture2D* _texture; Texture2D* _texture;
ccBlendFunc _blendFunc; BlendFunc _blendFunc;
Point _positionR; Point _positionR;
float _stroke; float _stroke;
@ -114,9 +114,9 @@ private:
float* _pointState; float* _pointState;
// Opengl // Opengl
ccVertex2F* _vertices; Vertex2F* _vertices;
GLubyte* _colorPointer; GLubyte* _colorPointer;
ccTex2F* _texCoords; Tex2F* _texCoords;
}; };
// end of misc_nodes group // end of misc_nodes group

34
cocos2dx/misc_nodes/CCProgressTimer.cpp
View File

@ -164,29 +164,29 @@ bool ProgressTimer::isOpacityModifyRGB(void) const
/// ///
// @returns the vertex position from the texture coordinate // @returns the vertex position from the texture coordinate
/// ///
ccTex2F ProgressTimer::textureCoordFromAlphaPoint(Point alpha) Tex2F ProgressTimer::textureCoordFromAlphaPoint(Point alpha)
{ {
ccTex2F ret = {0.0f, 0.0f}; Tex2F ret(0.0f, 0.0f);
if (!_sprite) { if (!_sprite) {
return ret; return ret;
} }
ccV3F_C4B_T2F_Quad quad = _sprite->getQuad(); V3F_C4B_T2F_Quad quad = _sprite->getQuad();
Point min = ccp(quad.bl.texCoords.u,quad.bl.texCoords.v); Point min = ccp(quad.bl.texCoords.u,quad.bl.texCoords.v);
Point max = ccp(quad.tr.texCoords.u,quad.tr.texCoords.v); Point max = ccp(quad.tr.texCoords.u,quad.tr.texCoords.v);
// Fix bug #1303 so that progress timer handles sprite frame texture rotation // Fix bug #1303 so that progress timer handles sprite frame texture rotation
if (_sprite->isTextureRectRotated()) { if (_sprite->isTextureRectRotated()) {
CC_SWAP(alpha.x, alpha.y, float); CC_SWAP(alpha.x, alpha.y, float);
} }
return tex2(min.x * (1.f - alpha.x) + max.x * alpha.x, min.y * (1.f - alpha.y) + max.y * alpha.y); return Tex2F(min.x * (1.f - alpha.x) + max.x * alpha.x, min.y * (1.f - alpha.y) + max.y * alpha.y);
} }
ccVertex2F ProgressTimer::vertexFromAlphaPoint(Point alpha) Vertex2F ProgressTimer::vertexFromAlphaPoint(Point alpha)
{ {
ccVertex2F ret = {0.0f, 0.0f}; Vertex2F ret(0.0f, 0.0f);
if (!_sprite) { if (!_sprite) {
return ret; return ret;
} }
ccV3F_C4B_T2F_Quad quad = _sprite->getQuad(); V3F_C4B_T2F_Quad quad = _sprite->getQuad();
Point min = ccp(quad.bl.vertices.x,quad.bl.vertices.y); Point min = ccp(quad.bl.vertices.x,quad.bl.vertices.y);
Point max = ccp(quad.tr.vertices.x,quad.tr.vertices.y); Point max = ccp(quad.tr.vertices.x,quad.tr.vertices.y);
ret.x = min.x * (1.f - alpha.x) + max.x * alpha.x; ret.x = min.x * (1.f - alpha.x) + max.x * alpha.x;
@ -202,7 +202,7 @@ void ProgressTimer::updateColor(void)
if (_vertexData) if (_vertexData)
{ {
ccColor4B sc = _sprite->getQuad().tl.colors; Color4B sc = _sprite->getQuad().tl.colors;
for (int i = 0; i < _vertexDataCount; ++i) for (int i = 0; i < _vertexDataCount; ++i)
{ {
_vertexData[i].colors = sc; _vertexData[i].colors = sc;
@ -344,7 +344,7 @@ void ProgressTimer::updateRadial(void)
if(!_vertexData) { if(!_vertexData) {
_vertexDataCount = index + 3; _vertexDataCount = index + 3;
_vertexData = (ccV2F_C4B_T2F*)malloc(_vertexDataCount * sizeof(ccV2F_C4B_T2F)); _vertexData = (V2F_C4B_T2F*)malloc(_vertexDataCount * sizeof(V2F_C4B_T2F));
CCAssert( _vertexData, "CCProgressTimer. Not enough memory"); CCAssert( _vertexData, "CCProgressTimer. Not enough memory");
} }
updateColor(); updateColor();
@ -415,7 +415,7 @@ void ProgressTimer::updateBar(void)
if (!_reverseDirection) { if (!_reverseDirection) {
if(!_vertexData) { if(!_vertexData) {
_vertexDataCount = 4; _vertexDataCount = 4;
_vertexData = (ccV2F_C4B_T2F*)malloc(_vertexDataCount * sizeof(ccV2F_C4B_T2F)); _vertexData = (V2F_C4B_T2F*)malloc(_vertexDataCount * sizeof(V2F_C4B_T2F));
CCAssert( _vertexData, "CCProgressTimer. Not enough memory"); CCAssert( _vertexData, "CCProgressTimer. Not enough memory");
} }
// TOPLEFT // TOPLEFT
@ -436,7 +436,7 @@ void ProgressTimer::updateBar(void)
} else { } else {
if(!_vertexData) { if(!_vertexData) {
_vertexDataCount = 8; _vertexDataCount = 8;
_vertexData = (ccV2F_C4B_T2F*)malloc(_vertexDataCount * sizeof(ccV2F_C4B_T2F)); _vertexData = (V2F_C4B_T2F*)malloc(_vertexDataCount * sizeof(V2F_C4B_T2F));
CCAssert( _vertexData, "CCProgressTimer. Not enough memory"); CCAssert( _vertexData, "CCProgressTimer. Not enough memory");
// TOPLEFT 1 // TOPLEFT 1
_vertexData[0].texCoords = textureCoordFromAlphaPoint(ccp(0,1)); _vertexData[0].texCoords = textureCoordFromAlphaPoint(ccp(0,1));
@ -500,16 +500,16 @@ void ProgressTimer::draw(void)
ccGLBindTexture2D( _sprite->getTexture()->getName() ); ccGLBindTexture2D( _sprite->getTexture()->getName() );
#ifdef EMSCRIPTEN #ifdef EMSCRIPTEN
setGLBufferData((void*) _vertexData, (_vertexDataCount * sizeof(ccV2F_C4B_T2F)), 0); setGLBufferData((void*) _vertexData, (_vertexDataCount * sizeof(V2F_C4B_T2F)), 0);
int offset = 0; int offset = 0;
glVertexAttribPointer( kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, sizeof(ccV2F_C4B_T2F), (GLvoid*)offset); glVertexAttribPointer( kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, sizeof(V2F_C4B_T2F), (GLvoid*)offset);
offset += sizeof(ccVertex2F); offset += sizeof(Vertex2F);
glVertexAttribPointer( kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, sizeof(ccV2F_C4B_T2F), (GLvoid*)offset); glVertexAttribPointer( kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, sizeof(V2F_C4B_T2F), (GLvoid*)offset);
offset += sizeof(ccColor4B); offset += sizeof(Color4B);
glVertexAttribPointer( kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, sizeof(ccV2F_C4B_T2F), (GLvoid*)offset); glVertexAttribPointer( kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, sizeof(V2F_C4B_T2F), (GLvoid*)offset);
#else #else
glVertexAttribPointer( kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, sizeof(_vertexData[0]) , &_vertexData[0].vertices); glVertexAttribPointer( kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, sizeof(_vertexData[0]) , &_vertexData[0].vertices);
glVertexAttribPointer( kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, sizeof(_vertexData[0]), &_vertexData[0].texCoords); glVertexAttribPointer( kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, sizeof(_vertexData[0]), &_vertexData[0].texCoords);

6
cocos2dx/misc_nodes/CCProgressTimer.h
View File

@ -92,8 +92,8 @@ public:
/** Creates a progress timer with the sprite as the shape the timer goes through */ /** Creates a progress timer with the sprite as the shape the timer goes through */
static ProgressTimer* create(Sprite* sp); static ProgressTimer* create(Sprite* sp);
protected: protected:
ccTex2F textureCoordFromAlphaPoint(Point alpha); Tex2F textureCoordFromAlphaPoint(Point alpha);
ccVertex2F vertexFromAlphaPoint(Point alpha); Vertex2F vertexFromAlphaPoint(Point alpha);
void updateProgress(void); void updateProgress(void);
void updateBar(void); void updateBar(void);
void updateRadial(void); void updateRadial(void);
@ -105,7 +105,7 @@ protected:
float _percentage; float _percentage;
Sprite *_sprite; Sprite *_sprite;
int _vertexDataCount; int _vertexDataCount;
ccV2F_C4B_T2F *_vertexData; V2F_C4B_T2F *_vertexData;
/** /**
* Midpoint is used to modify the progress start position. * Midpoint is used to modify the progress start position.

8
cocos2dx/misc_nodes/CCRenderTexture.cpp
View File

@ -54,7 +54,7 @@ RenderTexture::RenderTexture()
, _UITextureImage(NULL) , _UITextureImage(NULL)
, _pixelFormat(kTexture2DPixelFormat_RGBA8888) , _pixelFormat(kTexture2DPixelFormat_RGBA8888)
, _clearFlags(0) , _clearFlags(0)
, _clearColor(ccc4f(0,0,0,0)) , _clearColor(Color4F(0,0,0,0))
, _clearDepth(0.0f) , _clearDepth(0.0f)
, _clearStencil(0) , _clearStencil(0)
, _autoDraw(false) , _autoDraw(false)
@ -163,12 +163,12 @@ void RenderTexture::setClearFlags(unsigned int uClearFlags)
_clearFlags = uClearFlags; _clearFlags = uClearFlags;
} }
const ccColor4F& RenderTexture::getClearColor() const const Color4F& RenderTexture::getClearColor() const
{ {
return _clearColor; return _clearColor;
} }
void RenderTexture::setClearColor(const ccColor4F &clearColor) void RenderTexture::setClearColor(const Color4F &clearColor)
{ {
_clearColor = clearColor; _clearColor = clearColor;
} }
@ -339,7 +339,7 @@ bool RenderTexture::initWithWidthAndHeight(int w, int h, Texture2DPixelFormat eF
_texture->release(); _texture->release();
_sprite->setScaleY(-1); _sprite->setScaleY(-1);
ccBlendFunc tBlendFunc = {GL_ONE, GL_ONE_MINUS_SRC_ALPHA }; BlendFunc tBlendFunc = {GL_ONE, GL_ONE_MINUS_SRC_ALPHA };
_sprite->setBlendFunc(tBlendFunc); _sprite->setBlendFunc(tBlendFunc);
glBindRenderbuffer(GL_RENDERBUFFER, oldRBO); glBindRenderbuffer(GL_RENDERBUFFER, oldRBO);

8
cocos2dx/misc_nodes/CCRenderTexture.h
View File

@ -56,7 +56,7 @@ class CC_DLL RenderTexture : public Node
/** The Sprite being used. /** The Sprite being used.
The sprite, by default, will use the following blending function: GL_ONE, GL_ONE_MINUS_SRC_ALPHA. The sprite, by default, will use the following blending function: GL_ONE, GL_ONE_MINUS_SRC_ALPHA.
The blending function can be changed in runtime by calling: The blending function can be changed in runtime by calling:
- [[renderTexture sprite] setBlendFunc:(ccBlendFunc){GL_ONE, GL_ONE_MINUS_SRC_ALPHA}]; - [[renderTexture sprite] setBlendFunc:(BlendFunc){GL_ONE, GL_ONE_MINUS_SRC_ALPHA}];
*/ */
CC_PROPERTY(Sprite*, _sprite, Sprite) CC_PROPERTY(Sprite*, _sprite, Sprite)
public: public:
@ -140,8 +140,8 @@ public:
void setClearFlags(unsigned int uClearFlags); void setClearFlags(unsigned int uClearFlags);
/** Clear color value. Valid only when "autoDraw" is true. */ /** Clear color value. Valid only when "autoDraw" is true. */
const ccColor4F& getClearColor() const; const Color4F& getClearColor() const;
void setClearColor(const ccColor4F &clearColor); void setClearColor(const Color4F &clearColor);
/** Value for clearDepth. Valid only when autoDraw is true. */ /** Value for clearDepth. Valid only when autoDraw is true. */
float getClearDepth() const; float getClearDepth() const;
@ -171,7 +171,7 @@ protected:
// code for "auto" update // code for "auto" update
GLbitfield _clearFlags; GLbitfield _clearFlags;
ccColor4F _clearColor; Color4F _clearColor;
GLclampf _clearDepth; GLclampf _clearDepth;
GLint _clearStencil; GLint _clearStencil;
bool _autoDraw; bool _autoDraw;

6
cocos2dx/particle_nodes/CCParticleBatchNode.cpp
View File

@ -437,7 +437,7 @@ void ParticleBatchNode::increaseAtlasCapacityTo(unsigned int quantity)
//sets a 0'd quad into the quads array //sets a 0'd quad into the quads array
void ParticleBatchNode::disableParticle(unsigned int particleIndex) void ParticleBatchNode::disableParticle(unsigned int particleIndex)
{ {
ccV3F_C4B_T2F_Quad* quad = &((_textureAtlas->getQuads())[particleIndex]); V3F_C4B_T2F_Quad* quad = &((_textureAtlas->getQuads())[particleIndex]);
quad->br.vertices.x = quad->br.vertices.y = quad->tr.vertices.x = quad->tr.vertices.y = quad->tl.vertices.x = quad->tl.vertices.y = quad->bl.vertices.x = quad->bl.vertices.y = 0.0f; quad->br.vertices.x = quad->br.vertices.y = quad->tr.vertices.x = quad->tr.vertices.y = quad->tl.vertices.x = quad->tl.vertices.y = quad->bl.vertices.x = quad->bl.vertices.y = 0.0f;
} }
@ -509,12 +509,12 @@ Texture2D* ParticleBatchNode::getTexture(void)
return _textureAtlas->getTexture(); return _textureAtlas->getTexture();
} }
void ParticleBatchNode::setBlendFunc(const ccBlendFunc &blendFunc) void ParticleBatchNode::setBlendFunc(const BlendFunc &blendFunc)
{ {
_blendFunc = blendFunc; _blendFunc = blendFunc;
} }
// returns the blending function used for the texture // returns the blending function used for the texture
const ccBlendFunc& ParticleBatchNode::getBlendFunc(void) const const BlendFunc& ParticleBatchNode::getBlendFunc(void) const
{ {
return _blendFunc; return _blendFunc;
} }

6
cocos2dx/particle_nodes/CCParticleBatchNode.h
View File

@ -102,9 +102,9 @@ public:
virtual Texture2D* getTexture(void); virtual Texture2D* getTexture(void);
// sets a new texture. it will be retained // sets a new texture. it will be retained
virtual void setTexture(Texture2D *texture); virtual void setTexture(Texture2D *texture);
virtual void setBlendFunc(const ccBlendFunc &blendFunc); virtual void setBlendFunc(const BlendFunc &blendFunc);
// returns the blending function used for the texture // returns the blending function used for the texture
virtual const ccBlendFunc& getBlendFunc(void) const; virtual const BlendFunc& getBlendFunc(void) const;
void visit(); void visit();
@ -119,7 +119,7 @@ private:
CC_SYNTHESIZE(TextureAtlas*, _textureAtlas, TextureAtlas); CC_SYNTHESIZE(TextureAtlas*, _textureAtlas, TextureAtlas);
private: private:
/** the blend function used for drawing the quads */ /** the blend function used for drawing the quads */
ccBlendFunc _blendFunc; BlendFunc _blendFunc;
}; };
// end of particle_nodes group // end of particle_nodes group

24
cocos2dx/particle_nodes/CCParticleSystem.cpp
View File

@ -479,13 +479,13 @@ void ParticleSystem::initParticle(tParticle* particle)
// Color // Color
ccColor4F start; Color4F start;
start.r = clampf(_startColor.r + _startColorVar.r * CCRANDOM_MINUS1_1(), 0, 1); start.r = clampf(_startColor.r + _startColorVar.r * CCRANDOM_MINUS1_1(), 0, 1);
start.g = clampf(_startColor.g + _startColorVar.g * CCRANDOM_MINUS1_1(), 0, 1); start.g = clampf(_startColor.g + _startColorVar.g * CCRANDOM_MINUS1_1(), 0, 1);
start.b = clampf(_startColor.b + _startColorVar.b * CCRANDOM_MINUS1_1(), 0, 1); start.b = clampf(_startColor.b + _startColorVar.b * CCRANDOM_MINUS1_1(), 0, 1);
start.a = clampf(_startColor.a + _startColorVar.a * CCRANDOM_MINUS1_1(), 0, 1); start.a = clampf(_startColor.a + _startColorVar.a * CCRANDOM_MINUS1_1(), 0, 1);
ccColor4F end; Color4F end;
end.r = clampf(_endColor.r + _endColorVar.r * CCRANDOM_MINUS1_1(), 0, 1); end.r = clampf(_endColor.r + _endColorVar.r * CCRANDOM_MINUS1_1(), 0, 1);
end.g = clampf(_endColor.g + _endColorVar.g * CCRANDOM_MINUS1_1(), 0, 1); end.g = clampf(_endColor.g + _endColorVar.g * CCRANDOM_MINUS1_1(), 0, 1);
end.b = clampf(_endColor.b + _endColorVar.b * CCRANDOM_MINUS1_1(), 0, 1); end.b = clampf(_endColor.b + _endColorVar.b * CCRANDOM_MINUS1_1(), 0, 1);
@ -1146,42 +1146,42 @@ void ParticleSystem::setEndSizeVar(float var)
_endSizeVar = var; _endSizeVar = var;
} }
const ccColor4F& ParticleSystem::getStartColor() const const Color4F& ParticleSystem::getStartColor() const
{ {
return _startColor; return _startColor;
} }
void ParticleSystem::setStartColor(const ccColor4F& var) void ParticleSystem::setStartColor(const Color4F& var)
{ {
_startColor = var; _startColor = var;
} }
const ccColor4F& ParticleSystem::getStartColorVar() const const Color4F& ParticleSystem::getStartColorVar() const
{ {
return _startColorVar; return _startColorVar;
} }
void ParticleSystem::setStartColorVar(const ccColor4F& var) void ParticleSystem::setStartColorVar(const Color4F& var)
{ {
_startColorVar = var; _startColorVar = var;
} }
const ccColor4F& ParticleSystem::getEndColor() const const Color4F& ParticleSystem::getEndColor() const
{ {
return _endColor; return _endColor;
} }
void ParticleSystem::setEndColor(const ccColor4F& var) void ParticleSystem::setEndColor(const Color4F& var)
{ {
_endColor = var; _endColor = var;
} }
const ccColor4F& ParticleSystem::getEndColorVar() const const Color4F& ParticleSystem::getEndColorVar() const
{ {
return _endColorVar; return _endColorVar;
} }
void ParticleSystem::setEndColorVar(const ccColor4F& var) void ParticleSystem::setEndColorVar(const Color4F& var)
{ {
_endColorVar = var; _endColorVar = var;
} }
@ -1246,12 +1246,12 @@ void ParticleSystem::setTotalParticles(unsigned int var)
_totalParticles = var; _totalParticles = var;
} }
const ccBlendFunc& ParticleSystem::getBlendFunc() const const BlendFunc& ParticleSystem::getBlendFunc() const
{ {
return _blendFunc; return _blendFunc;
} }
void ParticleSystem::setBlendFunc(const ccBlendFunc &blendFunc) void ParticleSystem::setBlendFunc(const BlendFunc &blendFunc)
{ {
if( _blendFunc.src != blendFunc.src || _blendFunc.dst != blendFunc.dst ) { if( _blendFunc.src != blendFunc.src || _blendFunc.dst != blendFunc.dst ) {
_blendFunc = blendFunc; _blendFunc = blendFunc;

14
cocos2dx/particle_nodes/CCParticleSystem.h
View File

@ -86,8 +86,8 @@ typedef struct sParticle {
Point pos; Point pos;
Point startPos; Point startPos;
ccColor4F color; Color4F color;
ccColor4F deltaColor; Color4F deltaColor;
float size; float size;
float deltaSize; float deltaSize;
@ -305,13 +305,13 @@ public:
/** end size variance in pixels of each particle */ /** end size variance in pixels of each particle */
CC_PROPERTY(float, _endSizeVar, EndSizeVar) CC_PROPERTY(float, _endSizeVar, EndSizeVar)
/** start color of each particle */ /** start color of each particle */
CC_PROPERTY_PASS_BY_REF(ccColor4F, _startColor, StartColor) CC_PROPERTY_PASS_BY_REF(Color4F, _startColor, StartColor)
/** start color variance of each particle */ /** start color variance of each particle */
CC_PROPERTY_PASS_BY_REF(ccColor4F, _startColorVar, StartColorVar) CC_PROPERTY_PASS_BY_REF(Color4F, _startColorVar, StartColorVar)
/** end color and end color variation of each particle */ /** end color and end color variation of each particle */
CC_PROPERTY_PASS_BY_REF(ccColor4F, _endColor, EndColor) CC_PROPERTY_PASS_BY_REF(Color4F, _endColor, EndColor)
/** end color variance of each particle */ /** end color variance of each particle */
CC_PROPERTY_PASS_BY_REF(ccColor4F, _endColorVar, EndColorVar) CC_PROPERTY_PASS_BY_REF(Color4F, _endColorVar, EndColorVar)
//* initial angle of each particle //* initial angle of each particle
CC_PROPERTY(float, _startSpin, StartSpin) CC_PROPERTY(float, _startSpin, StartSpin)
//* initial angle of each particle //* initial angle of each particle
@ -327,7 +327,7 @@ public:
/** conforms to CocosNodeTexture protocol */ /** conforms to CocosNodeTexture protocol */
CC_PROPERTY(Texture2D*, _texture, Texture) CC_PROPERTY(Texture2D*, _texture, Texture)
/** conforms to CocosNodeTexture protocol */ /** conforms to CocosNodeTexture protocol */
CC_PROPERTY_PASS_BY_REF(ccBlendFunc, _blendFunc, BlendFunc) CC_PROPERTY_PASS_BY_REF(BlendFunc, _blendFunc, BlendFunc)
/** does the alpha value modify color */ /** does the alpha value modify color */
CC_PROPERTY(bool, _opacityModifyRGB, OpacityModifyRGB) CC_PROPERTY(bool, _opacityModifyRGB, OpacityModifyRGB)

34
cocos2dx/particle_nodes/CCParticleSystemQuad.cpp
View File

@ -163,7 +163,7 @@ void ParticleSystemQuad::initTexCoordsWithRect(const Rect& pointRect)
// Important. Texture in cocos2d are inverted, so the Y component should be inverted // Important. Texture in cocos2d are inverted, so the Y component should be inverted
CC_SWAP( top, bottom, float); CC_SWAP( top, bottom, float);
ccV3F_C4B_T2F_Quad *quads = NULL; V3F_C4B_T2F_Quad *quads = NULL;
unsigned int start = 0, end = 0; unsigned int start = 0, end = 0;
if (_batchNode) if (_batchNode)
{ {
@ -239,20 +239,20 @@ void ParticleSystemQuad::initIndices()
void ParticleSystemQuad::updateQuadWithParticle(tParticle* particle, const Point& newPosition) void ParticleSystemQuad::updateQuadWithParticle(tParticle* particle, const Point& newPosition)
{ {
ccV3F_C4B_T2F_Quad *quad; V3F_C4B_T2F_Quad *quad;
if (_batchNode) if (_batchNode)
{ {
ccV3F_C4B_T2F_Quad *batchQuads = _batchNode->getTextureAtlas()->getQuads(); V3F_C4B_T2F_Quad *batchQuads = _batchNode->getTextureAtlas()->getQuads();
quad = &(batchQuads[_atlasIndex+particle->atlasIndex]); quad = &(batchQuads[_atlasIndex+particle->atlasIndex]);
} }
else else
{ {
quad = &(_quads[_particleIdx]); quad = &(_quads[_particleIdx]);
} }
ccColor4B color = (_opacityModifyRGB) Color4B color = (_opacityModifyRGB)
? ccc4( particle->color.r*particle->color.a*255, particle->color.g*particle->color.a*255, particle->color.b*particle->color.a*255, particle->color.a*255) ? Color4B( particle->color.r*particle->color.a*255, particle->color.g*particle->color.a*255, particle->color.b*particle->color.a*255, particle->color.a*255)
: ccc4( particle->color.r*255, particle->color.g*255, particle->color.b*255, particle->color.a*255); : Color4B( particle->color.r*255, particle->color.g*255, particle->color.b*255, particle->color.a*255);
quad->bl.colors = color; quad->bl.colors = color;
quad->br.colors = color; quad->br.colors = color;
@ -378,11 +378,11 @@ void ParticleSystemQuad::draw()
glBindBuffer(GL_ARRAY_BUFFER, _buffersVBO[0]); glBindBuffer(GL_ARRAY_BUFFER, _buffersVBO[0]);
// vertices // vertices
glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, vertices)); glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( V3F_C4B_T2F, vertices));
// colors // colors
glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, colors)); glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, kQuadSize, (GLvoid*) offsetof( V3F_C4B_T2F, colors));
// tex coords // tex coords
glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, texCoords)); glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( V3F_C4B_T2F, texCoords));
glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, _buffersVBO[1]); glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, _buffersVBO[1]);
@ -409,7 +409,7 @@ void ParticleSystemQuad::setTotalParticles(unsigned int tp)
size_t indicesSize = sizeof(_indices[0]) * tp * 6 * 1; size_t indicesSize = sizeof(_indices[0]) * tp * 6 * 1;
tParticle* particlesNew = (tParticle*)realloc(_particles, particlesSize); tParticle* particlesNew = (tParticle*)realloc(_particles, particlesSize);
ccV3F_C4B_T2F_Quad* quadsNew = (ccV3F_C4B_T2F_Quad*)realloc(_quads, quadsSize); V3F_C4B_T2F_Quad* quadsNew = (V3F_C4B_T2F_Quad*)realloc(_quads, quadsSize);
GLushort* indicesNew = (GLushort*)realloc(_indices, indicesSize); GLushort* indicesNew = (GLushort*)realloc(_indices, indicesSize);
if (particlesNew && quadsNew && indicesNew) if (particlesNew && quadsNew && indicesNew)
@ -483,15 +483,15 @@ void ParticleSystemQuad::setupVBOandVAO()
// vertices // vertices
glEnableVertexAttribArray(kVertexAttrib_Position); glEnableVertexAttribArray(kVertexAttrib_Position);
glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, vertices)); glVertexAttribPointer(kVertexAttrib_Position, 2, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( V3F_C4B_T2F, vertices));
// colors // colors
glEnableVertexAttribArray(kVertexAttrib_Color); glEnableVertexAttribArray(kVertexAttrib_Color);
glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, colors)); glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, kQuadSize, (GLvoid*) offsetof( V3F_C4B_T2F, colors));
// tex coords // tex coords
glEnableVertexAttribArray(kVertexAttrib_TexCoords); glEnableVertexAttribArray(kVertexAttrib_TexCoords);
glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, texCoords)); glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( V3F_C4B_T2F, texCoords));
glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, _buffersVBO[1]); glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, _buffersVBO[1]);
glBufferData(GL_ELEMENT_ARRAY_BUFFER, sizeof(_indices[0]) * _totalParticles * 6, _indices, GL_STATIC_DRAW); glBufferData(GL_ELEMENT_ARRAY_BUFFER, sizeof(_indices[0]) * _totalParticles * 6, _indices, GL_STATIC_DRAW);
@ -541,7 +541,7 @@ bool ParticleSystemQuad::allocMemory()
CC_SAFE_FREE(_quads); CC_SAFE_FREE(_quads);
CC_SAFE_FREE(_indices); CC_SAFE_FREE(_indices);
_quads = (ccV3F_C4B_T2F_Quad*)malloc(_totalParticles * sizeof(ccV3F_C4B_T2F_Quad)); _quads = (V3F_C4B_T2F_Quad*)malloc(_totalParticles * sizeof(V3F_C4B_T2F_Quad));
_indices = (GLushort*)malloc(_totalParticles * 6 * sizeof(GLushort)); _indices = (GLushort*)malloc(_totalParticles * 6 * sizeof(GLushort));
if( !_quads || !_indices) if( !_quads || !_indices)
@ -553,7 +553,7 @@ bool ParticleSystemQuad::allocMemory()
return false; return false;
} }
memset(_quads, 0, _totalParticles * sizeof(ccV3F_C4B_T2F_Quad)); memset(_quads, 0, _totalParticles * sizeof(V3F_C4B_T2F_Quad));
memset(_indices, 0, _totalParticles * 6 * sizeof(GLushort)); memset(_indices, 0, _totalParticles * 6 * sizeof(GLushort));
return true; return true;
@ -583,8 +583,8 @@ void ParticleSystemQuad::setBatchNode(ParticleBatchNode * batchNode)
else if( !oldBatch ) else if( !oldBatch )
{ {
// copy current state to batch // copy current state to batch
ccV3F_C4B_T2F_Quad *batchQuads = _batchNode->getTextureAtlas()->getQuads(); V3F_C4B_T2F_Quad *batchQuads = _batchNode->getTextureAtlas()->getQuads();
ccV3F_C4B_T2F_Quad *quad = &(batchQuads[_atlasIndex] ); V3F_C4B_T2F_Quad *quad = &(batchQuads[_atlasIndex] );
memcpy( quad, _quads, _totalParticles * sizeof(_quads[0]) ); memcpy( quad, _quads, _totalParticles * sizeof(_quads[0]) );
CC_SAFE_FREE(_quads); CC_SAFE_FREE(_quads);

2
cocos2dx/particle_nodes/CCParticleSystemQuad.h
View File

@ -53,7 +53,7 @@ Special features and Limitations:
class CC_DLL ParticleSystemQuad : public ParticleSystem class CC_DLL ParticleSystemQuad : public ParticleSystem
{ {
protected: protected:
ccV3F_C4B_T2F_Quad *_quads; // quads to be rendered V3F_C4B_T2F_Quad *_quads; // quads to be rendered
GLushort *_indices; // indices GLushort *_indices; // indices
#if CC_TEXTURE_ATLAS_USE_VAO #if CC_TEXTURE_ATLAS_USE_VAO

2
cocos2dx/platform/mac/CCImage.mm
View File

@ -328,7 +328,7 @@ static bool _isValidFontName(const char *fontName)
return ret; return ret;
} }
static bool _initWithString(const char * pText, cocos2d::Image::ETextAlign eAlign, const char * pFontName, int nSize, tImageInfo* pInfo, cocos2d::ccColor3B* pStrokeColor) static bool _initWithString(const char * pText, cocos2d::Image::ETextAlign eAlign, const char * pFontName, int nSize, tImageInfo* pInfo, cocos2d::Color3B* pStrokeColor)
{ {
bool bRet = false; bool bRet = false;

1
cocos2dx/proj.linux/Makefile
View File

@ -138,6 +138,7 @@ SOURCES = ../actions/CCAction.cpp \
../CCDirector.cpp \ ../CCDirector.cpp \
../CCScheduler.cpp \ ../CCScheduler.cpp \
../ccFPSImages.c \ ../ccFPSImages.c \
../ccTypes.cpp \
../cocos2d.cpp ../cocos2d.cpp
COCOS_ROOT = ../.. COCOS_ROOT = ../..

1
cocos2dx/proj.nacl/Makefile
View File

@ -132,6 +132,7 @@ SOURCES = ../actions/CCAction.cpp \
../CCDirector.cpp \ ../CCDirector.cpp \
../CCScheduler.cpp \ ../CCScheduler.cpp \
../ccFPSImages.c \ ../ccFPSImages.c \
../ccTypes.cpp \
../cocos2d.cpp ../cocos2d.cpp
include cocos2dx.mk include cocos2dx.mk

1
cocos2dx/proj.win32/cocos2d.vcxproj
View File

@ -143,6 +143,7 @@ xcopy /Y /Q "$(ProjectDir)..\platform\third_party\win32\libraries\*.*" "$(OutDir
<ClCompile Include="..\base_nodes\CCAtlasNode.cpp" /> <ClCompile Include="..\base_nodes\CCAtlasNode.cpp" />
<ClCompile Include="..\base_nodes\CCNode.cpp" /> <ClCompile Include="..\base_nodes\CCNode.cpp" />
<ClCompile Include="..\ccFPSImages.c" /> <ClCompile Include="..\ccFPSImages.c" />
<ClCompile Include="..\ccTypes.cpp" />
<ClCompile Include="..\cocoa\CCAffineTransform.cpp" /> <ClCompile Include="..\cocoa\CCAffineTransform.cpp" />
<ClCompile Include="..\cocoa\CCArray.cpp" /> <ClCompile Include="..\cocoa\CCArray.cpp" />
<ClCompile Include="..\cocoa\CCAutoreleasePool.cpp" /> <ClCompile Include="..\cocoa\CCAutoreleasePool.cpp" />

1
cocos2dx/proj.win32/cocos2d.vcxproj.filters
View File

@ -489,6 +489,7 @@
<ClCompile Include="..\keyboard_dispatcher\CCKeyboardDispatcher.cpp"> <ClCompile Include="..\keyboard_dispatcher\CCKeyboardDispatcher.cpp">
<Filter>keyboard_dispatcher</Filter> <Filter>keyboard_dispatcher</Filter>
</ClCompile> </ClCompile>
<ClCompile Include="..\ccTypes.cpp" />
</ItemGroup> </ItemGroup>
<ItemGroup> <ItemGroup>
<ClInclude Include="..\base_nodes\CCAtlasNode.h"> <ClInclude Include="..\base_nodes\CCAtlasNode.h">

40
cocos2dx/sprite_nodes/CCSprite.cpp
View File

@ -176,7 +176,7 @@ bool Sprite::initWithTexture(Texture2D *pTexture, const Rect& rect, bool rotated
memset(&_quad, 0, sizeof(_quad)); memset(&_quad, 0, sizeof(_quad));
// Atlas: Color // Atlas: Color
ccColor4B tmpColor = { 255, 255, 255, 255 }; Color4B tmpColor(255, 255, 255, 255);
_quad.bl.colors = tmpColor; _quad.bl.colors = tmpColor;
_quad.br.colors = tmpColor; _quad.br.colors = tmpColor;
_quad.tl.colors = tmpColor; _quad.tl.colors = tmpColor;
@ -351,10 +351,10 @@ void Sprite::setTextureRect(const Rect& rect, bool rotated, const Size& untrimme
float y2 = y1 + _rect.size.height; float y2 = y1 + _rect.size.height;
// Don't update Z. // Don't update Z.
_quad.bl.vertices = vertex3(x1, y1, 0); _quad.bl.vertices = Vertex3F(x1, y1, 0);
_quad.br.vertices = vertex3(x2, y1, 0); _quad.br.vertices = Vertex3F(x2, y1, 0);
_quad.tl.vertices = vertex3(x1, y2, 0); _quad.tl.vertices = Vertex3F(x1, y2, 0);
_quad.tr.vertices = vertex3(x2, y2, 0); _quad.tr.vertices = Vertex3F(x2, y2, 0);
} }
} }
@ -457,7 +457,7 @@ void Sprite::updateTransform(void)
// If it is not visible, or one of its ancestors is not visible, then do nothing: // If it is not visible, or one of its ancestors is not visible, then do nothing:
if( !_visible || ( _parent && _parent != _batchNode && ((Sprite*)_parent)->_shouldBeHidden) ) if( !_visible || ( _parent && _parent != _batchNode && ((Sprite*)_parent)->_shouldBeHidden) )
{ {
_quad.br.vertices = _quad.tl.vertices = _quad.tr.vertices = _quad.bl.vertices = vertex3(0,0,0); _quad.br.vertices = _quad.tl.vertices = _quad.tr.vertices = _quad.bl.vertices = Vertex3F(0,0,0);
_shouldBeHidden = true; _shouldBeHidden = true;
} }
else else
@ -504,10 +504,10 @@ void Sprite::updateTransform(void)
float dx = x1 * cr - y2 * sr2 + x; float dx = x1 * cr - y2 * sr2 + x;
float dy = x1 * sr + y2 * cr2 + y; float dy = x1 * sr + y2 * cr2 + y;
_quad.bl.vertices = vertex3( RENDER_IN_SUBPIXEL(ax), RENDER_IN_SUBPIXEL(ay), _vertexZ ); _quad.bl.vertices = Vertex3F( RENDER_IN_SUBPIXEL(ax), RENDER_IN_SUBPIXEL(ay), _vertexZ );
_quad.br.vertices = vertex3( RENDER_IN_SUBPIXEL(bx), RENDER_IN_SUBPIXEL(by), _vertexZ ); _quad.br.vertices = Vertex3F( RENDER_IN_SUBPIXEL(bx), RENDER_IN_SUBPIXEL(by), _vertexZ );
_quad.tl.vertices = vertex3( RENDER_IN_SUBPIXEL(dx), RENDER_IN_SUBPIXEL(dy), _vertexZ ); _quad.tl.vertices = Vertex3F( RENDER_IN_SUBPIXEL(dx), RENDER_IN_SUBPIXEL(dy), _vertexZ );
_quad.tr.vertices = vertex3( RENDER_IN_SUBPIXEL(cx), RENDER_IN_SUBPIXEL(cy), _vertexZ ); _quad.tr.vertices = Vertex3F( RENDER_IN_SUBPIXEL(cx), RENDER_IN_SUBPIXEL(cy), _vertexZ );
} }
// MARMALADE CHANGE: ADDED CHECK FOR NULL, TO PERMIT SPRITES WITH NO BATCH NODE / TEXTURE ATLAS // MARMALADE CHANGE: ADDED CHECK FOR NULL, TO PERMIT SPRITES WITH NO BATCH NODE / TEXTURE ATLAS
@ -579,18 +579,18 @@ void Sprite::draw(void)
#endif // EMSCRIPTEN #endif // EMSCRIPTEN
// vertex // vertex
int diff = offsetof( ccV3F_C4B_T2F, vertices); int diff = offsetof( V3F_C4B_T2F, vertices);
glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, kQuadSize, (void*) (offset + diff)); glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, kQuadSize, (void*) (offset + diff));
if (_texture != NULL) if (_texture != NULL)
{ {
// texCoods // texCoods
diff = offsetof( ccV3F_C4B_T2F, texCoords); diff = offsetof( V3F_C4B_T2F, texCoords);
glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, kQuadSize, (void*)(offset + diff)); glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, kQuadSize, (void*)(offset + diff));
} }
// color // color
diff = offsetof( ccV3F_C4B_T2F, colors); diff = offsetof( V3F_C4B_T2F, colors);
glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, kQuadSize, (void*)(offset + diff)); glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, kQuadSize, (void*)(offset + diff));
@ -902,7 +902,7 @@ bool Sprite::isFlipY(void) const
void Sprite::updateColor(void) void Sprite::updateColor(void)
{ {
ccColor4B color4 = { _displayedColor.r, _displayedColor.g, _displayedColor.b, _displayedOpacity }; Color4B color4( _displayedColor.r, _displayedColor.g, _displayedColor.b, _displayedOpacity );
// special opacity for premultiplied textures // special opacity for premultiplied textures
if (_opacityModifyRGB) if (_opacityModifyRGB)
@ -943,7 +943,7 @@ void Sprite::setOpacity(GLubyte opacity)
updateColor(); updateColor();
} }
void Sprite::setColor(const ccColor3B& color3) void Sprite::setColor(const Color3B& color3)
{ {
NodeRGBA::setColor(color3); NodeRGBA::setColor(color3);
@ -964,7 +964,7 @@ bool Sprite::isOpacityModifyRGB(void) const
return _opacityModifyRGB; return _opacityModifyRGB;
} }
void Sprite::updateDisplayedColor(const ccColor3B& parentColor) void Sprite::updateDisplayedColor(const Color3B& parentColor)
{ {
NodeRGBA::updateDisplayedColor(parentColor); NodeRGBA::updateDisplayedColor(parentColor);
@ -1049,10 +1049,10 @@ void Sprite::setBatchNode(SpriteBatchNode *pobSpriteBatchNode)
float y1 = _offsetPosition.y; float y1 = _offsetPosition.y;
float x2 = x1 + _rect.size.width; float x2 = x1 + _rect.size.width;
float y2 = y1 + _rect.size.height; float y2 = y1 + _rect.size.height;
_quad.bl.vertices = vertex3( x1, y1, 0 ); _quad.bl.vertices = Vertex3F( x1, y1, 0 );
_quad.br.vertices = vertex3( x2, y1, 0 ); _quad.br.vertices = Vertex3F( x2, y1, 0 );
_quad.tl.vertices = vertex3( x1, y2, 0 ); _quad.tl.vertices = Vertex3F( x1, y2, 0 );
_quad.tr.vertices = vertex3( x2, y2, 0 ); _quad.tr.vertices = Vertex3F( x2, y2, 0 );
} else { } else {

14
cocos2dx/sprite_nodes/CCSprite.h
View File

@ -263,8 +263,8 @@ public:
/// @name Functions inherited from TextureProtocol /// @name Functions inherited from TextureProtocol
virtual void setTexture(Texture2D *texture); virtual void setTexture(Texture2D *texture);
virtual Texture2D* getTexture(void); virtual Texture2D* getTexture(void);
virtual void setBlendFunc(const ccBlendFunc &blendFunc) { _blendFunc = blendFunc; } inline void setBlendFunc(const BlendFunc &blendFunc) { _blendFunc = blendFunc; }
virtual const ccBlendFunc& getBlendFunc(void) const { return _blendFunc; } inline const BlendFunc& getBlendFunc(void) const { return _blendFunc; }
/// @} /// @}
/// @{ /// @{
@ -294,8 +294,8 @@ public:
/// @{ /// @{
/// @name Functions inherited from NodeRGBA /// @name Functions inherited from NodeRGBA
virtual void setColor(const ccColor3B& color3); virtual void setColor(const Color3B& color3);
virtual void updateDisplayedColor(const ccColor3B& parentColor); virtual void updateDisplayedColor(const Color3B& parentColor);
virtual void setOpacity(GLubyte opacity); virtual void setOpacity(GLubyte opacity);
virtual void setOpacityModifyRGB(bool modify); virtual void setOpacityModifyRGB(bool modify);
virtual bool isOpacityModifyRGB(void) const; virtual bool isOpacityModifyRGB(void) const;
@ -410,7 +410,7 @@ public:
/** /**
* Returns the quad (tex coords, vertex coords and color) information. * Returns the quad (tex coords, vertex coords and color) information.
*/ */
inline ccV3F_C4B_T2F_Quad getQuad(void) const { return _quad; } inline V3F_C4B_T2F_Quad getQuad(void) const { return _quad; }
/** /**
* Returns whether or not the texture rectangle is rotated. * Returns whether or not the texture rectangle is rotated.
@ -510,7 +510,7 @@ protected:
// //
// Data used when the sprite is self-rendered // Data used when the sprite is self-rendered
// //
ccBlendFunc _blendFunc; /// It's required for TextureProtocol inheritance BlendFunc _blendFunc; /// It's required for TextureProtocol inheritance
Texture2D* _texture; /// Texture2D object that is used to render the sprite Texture2D* _texture; /// Texture2D object that is used to render the sprite
// //
@ -526,7 +526,7 @@ protected:
Point _unflippedOffsetPositionFromCenter; Point _unflippedOffsetPositionFromCenter;
// vertex coords, texture coords and color info // vertex coords, texture coords and color info
ccV3F_C4B_T2F_Quad _quad; V3F_C4B_T2F_Quad _quad;
// opacity and RGB protocol // opacity and RGB protocol
bool _opacityModifyRGB; bool _opacityModifyRGB;

14
cocos2dx/sprite_nodes/CCSpriteBatchNode.cpp
View File

@ -365,10 +365,10 @@ void SpriteBatchNode::updateAtlasIndex(Sprite* sprite, int* curIndex)
void SpriteBatchNode::swap(int oldIndex, int newIndex) void SpriteBatchNode::swap(int oldIndex, int newIndex)
{ {
Object** x = _descendants->data->arr; Object** x = _descendants->data->arr;
ccV3F_C4B_T2F_Quad* quads = _textureAtlas->getQuads(); V3F_C4B_T2F_Quad* quads = _textureAtlas->getQuads();
Object* tempItem = x[oldIndex]; Object* tempItem = x[oldIndex];
ccV3F_C4B_T2F_Quad tempItemQuad=quads[oldIndex]; V3F_C4B_T2F_Quad tempItemQuad=quads[oldIndex];
//update the index of other swapped item //update the index of other swapped item
((Sprite*) x[newIndex])->setAtlasIndex(oldIndex); ((Sprite*) x[newIndex])->setAtlasIndex(oldIndex);
@ -566,7 +566,7 @@ void SpriteBatchNode::insertChild(Sprite *pSprite, unsigned int uIndex)
increaseAtlasCapacity(); increaseAtlasCapacity();
} }
ccV3F_C4B_T2F_Quad quad = pSprite->getQuad(); V3F_C4B_T2F_Quad quad = pSprite->getQuad();
_textureAtlas->insertQuad(&quad, uIndex); _textureAtlas->insertQuad(&quad, uIndex);
ccArray *descendantsData = _descendants->data; ccArray *descendantsData = _descendants->data;
@ -611,7 +611,7 @@ void SpriteBatchNode::appendChild(Sprite* sprite)
sprite->setAtlasIndex(index); sprite->setAtlasIndex(index);
ccV3F_C4B_T2F_Quad quad = sprite->getQuad(); V3F_C4B_T2F_Quad quad = sprite->getQuad();
_textureAtlas->insertQuad(&quad, index); _textureAtlas->insertQuad(&quad, index);
// add children recursively // add children recursively
@ -673,12 +673,12 @@ void SpriteBatchNode::updateBlendFunc(void)
} }
// CocosNodeTexture protocol // CocosNodeTexture protocol
void SpriteBatchNode::setBlendFunc(const ccBlendFunc &blendFunc) void SpriteBatchNode::setBlendFunc(const BlendFunc &blendFunc)
{ {
_blendFunc = blendFunc; _blendFunc = blendFunc;
} }
const ccBlendFunc& SpriteBatchNode::getBlendFunc(void) const const BlendFunc& SpriteBatchNode::getBlendFunc(void) const
{ {
return _blendFunc; return _blendFunc;
} }
@ -714,7 +714,7 @@ void SpriteBatchNode::insertQuadFromSprite(Sprite *sprite, unsigned int index)
sprite->setBatchNode(this); sprite->setBatchNode(this);
sprite->setAtlasIndex(index); sprite->setAtlasIndex(index);
ccV3F_C4B_T2F_Quad quad = sprite->getQuad(); V3F_C4B_T2F_Quad quad = sprite->getQuad();
_textureAtlas->insertQuad(&quad, index); _textureAtlas->insertQuad(&quad, index);
// XXX: updateTransform will update the textureAtlas too, using updateQuad. // XXX: updateTransform will update the textureAtlas too, using updateQuad.

6
cocos2dx/sprite_nodes/CCSpriteBatchNode.h
View File

@ -131,8 +131,8 @@ public:
// TextureProtocol // TextureProtocol
virtual Texture2D* getTexture(void); virtual Texture2D* getTexture(void);
virtual void setTexture(Texture2D *texture); virtual void setTexture(Texture2D *texture);
virtual void setBlendFunc(const ccBlendFunc &blendFunc); virtual void setBlendFunc(const BlendFunc &blendFunc);
virtual const ccBlendFunc& getBlendFunc(void) const; virtual const BlendFunc& getBlendFunc(void) const;
virtual void visit(void); virtual void visit(void);
virtual void addChild(Node * child); virtual void addChild(Node * child);
@ -168,7 +168,7 @@ private:
protected: protected:
TextureAtlas *_textureAtlas; TextureAtlas *_textureAtlas;
ccBlendFunc _blendFunc; BlendFunc _blendFunc;
// all descendants: children, gran children, etc... // all descendants: children, gran children, etc...
Array* _descendants; Array* _descendants;

14
cocos2dx/support/CCVertex.cpp
View File

@ -29,7 +29,7 @@
NS_CC_BEGIN NS_CC_BEGIN
void ccVertexLineToPolygon(Point *points, float stroke, ccVertex2F *vertices, unsigned int offset, unsigned int nuPoints) void ccVertexLineToPolygon(Point *points, float stroke, Vertex2F *vertices, unsigned int offset, unsigned int nuPoints)
{ {
nuPoints += offset; nuPoints += offset;
if(nuPoints<=1) return; if(nuPoints<=1) return;
@ -69,8 +69,8 @@ void ccVertexLineToPolygon(Point *points, float stroke, ccVertex2F *vertices, un
} }
perpVector = ccpMult(perpVector, stroke); perpVector = ccpMult(perpVector, stroke);
vertices[idx] = vertex2(p1.x+perpVector.x, p1.y+perpVector.y); vertices[idx] = Vertex2F(p1.x+perpVector.x, p1.y+perpVector.y);
vertices[idx+1] = vertex2(p1.x-perpVector.x, p1.y-perpVector.y); vertices[idx+1] = Vertex2F(p1.x-perpVector.x, p1.y-perpVector.y);
} }
@ -81,10 +81,10 @@ void ccVertexLineToPolygon(Point *points, float stroke, ccVertex2F *vertices, un
idx = i*2; idx = i*2;
const unsigned int idx1 = idx+2; const unsigned int idx1 = idx+2;
ccVertex2F p1 = vertices[idx]; Vertex2F p1 = vertices[idx];
ccVertex2F p2 = vertices[idx+1]; Vertex2F p2 = vertices[idx+1];
ccVertex2F p3 = vertices[idx1]; Vertex2F p3 = vertices[idx1];
ccVertex2F p4 = vertices[idx1+1]; Vertex2F p4 = vertices[idx1+1];
float s; float s;
//BOOL fixVertex = !ccpLineIntersect(ccp(p1.x, p1.y), ccp(p4.x, p4.y), ccp(p2.x, p2.y), ccp(p3.x, p3.y), &s, &t); //BOOL fixVertex = !ccpLineIntersect(ccp(p1.x, p1.y), ccp(p4.x, p4.y), ccp(p2.x, p2.y), ccp(p3.x, p3.y), &s, &t);

2
cocos2dx/support/CCVertex.h
View File

@ -37,7 +37,7 @@ NS_CC_BEGIN
/** @file Vertex.h */ /** @file Vertex.h */
/** converts a line to a polygon */ /** converts a line to a polygon */
void CC_DLL ccVertexLineToPolygon(Point *points, float stroke, ccVertex2F *vertices, unsigned int offset, unsigned int nuPoints); void CC_DLL ccVertexLineToPolygon(Point *points, float stroke, Vertex2F *vertices, unsigned int offset, unsigned int nuPoints);
/** returns whether or not the line intersects */ /** returns whether or not the line intersects */
bool CC_DLL ccVertexLineIntersect(float Ax, float Ay, bool CC_DLL ccVertexLineIntersect(float Ax, float Ay,

6
cocos2dx/text_input_node/CCTextFieldTTF.cpp
View File

@ -265,18 +265,18 @@ void TextFieldTTF::draw()
} }
// draw placeholder // draw placeholder
ccColor3B color = getColor(); Color3B color = getColor();
setColor(_colorSpaceHolder); setColor(_colorSpaceHolder);
LabelTTF::draw(); LabelTTF::draw();
setColor(color); setColor(color);
} }
const ccColor3B& TextFieldTTF::getColorSpaceHolder() const Color3B& TextFieldTTF::getColorSpaceHolder()
{ {
return _colorSpaceHolder; return _colorSpaceHolder;
} }
void TextFieldTTF::setColorSpaceHolder(const ccColor3B& color) void TextFieldTTF::setColorSpaceHolder(const Color3B& color)
{ {
_colorSpaceHolder = color; _colorSpaceHolder = color;
} }

6
cocos2dx/text_input_node/CCTextFieldTTF.h
View File

@ -127,8 +127,8 @@ public:
CC_SYNTHESIZE(TextFieldDelegate *, _delegate, Delegate); CC_SYNTHESIZE(TextFieldDelegate *, _delegate, Delegate);
CC_SYNTHESIZE_READONLY(int, _charCount, CharCount); CC_SYNTHESIZE_READONLY(int, _charCount, CharCount);
virtual const ccColor3B& getColorSpaceHolder(); virtual const Color3B& getColorSpaceHolder();
virtual void setColorSpaceHolder(const ccColor3B& color); virtual void setColorSpaceHolder(const Color3B& color);
// input text property // input text property
public: public:
@ -144,7 +144,7 @@ public:
virtual const char * getPlaceHolder(void); virtual const char * getPlaceHolder(void);
protected: protected:
std::string * _placeHolder; std::string * _placeHolder;
ccColor3B _colorSpaceHolder; Color3B _colorSpaceHolder;
public: public:
virtual void setSecureTextEntry(bool value); virtual void setSecureTextEntry(bool value);
virtual bool isSecureTextEntry(); virtual bool isSecureTextEntry();

62
cocos2dx/textures/CCTexture2D.cpp
View File

@ -444,7 +444,7 @@ bool Texture2D::initWithString(const char *text, const char *fontName, float fon
{ {
#if (CC_TARGET_PLATFORM == CC_PLATFORM_ANDROID) || (CC_TARGET_PLATFORM == CC_PLATFORM_IOS) #if (CC_TARGET_PLATFORM == CC_PLATFORM_ANDROID) || (CC_TARGET_PLATFORM == CC_PLATFORM_IOS)
ccFontDefinition tempDef; FontDefinition tempDef;
tempDef._shadow._shadowEnabled = false; tempDef._shadow._shadowEnabled = false;
tempDef._stroke._strokeEnabled = false; tempDef._stroke._strokeEnabled = false;
@ -455,9 +455,9 @@ bool Texture2D::initWithString(const char *text, const char *fontName, float fon
tempDef._dimensions = dimensions; tempDef._dimensions = dimensions;
tempDef._alignment = hAlignment; tempDef._alignment = hAlignment;
tempDef._vertAlignment = vAlignment; tempDef._vertAlignment = vAlignment;
tempDef._fontFillColor = ccWHITE; tempDef._fontFillColor = Color3B::white;
return initWithString(text, &tempDef); return initWithString(text, tempDef);
#else #else
@ -510,32 +510,32 @@ bool Texture2D::initWithString(const char *text, const char *fontName, float fon
} }
bool Texture2D::initWithString(const char *text, ccFontDefinition *textDefinition) bool Texture2D::initWithString(const char *text, const FontDefinition& textDefinition)
{ {
#if (CC_TARGET_PLATFORM == CC_PLATFORM_ANDROID) || (CC_TARGET_PLATFORM == CC_PLATFORM_IOS) #if (CC_TARGET_PLATFORM == CC_PLATFORM_ANDROID) || (CC_TARGET_PLATFORM == CC_PLATFORM_IOS)
#if CC_ENABLE_CACHE_TEXTURE_DATA #if CC_ENABLE_CACHE_TEXTURE_DATA
// cache the texture data // cache the texture data
VolatileTexture::addStringTexture(this, text, textDefinition->_dimensions, textDefinition->_alignment, textDefinition->_vertAlignment, textDefinition->_fontName.c_str(), textDefinition->_fontSize); VolatileTexture::addStringTexture(this, text, textDefinition._dimensions, textDefinition._alignment, textDefinition._vertAlignment, textDefinition._fontName.c_str(), textDefinition._fontSize);
#endif #endif
bool bRet = false; bool bRet = false;
Image::ETextAlign eAlign; Image::ETextAlign eAlign;
if (kVerticalTextAlignmentTop == textDefinition->_vertAlignment) if (kVerticalTextAlignmentTop == textDefinition._vertAlignment)
{ {
eAlign = (kTextAlignmentCenter == textDefinition->_alignment) ? Image::kAlignTop eAlign = (kTextAlignmentCenter == textDefinition._alignment) ? Image::kAlignTop
: (kTextAlignmentLeft == textDefinition->_alignment) ? Image::kAlignTopLeft : Image::kAlignTopRight; : (kTextAlignmentLeft == textDefinition._alignment) ? Image::kAlignTopLeft : Image::kAlignTopRight;
} }
else if (kVerticalTextAlignmentCenter == textDefinition->_vertAlignment) else if (kVerticalTextAlignmentCenter == textDefinition._vertAlignment)
{ {
eAlign = (kTextAlignmentCenter == textDefinition->_alignment) ? Image::kAlignCenter eAlign = (kTextAlignmentCenter == textDefinition._alignment) ? Image::kAlignCenter
: (kTextAlignmentLeft == textDefinition->_alignment) ? Image::kAlignLeft : Image::kAlignRight; : (kTextAlignmentLeft == textDefinition._alignment) ? Image::kAlignLeft : Image::kAlignRight;
} }
else if (kVerticalTextAlignmentBottom == textDefinition->_vertAlignment) else if (kVerticalTextAlignmentBottom == textDefinition._vertAlignment)
{ {
eAlign = (kTextAlignmentCenter == textDefinition->_alignment) ? Image::kAlignBottom eAlign = (kTextAlignmentCenter == textDefinition._alignment) ? Image::kAlignBottom
: (kTextAlignmentLeft == textDefinition->_alignment) ? Image::kAlignBottomLeft : Image::kAlignBottomRight; : (kTextAlignmentLeft == textDefinition._alignment) ? Image::kAlignBottomLeft : Image::kAlignBottomRight;
} }
else else
{ {
@ -550,13 +550,13 @@ bool Texture2D::initWithString(const char *text, ccFontDefinition *textDefinitio
float shadowBlur = 0.0f; float shadowBlur = 0.0f;
float shadowOpacity = 0.0f; float shadowOpacity = 0.0f;
if ( textDefinition->_shadow._shadowEnabled ) if ( textDefinition._shadow._shadowEnabled )
{ {
shadowEnabled = true; shadowEnabled = true;
shadowDX = textDefinition->_shadow._shadowOffset.width; shadowDX = textDefinition._shadow._shadowOffset.width;
shadowDY = textDefinition->_shadow._shadowOffset.height; shadowDY = textDefinition._shadow._shadowOffset.height;
shadowBlur = textDefinition->_shadow._shadowBlur; shadowBlur = textDefinition._shadow._shadowBlur;
shadowOpacity = textDefinition->_shadow._shadowOpacity; shadowOpacity = textDefinition._shadow._shadowOpacity;
} }
// handle stroke parameters // handle stroke parameters
@ -566,13 +566,13 @@ bool Texture2D::initWithString(const char *text, ccFontDefinition *textDefinitio
float strokeColorB = 0.0f; float strokeColorB = 0.0f;
float strokeSize = 0.0f; float strokeSize = 0.0f;
if ( textDefinition->_stroke._strokeEnabled ) if ( textDefinition._stroke._strokeEnabled )
{ {
strokeEnabled = true; strokeEnabled = true;
strokeColorR = textDefinition->_stroke._strokeColor.r / 255.0f; strokeColorR = textDefinition._stroke._strokeColor.r / 255.0f;
strokeColorG = textDefinition->_stroke._strokeColor.g / 255.0f; strokeColorG = textDefinition._stroke._strokeColor.g / 255.0f;
strokeColorB = textDefinition->_stroke._strokeColor.b / 255.0f; strokeColorB = textDefinition._stroke._strokeColor.b / 255.0f;
strokeSize = textDefinition->_stroke._strokeSize; strokeSize = textDefinition._stroke._strokeSize;
} }
Image* pImage = new Image(); Image* pImage = new Image();
@ -581,14 +581,14 @@ bool Texture2D::initWithString(const char *text, ccFontDefinition *textDefinitio
CC_BREAK_IF(NULL == pImage); CC_BREAK_IF(NULL == pImage);
bRet = pImage->initWithStringShadowStroke(text, bRet = pImage->initWithStringShadowStroke(text,
(int)textDefinition->_dimensions.width, (int)textDefinition._dimensions.width,
(int)textDefinition->_dimensions.height, (int)textDefinition._dimensions.height,
eAlign, eAlign,
textDefinition->_fontName.c_str(), textDefinition._fontName.c_str(),
textDefinition->_fontSize, textDefinition._fontSize,
textDefinition->_fontFillColor.r / 255.0f, textDefinition._fontFillColor.r / 255.0f,
textDefinition->_fontFillColor.g / 255.0f, textDefinition._fontFillColor.g / 255.0f,
textDefinition->_fontFillColor.b / 255.0f, textDefinition._fontFillColor.b / 255.0f,
shadowEnabled, shadowEnabled,
shadowDX, shadowDX,
shadowDY, shadowDY,

2
cocos2dx/textures/CCTexture2D.h
View File

@ -136,7 +136,7 @@ public:
/** Initializes a texture from a string with font name and font size */ /** Initializes a texture from a string with font name and font size */
bool initWithString(const char *text, const char *fontName, float fontSize); bool initWithString(const char *text, const char *fontName, float fontSize);
/** Initializes a texture from a string using a text definition*/ /** Initializes a texture from a string using a text definition*/
bool initWithString(const char *text, ccFontDefinition *textDefinition); bool initWithString(const char *text, const FontDefinition& textDefinition);
/** Initializes a texture from a PVR file */ /** Initializes a texture from a PVR file */
bool initWithPVRFile(const char* file); bool initWithPVRFile(const char* file);

40
cocos2dx/textures/CCTextureAtlas.cpp
View File

@ -90,14 +90,14 @@ void TextureAtlas::setTexture(Texture2D * var)
_texture = var; _texture = var;
} }
ccV3F_C4B_T2F_Quad* TextureAtlas::getQuads() V3F_C4B_T2F_Quad* TextureAtlas::getQuads()
{ {
//if someone accesses the quads directly, presume that changes will be made //if someone accesses the quads directly, presume that changes will be made
_dirty = true; _dirty = true;
return _quads; return _quads;
} }
void TextureAtlas::setQuads(ccV3F_C4B_T2F_Quad *var) void TextureAtlas::setQuads(V3F_C4B_T2F_Quad *var)
{ {
_quads = var; _quads = var;
} }
@ -157,7 +157,7 @@ bool TextureAtlas::initWithTexture(Texture2D *texture, unsigned int capacity)
// Re-initialization is not allowed // Re-initialization is not allowed
CCAssert(_quads == NULL && _indices == NULL, ""); CCAssert(_quads == NULL && _indices == NULL, "");
_quads = (ccV3F_C4B_T2F_Quad*)malloc( _capacity * sizeof(ccV3F_C4B_T2F_Quad) ); _quads = (V3F_C4B_T2F_Quad*)malloc( _capacity * sizeof(V3F_C4B_T2F_Quad) );
_indices = (GLushort *)malloc( _capacity * 6 * sizeof(GLushort) ); _indices = (GLushort *)malloc( _capacity * 6 * sizeof(GLushort) );
if( ! ( _quads && _indices) && _capacity > 0) if( ! ( _quads && _indices) && _capacity > 0)
@ -172,7 +172,7 @@ bool TextureAtlas::initWithTexture(Texture2D *texture, unsigned int capacity)
return false; return false;
} }
memset( _quads, 0, _capacity * sizeof(ccV3F_C4B_T2F_Quad) ); memset( _quads, 0, _capacity * sizeof(V3F_C4B_T2F_Quad) );
memset( _indices, 0, _capacity * 6 * sizeof(GLushort) ); memset( _indices, 0, _capacity * 6 * sizeof(GLushort) );
// listen the event when app go to background // listen the event when app go to background
@ -256,15 +256,15 @@ void TextureAtlas::setupVBOandVAO()
// vertices // vertices
glEnableVertexAttribArray(kVertexAttrib_Position); glEnableVertexAttribArray(kVertexAttrib_Position);
glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, vertices)); glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( V3F_C4B_T2F, vertices));
// colors // colors
glEnableVertexAttribArray(kVertexAttrib_Color); glEnableVertexAttribArray(kVertexAttrib_Color);
glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, colors)); glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, kQuadSize, (GLvoid*) offsetof( V3F_C4B_T2F, colors));
// tex coords // tex coords
glEnableVertexAttribArray(kVertexAttrib_TexCoords); glEnableVertexAttribArray(kVertexAttrib_TexCoords);
glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, texCoords)); glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof( V3F_C4B_T2F, texCoords));
glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, _buffersVBO[1]); glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, _buffersVBO[1]);
glBufferData(GL_ELEMENT_ARRAY_BUFFER, sizeof(_indices[0]) * _capacity * 6, _indices, GL_STATIC_DRAW); glBufferData(GL_ELEMENT_ARRAY_BUFFER, sizeof(_indices[0]) * _capacity * 6, _indices, GL_STATIC_DRAW);
@ -303,7 +303,7 @@ void TextureAtlas::mapBuffers()
// TextureAtlas - Update, Insert, Move & Remove // TextureAtlas - Update, Insert, Move & Remove
void TextureAtlas::updateQuad(ccV3F_C4B_T2F_Quad *quad, unsigned int index) void TextureAtlas::updateQuad(V3F_C4B_T2F_Quad *quad, unsigned int index)
{ {
CCAssert( index >= 0 && index < _capacity, "updateQuadWithTexture: Invalid index"); CCAssert( index >= 0 && index < _capacity, "updateQuadWithTexture: Invalid index");
@ -316,7 +316,7 @@ void TextureAtlas::updateQuad(ccV3F_C4B_T2F_Quad *quad, unsigned int index)
} }
void TextureAtlas::insertQuad(ccV3F_C4B_T2F_Quad *quad, unsigned int index) void TextureAtlas::insertQuad(V3F_C4B_T2F_Quad *quad, unsigned int index)
{ {
CCAssert( index < _capacity, "insertQuadWithTexture: Invalid index"); CCAssert( index < _capacity, "insertQuadWithTexture: Invalid index");
@ -340,7 +340,7 @@ void TextureAtlas::insertQuad(ccV3F_C4B_T2F_Quad *quad, unsigned int index)
} }
void TextureAtlas::insertQuads(ccV3F_C4B_T2F_Quad* quads, unsigned int index, unsigned int amount) void TextureAtlas::insertQuads(V3F_C4B_T2F_Quad* quads, unsigned int index, unsigned int amount)
{ {
CCAssert(index + amount <= _capacity, "insertQuadWithTexture: Invalid index + amount"); CCAssert(index + amount <= _capacity, "insertQuadWithTexture: Invalid index + amount");
@ -392,7 +392,7 @@ void TextureAtlas::insertQuadFromIndex(unsigned int oldIndex, unsigned int newIn
} }
// texture coordinates // texture coordinates
ccV3F_C4B_T2F_Quad quadsBackup = _quads[oldIndex]; V3F_C4B_T2F_Quad quadsBackup = _quads[oldIndex];
memmove( &_quads[dst],&_quads[src], sizeof(_quads[0]) * howMany ); memmove( &_quads[dst],&_quads[src], sizeof(_quads[0]) * howMany );
_quads[newIndex] = quadsBackup; _quads[newIndex] = quadsBackup;
@ -455,14 +455,14 @@ bool TextureAtlas::resizeCapacity(unsigned int newCapacity)
_totalQuads = MIN(_totalQuads, newCapacity); _totalQuads = MIN(_totalQuads, newCapacity);
_capacity = newCapacity; _capacity = newCapacity;
ccV3F_C4B_T2F_Quad* tmpQuads = NULL; V3F_C4B_T2F_Quad* tmpQuads = NULL;
GLushort* tmpIndices = NULL; GLushort* tmpIndices = NULL;
// when calling initWithTexture(fileName, 0) on bada device, calloc(0, 1) will fail and return NULL, // when calling initWithTexture(fileName, 0) on bada device, calloc(0, 1) will fail and return NULL,
// so here must judge whether _quads and _indices is NULL. // so here must judge whether _quads and _indices is NULL.
if (_quads == NULL) if (_quads == NULL)
{ {
tmpQuads = (ccV3F_C4B_T2F_Quad*)malloc( _capacity * sizeof(_quads[0]) ); tmpQuads = (V3F_C4B_T2F_Quad*)malloc( _capacity * sizeof(_quads[0]) );
if (tmpQuads != NULL) if (tmpQuads != NULL)
{ {
memset(tmpQuads, 0, _capacity * sizeof(_quads[0]) ); memset(tmpQuads, 0, _capacity * sizeof(_quads[0]) );
@ -470,7 +470,7 @@ bool TextureAtlas::resizeCapacity(unsigned int newCapacity)
} }
else else
{ {
tmpQuads = (ccV3F_C4B_T2F_Quad*)realloc( _quads, sizeof(_quads[0]) * _capacity ); tmpQuads = (V3F_C4B_T2F_Quad*)realloc( _quads, sizeof(_quads[0]) * _capacity );
if (tmpQuads != NULL && _capacity > uOldCapactiy) if (tmpQuads != NULL && _capacity > uOldCapactiy)
{ {
memset(tmpQuads+uOldCapactiy, 0, (_capacity - uOldCapactiy)*sizeof(_quads[0]) ); memset(tmpQuads+uOldCapactiy, 0, (_capacity - uOldCapactiy)*sizeof(_quads[0]) );
@ -532,8 +532,8 @@ void TextureAtlas::moveQuadsFromIndex(unsigned int oldIndex, unsigned int amount
return; return;
} }
//create buffer //create buffer
size_t quadSize = sizeof(ccV3F_C4B_T2F_Quad); size_t quadSize = sizeof(V3F_C4B_T2F_Quad);
ccV3F_C4B_T2F_Quad* tempQuads = (ccV3F_C4B_T2F_Quad*)malloc( quadSize * amount); V3F_C4B_T2F_Quad* tempQuads = (V3F_C4B_T2F_Quad*)malloc( quadSize * amount);
memcpy( tempQuads, &_quads[oldIndex], quadSize * amount ); memcpy( tempQuads, &_quads[oldIndex], quadSize * amount );
if (newIndex < oldIndex) if (newIndex < oldIndex)
@ -562,7 +562,7 @@ void TextureAtlas::moveQuadsFromIndex(unsigned int index, unsigned int newIndex)
void TextureAtlas::fillWithEmptyQuadsFromIndex(unsigned int index, unsigned int amount) void TextureAtlas::fillWithEmptyQuadsFromIndex(unsigned int index, unsigned int amount)
{ {
ccV3F_C4B_T2F_Quad quad; V3F_C4B_T2F_Quad quad;
memset(&quad, 0, sizeof(quad)); memset(&quad, 0, sizeof(quad));
unsigned int to = index + amount; unsigned int to = index + amount;
@ -656,13 +656,13 @@ void TextureAtlas::drawNumberOfQuads(unsigned int n, unsigned int start)
ccGLEnableVertexAttribs(kVertexAttribFlag_PosColorTex); ccGLEnableVertexAttribs(kVertexAttribFlag_PosColorTex);
// vertices // vertices
glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof(ccV3F_C4B_T2F, vertices)); glVertexAttribPointer(kVertexAttrib_Position, 3, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof(V3F_C4B_T2F, vertices));
// colors // colors
glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, kQuadSize, (GLvoid*) offsetof(ccV3F_C4B_T2F, colors)); glVertexAttribPointer(kVertexAttrib_Color, 4, GL_UNSIGNED_BYTE, GL_TRUE, kQuadSize, (GLvoid*) offsetof(V3F_C4B_T2F, colors));
// tex coords // tex coords
glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof(ccV3F_C4B_T2F, texCoords)); glVertexAttribPointer(kVertexAttrib_TexCoords, 2, GL_FLOAT, GL_FALSE, kQuadSize, (GLvoid*) offsetof(V3F_C4B_T2F, texCoords));
glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, _buffersVBO[1]); glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, _buffersVBO[1]);

8
cocos2dx/textures/CCTextureAtlas.h
View File

@ -71,7 +71,7 @@ protected:
/** Texture of the texture atlas */ /** Texture of the texture atlas */
CC_PROPERTY(Texture2D *, _texture, Texture) CC_PROPERTY(Texture2D *, _texture, Texture)
/** Quads that are going to be rendered */ /** Quads that are going to be rendered */
CC_PROPERTY(ccV3F_C4B_T2F_Quad *, _quads, Quads) CC_PROPERTY(V3F_C4B_T2F_Quad *, _quads, Quads)
public: public:
@ -111,20 +111,20 @@ public:
* index must be between 0 and the atlas capacity - 1 * index must be between 0 and the atlas capacity - 1
@since v0.8 @since v0.8
*/ */
void updateQuad(ccV3F_C4B_T2F_Quad* quad, unsigned int index); void updateQuad(V3F_C4B_T2F_Quad* quad, unsigned int index);
/** Inserts a Quad (texture, vertex and color) at a certain index /** Inserts a Quad (texture, vertex and color) at a certain index
index must be between 0 and the atlas capacity - 1 index must be between 0 and the atlas capacity - 1
@since v0.8 @since v0.8
*/ */
void insertQuad(ccV3F_C4B_T2F_Quad* quad, unsigned int index); void insertQuad(V3F_C4B_T2F_Quad* quad, unsigned int index);
/** Inserts a c array of quads at a given index /** Inserts a c array of quads at a given index
index must be between 0 and the atlas capacity - 1 index must be between 0 and the atlas capacity - 1
this method doesn't enlarge the array when amount + index > totalQuads this method doesn't enlarge the array when amount + index > totalQuads
@since v1.1 @since v1.1
*/ */
void insertQuads(ccV3F_C4B_T2F_Quad* quads, unsigned int index, unsigned int amount); void insertQuads(V3F_C4B_T2F_Quad* quads, unsigned int index, unsigned int amount);
/** Removes the quad that is located at a certain index and inserts it at a new index /** Removes the quad that is located at a certain index and inserts it at a new index
This operation is faster than removing and inserting in a quad in 2 different steps This operation is faster than removing and inserting in a quad in 2 different steps

26
cocos2dx/tilemap_parallax_nodes/CCTileMapAtlas.cpp
View File

@ -101,8 +101,8 @@ void TileMapAtlas::calculateItemsToRender()
{ {
for( int y=0; y < _TGAInfo->height; y++ ) for( int y=0; y < _TGAInfo->height; y++ )
{ {
ccColor3B *ptr = (ccColor3B*) _TGAInfo->imageData; Color3B *ptr = (Color3B*) _TGAInfo->imageData;
ccColor3B value = ptr[x + y * _TGAInfo->width]; Color3B value = ptr[x + y * _TGAInfo->width];
if( value.r ) if( value.r )
{ {
++_itemsToRender; ++_itemsToRender;
@ -132,7 +132,7 @@ void TileMapAtlas::loadTGAfile(const char *file)
} }
// TileMapAtlas - Atlas generation / updates // TileMapAtlas - Atlas generation / updates
void TileMapAtlas::setTile(const ccColor3B& tile, const Point& position) void TileMapAtlas::setTile(const Color3B& tile, const Point& position)
{ {
CCAssert(_TGAInfo != NULL, "tgaInfo must not be nil"); CCAssert(_TGAInfo != NULL, "tgaInfo must not be nil");
CCAssert(_posToAtlasIndex != NULL, "posToAtlasIndex must not be nil"); CCAssert(_posToAtlasIndex != NULL, "posToAtlasIndex must not be nil");
@ -140,8 +140,8 @@ void TileMapAtlas::setTile(const ccColor3B& tile, const Point& position)
CCAssert(position.y < _TGAInfo->height, "Invalid position.x"); CCAssert(position.y < _TGAInfo->height, "Invalid position.x");
CCAssert(tile.r != 0, "R component must be non 0"); CCAssert(tile.r != 0, "R component must be non 0");
ccColor3B *ptr = (ccColor3B*)_TGAInfo->imageData; Color3B *ptr = (Color3B*)_TGAInfo->imageData;
ccColor3B value = ptr[(unsigned int)(position.x + position.y * _TGAInfo->width)]; Color3B value = ptr[(unsigned int)(position.x + position.y * _TGAInfo->width)];
if( value.r == 0 ) if( value.r == 0 )
{ {
CCLOG("cocos2d: Value.r must be non 0."); CCLOG("cocos2d: Value.r must be non 0.");
@ -159,23 +159,23 @@ void TileMapAtlas::setTile(const ccColor3B& tile, const Point& position)
} }
} }
ccColor3B TileMapAtlas::tileAt(const Point& position) Color3B TileMapAtlas::tileAt(const Point& position)
{ {
CCAssert( _TGAInfo != NULL, "tgaInfo must not be nil"); CCAssert( _TGAInfo != NULL, "tgaInfo must not be nil");
CCAssert( position.x < _TGAInfo->width, "Invalid position.x"); CCAssert( position.x < _TGAInfo->width, "Invalid position.x");
CCAssert( position.y < _TGAInfo->height, "Invalid position.y"); CCAssert( position.y < _TGAInfo->height, "Invalid position.y");
ccColor3B *ptr = (ccColor3B*)_TGAInfo->imageData; Color3B *ptr = (Color3B*)_TGAInfo->imageData;
ccColor3B value = ptr[(unsigned int)(position.x + position.y * _TGAInfo->width)]; Color3B value = ptr[(unsigned int)(position.x + position.y * _TGAInfo->width)];
return value; return value;
} }
void TileMapAtlas::updateAtlasValueAt(const Point& pos, const ccColor3B& value, unsigned int index) void TileMapAtlas::updateAtlasValueAt(const Point& pos, const Color3B& value, unsigned int index)
{ {
CCAssert( index >= 0 && index < _textureAtlas->getCapacity(), "updateAtlasValueAt: Invalid index"); CCAssert( index >= 0 && index < _textureAtlas->getCapacity(), "updateAtlasValueAt: Invalid index");
ccV3F_C4B_T2F_Quad* quad = &((_textureAtlas->getQuads())[index]); V3F_C4B_T2F_Quad* quad = &((_textureAtlas->getQuads())[index]);
int x = pos.x; int x = pos.x;
int y = pos.y; int y = pos.y;
@ -222,7 +222,7 @@ void TileMapAtlas::updateAtlasValueAt(const Point& pos, const ccColor3B& value,
quad->tr.vertices.y = (float)(y * _itemHeight + _itemHeight); quad->tr.vertices.y = (float)(y * _itemHeight + _itemHeight);
quad->tr.vertices.z = 0.0f; quad->tr.vertices.z = 0.0f;
ccColor4B color = { _displayedColor.r, _displayedColor.g, _displayedColor.b, _displayedOpacity }; Color4B color(_displayedColor.r, _displayedColor.g, _displayedColor.b, _displayedOpacity);
quad->tr.colors = color; quad->tr.colors = color;
quad->tl.colors = color; quad->tl.colors = color;
quad->br.colors = color; quad->br.colors = color;
@ -247,8 +247,8 @@ void TileMapAtlas::updateAtlasValues()
{ {
if( total < _itemsToRender ) if( total < _itemsToRender )
{ {
ccColor3B *ptr = (ccColor3B*) _TGAInfo->imageData; Color3B *ptr = (Color3B*) _TGAInfo->imageData;
ccColor3B value = ptr[x + y * _TGAInfo->width]; Color3B value = ptr[x + y * _TGAInfo->width];
if( value.r != 0 ) if( value.r != 0 )
{ {

6
cocos2dx/tilemap_parallax_nodes/CCTileMapAtlas.h
View File

@ -74,17 +74,17 @@ public:
/** returns a tile from position x,y. /** returns a tile from position x,y.
For the moment only channel R is used For the moment only channel R is used
*/ */
ccColor3B tileAt(const Point& position); Color3B tileAt(const Point& position);
/** sets a tile at position x,y. /** sets a tile at position x,y.
For the moment only channel R is used For the moment only channel R is used
*/ */
void setTile(const ccColor3B& tile, const Point& position); void setTile(const Color3B& tile, const Point& position);
/** dealloc the map from memory */ /** dealloc the map from memory */
void releaseMap(); void releaseMap();
private: private:
void loadTGAfile(const char *file); void loadTGAfile(const char *file);
void calculateItemsToRender(); void calculateItemsToRender();
void updateAtlasValueAt(const Point& pos, const ccColor3B& value, unsigned int index); void updateAtlasValueAt(const Point& pos, const Color3B& value, unsigned int index);
void updateAtlasValues(); void updateAtlasValues();
protected: protected:

6
extensions/CCArmature/CCArmature.h
View File

@ -120,8 +120,8 @@ public:
*/ */
virtual void updateOffsetPoint(); virtual void updateOffsetPoint();
virtual void setBlendFunc(const ccBlendFunc& blendFunc) { _blendFunc = blendFunc; } inline void setBlendFunc(const BlendFunc& blendFunc) { _blendFunc = blendFunc; }
virtual const ccBlendFunc& getBlendFunc(void) const { return _blendFunc; } inline const BlendFunc& getBlendFunc(void) const { return _blendFunc; }
protected: protected:
@ -149,7 +149,7 @@ protected:
static std::map<int, Armature*> _armatureIndexDic; //! Use to save armature zorder info, static std::map<int, Armature*> _armatureIndexDic; //! Use to save armature zorder info,
ccBlendFunc _blendFunc; //! It's required for TextureProtocol inheritance BlendFunc _blendFunc; //! It's required for TextureProtocol inheritance
Point _offsetPoint; Point _offsetPoint;
}; };

4
extensions/CCArmature/CCBone.cpp
View File

@ -196,7 +196,7 @@ void Bone::update(float delta)
} }
void Bone::updateDisplayedColor(const ccColor3B &parentColor) void Bone::updateDisplayedColor(const Color3B &parentColor)
{ {
NodeRGBA::updateDisplayedColor(parentColor); NodeRGBA::updateDisplayedColor(parentColor);
updateColor(); updateColor();
@ -214,7 +214,7 @@ void Bone::updateColor()
RGBAProtocol *protocol = dynamic_cast<RGBAProtocol *>(display); RGBAProtocol *protocol = dynamic_cast<RGBAProtocol *>(display);
if(protocol != NULL) if(protocol != NULL)
{ {
protocol->setColor(ccc3(_displayedColor.r * _tweenData->r / 255, _displayedColor.g * _tweenData->g / 255, _displayedColor.b * _tweenData->b / 255)); protocol->setColor(Color3B(_displayedColor.r * _tweenData->r / 255, _displayedColor.g * _tweenData->g / 255, _displayedColor.b * _tweenData->b / 255));
protocol->setOpacity(_displayedOpacity * _tweenData->a / 255); protocol->setOpacity(_displayedOpacity * _tweenData->a / 255);
} }
} }

2
extensions/CCArmature/CCBone.h
View File

@ -118,7 +118,7 @@ public:
void update(float delta); void update(float delta);
void updateDisplayedColor(const ccColor3B &parentColor); void updateDisplayedColor(const Color3B &parentColor);
void updateDisplayedOpacity(GLubyte parentOpacity); void updateDisplayedOpacity(GLubyte parentOpacity);
//! Update color to render display //! Update color to render display

4
extensions/CCArmature/datas/CCDatas.h
View File

@ -394,9 +394,9 @@ public:
}; };
struct ContourVertex2 : public Object struct ContourVertex2F : public Object
{ {
ContourVertex2(float x, float y) ContourVertex2F(float x, float y)
{ {
this->x = x; this->x = x;
this->y = y; this->y = y;

12
extensions/CCArmature/display/CCShaderNode.cpp
View File

@ -33,8 +33,8 @@ enum
}; };
ShaderNode::ShaderNode() ShaderNode::ShaderNode()
: _center(vertex2(0.0f, 0.0f)) : _center(Vertex2F(0.0f, 0.0f))
, _resolution(vertex2(0.0f, 0.0f)) , _resolution(Vertex2F(0.0f, 0.0f))
, _time(0.0f) , _time(0.0f)
, _uniformCenter(0) , _uniformCenter(0)
, _uniformResolution(0) , _uniformResolution(0)
@ -57,7 +57,7 @@ bool ShaderNode::initWithVertex(const char *vert, const char *frag)
loadShaderVertex(vert, frag); loadShaderVertex(vert, frag);
_time = 0; _time = 0;
_resolution = vertex2(SIZE_X, SIZE_Y); _resolution = Vertex2F(SIZE_X, SIZE_Y);
scheduleUpdate(); scheduleUpdate();
@ -95,15 +95,15 @@ void ShaderNode::translateFormOtherNode(AffineTransform &transform)
{ {
Node::setAdditionalTransform(transform); Node::setAdditionalTransform(transform);
_center = vertex2(_additionalTransform.tx * CC_CONTENT_SCALE_FACTOR(), _additionalTransform.ty * CC_CONTENT_SCALE_FACTOR()); _center = Vertex2F(_additionalTransform.tx * CC_CONTENT_SCALE_FACTOR(), _additionalTransform.ty * CC_CONTENT_SCALE_FACTOR());
_resolution = vertex2( SIZE_X * _additionalTransform.a, SIZE_Y * _additionalTransform.d); _resolution = Vertex2F( SIZE_X * _additionalTransform.a, SIZE_Y * _additionalTransform.d);
} }
void ShaderNode::setPosition(const Point &newPosition) void ShaderNode::setPosition(const Point &newPosition)
{ {
Node::setPosition(newPosition); Node::setPosition(newPosition);
Point position = getPosition(); Point position = getPosition();
_center = vertex2(position.x * CC_CONTENT_SCALE_FACTOR(), position.y * CC_CONTENT_SCALE_FACTOR()); _center = Vertex2F(position.x * CC_CONTENT_SCALE_FACTOR(), position.y * CC_CONTENT_SCALE_FACTOR());
} }
void ShaderNode::draw() void ShaderNode::draw()

4
extensions/CCArmature/display/CCShaderNode.h
View File

@ -46,8 +46,8 @@ public:
private: private:
ccVertex2F _center; Vertex2F _center;
ccVertex2F _resolution; Vertex2F _resolution;
float _time; float _time;
GLuint _uniformCenter, _uniformResolution, _uniformTime; GLuint _uniformCenter, _uniformResolution, _uniformTime;
}; };

10
extensions/CCArmature/display/CCSkin.cpp
View File

@ -89,7 +89,7 @@ void Skin::draw()
// If it is not visible, or one of its ancestors is not visible, then do nothing: // If it is not visible, or one of its ancestors is not visible, then do nothing:
if( !_visible) if( !_visible)
{ {
_quad.br.vertices = _quad.tl.vertices = _quad.tr.vertices = _quad.bl.vertices = vertex3(0, 0, 0); _quad.br.vertices = _quad.tl.vertices = _quad.tr.vertices = _quad.bl.vertices = Vertex3F(0, 0, 0);
} }
else else
{ {
@ -124,10 +124,10 @@ void Skin::draw()
float dx = x1 * cr - y2 * sr2 + x; float dx = x1 * cr - y2 * sr2 + x;
float dy = x1 * sr + y2 * cr2 + y; float dy = x1 * sr + y2 * cr2 + y;
_quad.bl.vertices = vertex3( RENDER_IN_SUBPIXEL(ax), RENDER_IN_SUBPIXEL(ay), _vertexZ ); _quad.bl.vertices = Vertex3F( RENDER_IN_SUBPIXEL(ax), RENDER_IN_SUBPIXEL(ay), _vertexZ );
_quad.br.vertices = vertex3( RENDER_IN_SUBPIXEL(bx), RENDER_IN_SUBPIXEL(by), _vertexZ ); _quad.br.vertices = Vertex3F( RENDER_IN_SUBPIXEL(bx), RENDER_IN_SUBPIXEL(by), _vertexZ );
_quad.tl.vertices = vertex3( RENDER_IN_SUBPIXEL(dx), RENDER_IN_SUBPIXEL(dy), _vertexZ ); _quad.tl.vertices = Vertex3F( RENDER_IN_SUBPIXEL(dx), RENDER_IN_SUBPIXEL(dy), _vertexZ );
_quad.tr.vertices = vertex3( RENDER_IN_SUBPIXEL(cx), RENDER_IN_SUBPIXEL(cy), _vertexZ ); _quad.tr.vertices = Vertex3F( RENDER_IN_SUBPIXEL(cx), RENDER_IN_SUBPIXEL(cy), _vertexZ );
} }
// MARMALADE CHANGE: ADDED CHECK FOR NULL, TO PERMIT SPRITES WITH NO BATCH NODE / TEXTURE ATLAS // MARMALADE CHANGE: ADDED CHECK FOR NULL, TO PERMIT SPRITES WITH NO BATCH NODE / TEXTURE ATLAS

8
extensions/CCArmature/external_tool/CCTexture2DMutable.cpp
View File

@ -108,10 +108,10 @@ bool Texture2DMutable::initWithData(const void* data, Texture2DPixelFormat pixel
return true; return true;
} }
ccColor4B Texture2DMutable::pixelAt(const Point& pt) Color4B Texture2DMutable::pixelAt(const Point& pt)
{ {
ccColor4B c = {0, 0, 0, 0}; Color4B c(0, 0, 0, 0);
if(!data_) return c; if(!data_) return c;
if(pt.x < 0 || pt.y < 0) return c; if(pt.x < 0 || pt.y < 0) return c;
if(pt.x >= _contentSize.width || pt.y >= _contentSize.height) return c; if(pt.x >= _contentSize.width || pt.y >= _contentSize.height) return c;
@ -162,7 +162,7 @@ ccColor4B Texture2DMutable::pixelAt(const Point& pt)
return c; return c;
} }
bool Texture2DMutable::setPixelAt(const Point& pt, ccColor4B c) bool Texture2DMutable::setPixelAt(const Point& pt, Color4B c)
{ {
if(!data_)return false; if(!data_)return false;
if(pt.x < 0 || pt.y < 0) return false; if(pt.x < 0 || pt.y < 0) return false;
@ -199,7 +199,7 @@ bool Texture2DMutable::setPixelAt(const Point& pt, ccColor4B c)
return true; return true;
} }
void Texture2DMutable::fill(ccColor4B p) void Texture2DMutable::fill(Color4B p)
{ {
for(int r = 0; r < _contentSize.height; ++r) for(int r = 0; r < _contentSize.height; ++r)
for(int c = 0; c < _contentSize.width; ++c) for(int c = 0; c < _contentSize.width; ++c)

8
extensions/CCArmature/external_tool/CCTexture2DMutable.h
View File

@ -48,20 +48,20 @@ public:
bool initWithData(const void* data, cocos2d::Texture2DPixelFormat pixelFormat, unsigned int pixelsWide, unsigned int pixelsHigh, const cocos2d::Size& contentSize); bool initWithData(const void* data, cocos2d::Texture2DPixelFormat pixelFormat, unsigned int pixelsWide, unsigned int pixelsHigh, const cocos2d::Size& contentSize);
cocos2d::ccColor4B pixelAt(const cocos2d::Point& pt); cocos2d::Color4B pixelAt(const cocos2d::Point& pt);
/// ///
// @param pt is a point to get a pixel (0,0) is top-left to (width,height) bottom-right // @param pt is a point to get a pixel (0,0) is top-left to (width,height) bottom-right
// @param c is a ccColor4B which is a colour. // @param c is a Color4B which is a colour.
// @returns if a pixel was set // @returns if a pixel was set
// Remember to call apply to actually update the texture canvas. // Remember to call apply to actually update the texture canvas.
/// ///
bool setPixelAt(const cocos2d::Point& pt, cocos2d::ccColor4B c); bool setPixelAt(const cocos2d::Point& pt, cocos2d::Color4B c);
/// ///
// Fill with specified colour // Fill with specified colour
/// ///
void fill(cocos2d::ccColor4B c); void fill(cocos2d::Color4B c);
/// ///
// @param textureToCopy is the texture image to copy over // @param textureToCopy is the texture image to copy over

4
extensions/CCArmature/physics/CCColliderDetector.cpp
View File

@ -101,7 +101,7 @@ void ColliderDetector::addContourData(ContourData *contourData)
int i = 0; int i = 0;
CCARRAY_FOREACH(array, object) CCARRAY_FOREACH(array, object)
{ {
ContourVertex2 *v = (ContourVertex2 *)object; ContourVertex2F *v = (ContourVertex2F *)object;
b2bv[i].Set(v->x / PT_RATIO, v->y / PT_RATIO); b2bv[i].Set(v->x / PT_RATIO, v->y / PT_RATIO);
i++; i++;
} }
@ -188,7 +188,7 @@ void ColliderDetector::updateTransform(AffineTransform &t)
int i = 0; int i = 0;
CCARRAY_FOREACH(array, object) CCARRAY_FOREACH(array, object)
{ {
ContourVertex2 *cv = (ContourVertex2 *)object; ContourVertex2F *cv = (ContourVertex2F *)object;
b2Vec2 &bv = shape->m_vertices[i]; b2Vec2 &bv = shape->m_vertices[i];
helpPoint.setPoint(cv->x, cv->y); helpPoint.setPoint(cv->x, cv->y);

4
extensions/CCArmature/utils/CCDataReaderHelper.cpp
View File

@ -778,7 +778,7 @@ ContourData *DataReaderHelper::decodeContour(tinyxml2::XMLElement *contourXML)
while (vertexDataXML) while (vertexDataXML)
{ {
ContourVertex2 *vertex = new ContourVertex2(0, 0); ContourVertex2F *vertex = new ContourVertex2F(0, 0);
vertex->autorelease(); vertex->autorelease();
vertexDataXML->QueryFloatAttribute(A_X, &vertex->x); vertexDataXML->QueryFloatAttribute(A_X, &vertex->x);
@ -1096,7 +1096,7 @@ ContourData *DataReaderHelper::decodeContour(cs::CSJsonDictionary &json)
{ {
cs::CSJsonDictionary *dic = json.getSubItemFromArray(VERTEX_POINT, i); cs::CSJsonDictionary *dic = json.getSubItemFromArray(VERTEX_POINT, i);
ContourVertex2 *vertex = new ContourVertex2(0, 0); ContourVertex2F *vertex = new ContourVertex2F(0, 0);
vertex->x = dic->getItemFloatValue(A_X, 0); vertex->x = dic->getItemFloatValue(A_X, 0);
vertex->y = dic->getItemFloatValue(A_Y, 0); vertex->y = dic->getItemFloatValue(A_Y, 0);

6
extensions/CCBReader/CCBAnimationManager.cpp
View File

@ -312,8 +312,8 @@ ActionInterval* CCBAnimationManager::getAction(CCBKeyframe *pKeyframe0, CCBKeyfr
} }
else if (strcmp(pPropName, "color") == 0) else if (strcmp(pPropName, "color") == 0)
{ {
ccColor3BWapper* color = (ccColor3BWapper*)pKeyframe1->getValue(); Color3BWapper* color = (Color3BWapper*)pKeyframe1->getValue();
ccColor3B c = color->getColor(); Color3B c = color->getColor();
return TintTo::create(duration, c.r, c.g, c.b); return TintTo::create(duration, c.r, c.g, c.b);
} }
@ -472,7 +472,7 @@ void CCBAnimationManager::setAnimatedProperty(const char *pPropName, Node *pNode
} }
else if (strcmp(pPropName, "color") == 0) else if (strcmp(pPropName, "color") == 0)
{ {
ccColor3BWapper *color = (ccColor3BWapper*)pValue; Color3BWapper *color = (Color3BWapper*)pValue;
(dynamic_cast<RGBAProtocol*>(pNode))->setColor(color->getColor()); (dynamic_cast<RGBAProtocol*>(pNode))->setColor(color->getColor());
} }
else if (strcmp(pPropName, "visible") == 0) else if (strcmp(pPropName, "visible") == 0)

4
extensions/CCBReader/CCBReader.cpp
View File

@ -790,8 +790,8 @@ CCBKeyframe* CCBReader::readKeyframe(int type)
int g = readByte(); int g = readByte();
int b = readByte(); int b = readByte();
ccColor3B c = ccc3(r,g,b); Color3B c = Color3B(r,g,b);
value = ccColor3BWapper::create(c); value = Color3BWapper::create(c);
} }
else if (type == kCCBPropTypeDegrees) else if (type == kCCBPropTypeDegrees)
{ {

8
extensions/CCBReader/CCBValue.cpp
View File

@ -4,11 +4,11 @@ using namespace cocos2d;
NS_CC_EXT_BEGIN NS_CC_EXT_BEGIN
// Implementation of ccColor3BWapper // Implementation of Color3BWapper
ccColor3BWapper* ccColor3BWapper::create(const ccColor3B& color) Color3BWapper* Color3BWapper::create(const Color3B& color)
{ {
ccColor3BWapper *ret = new ccColor3BWapper(); Color3BWapper *ret = new Color3BWapper();
if (ret) if (ret)
{ {
ret->color.r = color.r; ret->color.r = color.r;
@ -21,7 +21,7 @@ ccColor3BWapper* ccColor3BWapper::create(const ccColor3B& color)
return ret; return ret;
} }
const ccColor3B& ccColor3BWapper::getColor() const const Color3B& Color3BWapper::getColor() const
{ {
return color; return color;
} }

10
extensions/CCBReader/CCBValue.h
View File

@ -5,20 +5,20 @@
#include "ExtensionMacros.h" #include "ExtensionMacros.h"
/* /*
These classes are wrapper of basic types, such as ccColor3B These classes are wrapper of basic types, such as Color3B
*/ */
NS_CC_EXT_BEGIN NS_CC_EXT_BEGIN
class ccColor3BWapper : public Object class Color3BWapper : public Object
{ {
private: private:
ccColor3B color; Color3B color;
public: public:
static ccColor3BWapper* create(const ccColor3B& color); static Color3BWapper* create(const Color3B& color);
const ccColor3B& getColor() const; const Color3B& getColor() const;
}; };
enum enum

2
extensions/CCBReader/CCControlButtonLoader.cpp
View File

@ -100,7 +100,7 @@ void ControlButtonLoader::onHandlePropTypeSpriteFrame(Node * pNode, Node * pPare
} }
} }
void ControlButtonLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader) { void ControlButtonLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_TITLECOLOR_NORMAL) == 0) { if(strcmp(pPropertyName, PROPERTY_TITLECOLOR_NORMAL) == 0) {
((ControlButton *)pNode)->setTitleColorForState(pColor3B, ControlStateNormal); ((ControlButton *)pNode)->setTitleColorForState(pColor3B, ControlStateNormal);
} else if(strcmp(pPropertyName, PROPERTY_TITLECOLOR_HIGHLIGHTED) == 0) { } else if(strcmp(pPropertyName, PROPERTY_TITLECOLOR_HIGHLIGHTED) == 0) {

2
extensions/CCBReader/CCControlButtonLoader.h
View File

@ -24,7 +24,7 @@ class ControlButtonLoader : public ControlLoader {
virtual void onHandlePropTypePoint(Node * pNode, Node * pParent, const char * pPropertyName, Point pPoint, CCBReader * pCCBReader); virtual void onHandlePropTypePoint(Node * pNode, Node * pParent, const char * pPropertyName, Point pPoint, CCBReader * pCCBReader);
virtual void onHandlePropTypeSize(Node * pNode, Node * pParent, const char * pPropertyName, Size pSize, CCBReader * pCCBReader); virtual void onHandlePropTypeSize(Node * pNode, Node * pParent, const char * pPropertyName, Size pSize, CCBReader * pCCBReader);
virtual void onHandlePropTypeSpriteFrame(Node * pNode, Node * pParent, const char * pPropertyName, SpriteFrame * pSpriteFrame, CCBReader * pCCBReader); virtual void onHandlePropTypeSpriteFrame(Node * pNode, Node * pParent, const char * pPropertyName, SpriteFrame * pSpriteFrame, CCBReader * pCCBReader);
virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader); virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader);
}; };
NS_CC_EXT_END NS_CC_EXT_END

4
extensions/CCBReader/CCLabelBMFontLoader.cpp
View File

@ -10,7 +10,7 @@ NS_CC_EXT_BEGIN
#define PROPERTY_FNTFILE "fntFile" #define PROPERTY_FNTFILE "fntFile"
#define PROPERTY_STRING "string" #define PROPERTY_STRING "string"
void LabelBMFontLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader) { void LabelBMFontLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_COLOR) == 0) { if(strcmp(pPropertyName, PROPERTY_COLOR) == 0) {
((LabelBMFont *)pNode)->setColor(pColor3B); ((LabelBMFont *)pNode)->setColor(pColor3B);
} else { } else {
@ -26,7 +26,7 @@ void LabelBMFontLoader::onHandlePropTypeByte(Node * pNode, Node * pParent, const
} }
} }
void LabelBMFontLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader) { void LabelBMFontLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) { if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) {
((LabelBMFont *)pNode)->setBlendFunc(pBlendFunc); ((LabelBMFont *)pNode)->setBlendFunc(pBlendFunc);
} else { } else {

4
extensions/CCBReader/CCLabelBMFontLoader.h
View File

@ -16,9 +16,9 @@ class LabelBMFontLoader : public NodeLoader {
protected: protected:
CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(LabelBMFont); CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(LabelBMFont);
virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader); virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader);
virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader); virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader);
virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader); virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader);
virtual void onHandlePropTypeFntFile(Node * pNode, Node * pParent, const char * pPropertyName, const char* pFntFile, CCBReader * pCCBReader); virtual void onHandlePropTypeFntFile(Node * pNode, Node * pParent, const char * pPropertyName, const char* pFntFile, CCBReader * pCCBReader);
virtual void onHandlePropTypeText(Node * pNode, Node * pParent, const char * pPropertyName, const char* pText, CCBReader * pCCBReader); virtual void onHandlePropTypeText(Node * pNode, Node * pParent, const char * pPropertyName, const char* pText, CCBReader * pCCBReader);
}; };

4
extensions/CCBReader/CCLabelTTFLoader.cpp
View File

@ -14,7 +14,7 @@
NS_CC_EXT_BEGIN NS_CC_EXT_BEGIN
void LabelTTFLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader) { void LabelTTFLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_COLOR) == 0) { if(strcmp(pPropertyName, PROPERTY_COLOR) == 0) {
((LabelTTF *)pNode)->setColor(pColor3B); ((LabelTTF *)pNode)->setColor(pColor3B);
} else { } else {
@ -30,7 +30,7 @@ void LabelTTFLoader::onHandlePropTypeByte(Node * pNode, Node * pParent, const ch
} }
} }
void LabelTTFLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader) { void LabelTTFLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) { if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) {
((LabelTTF *)pNode)->setBlendFunc(pBlendFunc); ((LabelTTF *)pNode)->setBlendFunc(pBlendFunc);
} else { } else {

4
extensions/CCBReader/CCLabelTTFLoader.h
View File

@ -16,9 +16,9 @@ class LabelTTFLoader : public NodeLoader {
protected: protected:
CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(LabelTTF); CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(LabelTTF);
virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader); virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader);
virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader); virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader);
virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader); virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader);
virtual void onHandlePropTypeFontTTF(Node * pNode, Node * pParent, const char * pPropertyName, const char * pFontTTF, CCBReader * pCCBReader); virtual void onHandlePropTypeFontTTF(Node * pNode, Node * pParent, const char * pPropertyName, const char * pFontTTF, CCBReader * pCCBReader);
virtual void onHandlePropTypeText(Node * pNode, Node * pParent, const char * pPropertyName, const char * pText, CCBReader * pCCBReader); virtual void onHandlePropTypeText(Node * pNode, Node * pParent, const char * pPropertyName, const char * pText, CCBReader * pCCBReader);
virtual void onHandlePropTypeFloatScale(Node * pNode, Node * pParent, const char * pPropertyName, float pFloatScale, CCBReader * pCCBReader); virtual void onHandlePropTypeFloatScale(Node * pNode, Node * pParent, const char * pPropertyName, float pFloatScale, CCBReader * pCCBReader);

4
extensions/CCBReader/CCLayerColorLoader.cpp
View File

@ -8,7 +8,7 @@ NS_CC_EXT_BEGIN
#define PROPERTY_OPACITY "opacity" #define PROPERTY_OPACITY "opacity"
#define PROPERTY_BLENDFUNC "blendFunc" #define PROPERTY_BLENDFUNC "blendFunc"
void LayerColorLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader) { void LayerColorLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_COLOR) == 0) { if(strcmp(pPropertyName, PROPERTY_COLOR) == 0) {
((LayerColor *)pNode)->setColor(pColor3B); ((LayerColor *)pNode)->setColor(pColor3B);
} else { } else {
@ -24,7 +24,7 @@ void LayerColorLoader::onHandlePropTypeByte(Node * pNode, Node * pParent, const
} }
} }
void LayerColorLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader) { void LayerColorLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) { if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) {
((LayerColor *)pNode)->setBlendFunc(pBlendFunc); ((LayerColor *)pNode)->setBlendFunc(pBlendFunc);
} else { } else {

4
extensions/CCBReader/CCLayerColorLoader.h
View File

@ -16,9 +16,9 @@ class LayerColorLoader : public LayerLoader {
protected: protected:
CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(LayerColor); CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(LayerColor);
virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader); virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader);
virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader); virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader);
virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader); virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader);
}; };
NS_CC_EXT_END NS_CC_EXT_END

4
extensions/CCBReader/CCLayerGradientLoader.cpp
View File

@ -11,7 +11,7 @@
NS_CC_EXT_BEGIN NS_CC_EXT_BEGIN
void LayerGradientLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader) { void LayerGradientLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_STARTCOLOR) == 0) { if(strcmp(pPropertyName, PROPERTY_STARTCOLOR) == 0) {
((LayerGradient *)pNode)->setStartColor(pColor3B); ((LayerGradient *)pNode)->setStartColor(pColor3B);
} else if(strcmp(pPropertyName, PROPERTY_ENDCOLOR) == 0) { } else if(strcmp(pPropertyName, PROPERTY_ENDCOLOR) == 0) {
@ -31,7 +31,7 @@ void LayerGradientLoader::onHandlePropTypeByte(Node * pNode, Node * pParent, con
} }
} }
void LayerGradientLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader) { void LayerGradientLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) { if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) {
((LayerGradient *)pNode)->setBlendFunc(pBlendFunc); ((LayerGradient *)pNode)->setBlendFunc(pBlendFunc);
} else { } else {

4
extensions/CCBReader/CCLayerGradientLoader.h
View File

@ -16,10 +16,10 @@ class LayerGradientLoader : public LayerLoader {
protected: protected:
CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(LayerGradient); CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(LayerGradient);
virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader); virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader);
virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader); virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader);
virtual void onHandlePropTypePoint(Node * pNode, Node * pParent, const char * pPropertyName, Point pPoint, CCBReader * pCCBReader); virtual void onHandlePropTypePoint(Node * pNode, Node * pParent, const char * pPropertyName, Point pPoint, CCBReader * pCCBReader);
virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader); virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader);
}; };
NS_CC_EXT_END NS_CC_EXT_END

26
extensions/CCBReader/CCNodeLoader.cpp
View File

@ -258,7 +258,7 @@ void NodeLoader::parseProperties(Node * pNode, Node * pParent, CCBReader * pCCBR
} }
case kCCBPropTypeColor3: case kCCBPropTypeColor3:
{ {
ccColor3B color3B = this->parsePropTypeColor3(pNode, pParent, pCCBReader, propertyName.c_str()); Color3B color3B = this->parsePropTypeColor3(pNode, pParent, pCCBReader, propertyName.c_str());
if(setProp) if(setProp)
{ {
this->onHandlePropTypeColor3(pNode, pParent, propertyName.c_str(), color3B, pCCBReader); this->onHandlePropTypeColor3(pNode, pParent, propertyName.c_str(), color3B, pCCBReader);
@ -267,7 +267,7 @@ void NodeLoader::parseProperties(Node * pNode, Node * pParent, CCBReader * pCCBR
} }
case kCCBPropTypeColor4FVar: case kCCBPropTypeColor4FVar:
{ {
ccColor4F * color4FVar = this->parsePropTypeColor4FVar(pNode, pParent, pCCBReader); Color4F * color4FVar = this->parsePropTypeColor4FVar(pNode, pParent, pCCBReader);
if(setProp) if(setProp)
{ {
this->onHandlePropTypeColor4FVar(pNode, pParent, propertyName.c_str(), color4FVar, pCCBReader); this->onHandlePropTypeColor4FVar(pNode, pParent, propertyName.c_str(), color4FVar, pCCBReader);
@ -285,7 +285,7 @@ void NodeLoader::parseProperties(Node * pNode, Node * pParent, CCBReader * pCCBR
} }
case kCCBPropTypeBlendmode: case kCCBPropTypeBlendmode:
{ {
ccBlendFunc blendFunc = this->parsePropTypeBlendFunc(pNode, pParent, pCCBReader); BlendFunc blendFunc = this->parsePropTypeBlendFunc(pNode, pParent, pCCBReader);
if(setProp) if(setProp)
{ {
this->onHandlePropTypeBlendFunc(pNode, pParent, propertyName.c_str(), blendFunc, pCCBReader); this->onHandlePropTypeBlendFunc(pNode, pParent, propertyName.c_str(), blendFunc, pCCBReader);
@ -642,21 +642,21 @@ unsigned char NodeLoader::parsePropTypeByte(Node * pNode, Node * pParent, CCBRea
return ret; return ret;
} }
ccColor3B NodeLoader::parsePropTypeColor3(Node * pNode, Node * pParent, CCBReader * pCCBReader, const char *pPropertyName) { Color3B NodeLoader::parsePropTypeColor3(Node * pNode, Node * pParent, CCBReader * pCCBReader, const char *pPropertyName) {
unsigned char red = pCCBReader->readByte(); unsigned char red = pCCBReader->readByte();
unsigned char green = pCCBReader->readByte(); unsigned char green = pCCBReader->readByte();
unsigned char blue = pCCBReader->readByte(); unsigned char blue = pCCBReader->readByte();
ccColor3B color = { red, green, blue }; Color3B color(red, green, blue);
if (pCCBReader->getAnimatedProperties()->find(pPropertyName) != pCCBReader->getAnimatedProperties()->end()) if (pCCBReader->getAnimatedProperties()->find(pPropertyName) != pCCBReader->getAnimatedProperties()->end())
{ {
ccColor3BWapper *value = ccColor3BWapper::create(color); Color3BWapper *value = Color3BWapper::create(color);
pCCBReader->getAnimationManager()->setBaseValue(value, pNode, pPropertyName); pCCBReader->getAnimationManager()->setBaseValue(value, pNode, pPropertyName);
} }
return color; return color;
} }
ccColor4F * NodeLoader::parsePropTypeColor4FVar(Node * pNode, Node * pParent, CCBReader * pCCBReader) { Color4F * NodeLoader::parsePropTypeColor4FVar(Node * pNode, Node * pParent, CCBReader * pCCBReader) {
float red = pCCBReader->readFloat(); float red = pCCBReader->readFloat();
float green = pCCBReader->readFloat(); float green = pCCBReader->readFloat();
float blue = pCCBReader->readFloat(); float blue = pCCBReader->readFloat();
@ -666,7 +666,7 @@ ccColor4F * NodeLoader::parsePropTypeColor4FVar(Node * pNode, Node * pParent, CC
float blueVar = pCCBReader->readFloat(); float blueVar = pCCBReader->readFloat();
float alphaVar = pCCBReader->readFloat(); float alphaVar = pCCBReader->readFloat();
ccColor4F * colors = new ccColor4F[2]; Color4F * colors = new Color4F[2];
colors[0].r = red; colors[0].r = red;
colors[0].g = green; colors[0].g = green;
colors[0].b = blue; colors[0].b = blue;
@ -691,12 +691,12 @@ bool * NodeLoader::parsePropTypeFlip(Node * pNode, Node * pParent, CCBReader * p
return arr; return arr;
} }
ccBlendFunc NodeLoader::parsePropTypeBlendFunc(Node * pNode, Node * pParent, CCBReader * pCCBReader) BlendFunc NodeLoader::parsePropTypeBlendFunc(Node * pNode, Node * pParent, CCBReader * pCCBReader)
{ {
int source = pCCBReader->readInt(false); int source = pCCBReader->readInt(false);
int destination = pCCBReader->readInt(false); int destination = pCCBReader->readInt(false);
ccBlendFunc blendFunc; BlendFunc blendFunc;
blendFunc.src = source; blendFunc.src = source;
blendFunc.dst = destination; blendFunc.dst = destination;
@ -1056,11 +1056,11 @@ void NodeLoader::onHandlePropTypeByte(Node * pNode, Node * pParent, const char*
ASSERT_FAIL_UNEXPECTED_PROPERTY(pPropertyName); ASSERT_FAIL_UNEXPECTED_PROPERTY(pPropertyName);
} }
void NodeLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char* pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader) { void NodeLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char* pPropertyName, Color3B pColor3B, CCBReader * pCCBReader) {
ASSERT_FAIL_UNEXPECTED_PROPERTY(pPropertyName); ASSERT_FAIL_UNEXPECTED_PROPERTY(pPropertyName);
} }
void NodeLoader::onHandlePropTypeColor4FVar(Node * pNode, Node * pParent, const char* pPropertyName, ccColor4F * pColor4FVar, CCBReader * pCCBReader) { void NodeLoader::onHandlePropTypeColor4FVar(Node * pNode, Node * pParent, const char* pPropertyName, Color4F * pColor4FVar, CCBReader * pCCBReader) {
ASSERT_FAIL_UNEXPECTED_PROPERTY(pPropertyName); ASSERT_FAIL_UNEXPECTED_PROPERTY(pPropertyName);
} }
@ -1068,7 +1068,7 @@ void NodeLoader::onHandlePropTypeFlip(Node * pNode, Node * pParent, const char*
ASSERT_FAIL_UNEXPECTED_PROPERTY(pPropertyName); ASSERT_FAIL_UNEXPECTED_PROPERTY(pPropertyName);
} }
void NodeLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char* pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader) { void NodeLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char* pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader) {
ASSERT_FAIL_UNEXPECTED_PROPERTY(pPropertyName); ASSERT_FAIL_UNEXPECTED_PROPERTY(pPropertyName);
} }

12
extensions/CCBReader/CCNodeLoader.h
View File

@ -72,10 +72,10 @@ class NodeLoader : public Object {
virtual Animation * parsePropTypeAnimation(Node * pNode, Node * pParent, CCBReader * pCCBReader); virtual Animation * parsePropTypeAnimation(Node * pNode, Node * pParent, CCBReader * pCCBReader);
virtual Texture2D * parsePropTypeTexture(Node * pNode, Node * pParent, CCBReader * pCCBReader); virtual Texture2D * parsePropTypeTexture(Node * pNode, Node * pParent, CCBReader * pCCBReader);
virtual unsigned char parsePropTypeByte(Node * pNode, Node * pParent, CCBReader * pCCBReader, const char *pPropertyName); virtual unsigned char parsePropTypeByte(Node * pNode, Node * pParent, CCBReader * pCCBReader, const char *pPropertyName);
virtual ccColor3B parsePropTypeColor3(Node * pNode, Node * pParent, CCBReader * pCCBReader, const char *pPropertyName); virtual Color3B parsePropTypeColor3(Node * pNode, Node * pParent, CCBReader * pCCBReader, const char *pPropertyName);
virtual ccColor4F * parsePropTypeColor4FVar(Node * pNode, Node * pParent, CCBReader * pCCBReader); virtual Color4F * parsePropTypeColor4FVar(Node * pNode, Node * pParent, CCBReader * pCCBReader);
virtual bool * parsePropTypeFlip(Node * pNode, Node * pParent, CCBReader * pCCBReader); virtual bool * parsePropTypeFlip(Node * pNode, Node * pParent, CCBReader * pCCBReader);
virtual ccBlendFunc parsePropTypeBlendFunc(Node * pNode, Node * pParent, CCBReader * pCCBReader); virtual BlendFunc parsePropTypeBlendFunc(Node * pNode, Node * pParent, CCBReader * pCCBReader);
virtual std::string parsePropTypeFntFile(Node * pNode, Node * pParent, CCBReader * pCCBReader); virtual std::string parsePropTypeFntFile(Node * pNode, Node * pParent, CCBReader * pCCBReader);
virtual std::string parsePropTypeString(Node * pNode, Node * pParent, CCBReader * pCCBReader); virtual std::string parsePropTypeString(Node * pNode, Node * pParent, CCBReader * pCCBReader);
virtual std::string parsePropTypeText(Node * pNode, Node * pParent, CCBReader * pCCBReader); virtual std::string parsePropTypeText(Node * pNode, Node * pParent, CCBReader * pCCBReader);
@ -104,10 +104,10 @@ class NodeLoader : public Object {
virtual void onHandlePropTypeAnimation(Node * pNode, Node * pParent, const char* pPropertyName, Animation * pAnimation, CCBReader * pCCBReader); virtual void onHandlePropTypeAnimation(Node * pNode, Node * pParent, const char* pPropertyName, Animation * pAnimation, CCBReader * pCCBReader);
virtual void onHandlePropTypeTexture(Node * pNode, Node * pParent, const char* pPropertyName, Texture2D * pTexture2D, CCBReader * pCCBReader); virtual void onHandlePropTypeTexture(Node * pNode, Node * pParent, const char* pPropertyName, Texture2D * pTexture2D, CCBReader * pCCBReader);
virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char* pPropertyName, unsigned char pByte, CCBReader * pCCBReader); virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char* pPropertyName, unsigned char pByte, CCBReader * pCCBReader);
virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char* pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader); virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char* pPropertyName, Color3B pColor3B, CCBReader * pCCBReader);
virtual void onHandlePropTypeColor4FVar(Node * pNode, Node * pParent, const char* pPropertyName, ccColor4F * pColor4FVar, CCBReader * pCCBReader); virtual void onHandlePropTypeColor4FVar(Node * pNode, Node * pParent, const char* pPropertyName, Color4F * pColor4FVar, CCBReader * pCCBReader);
virtual void onHandlePropTypeFlip(Node * pNode, Node * pParent, const char* pPropertyName, bool * pFlip, CCBReader * pCCBReader); virtual void onHandlePropTypeFlip(Node * pNode, Node * pParent, const char* pPropertyName, bool * pFlip, CCBReader * pCCBReader);
virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char* pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader); virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char* pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader);
virtual void onHandlePropTypeFntFile(Node * pNode, Node * pParent, const char* pPropertyName, const char * pFntFile, CCBReader * pCCBReader); virtual void onHandlePropTypeFntFile(Node * pNode, Node * pParent, const char* pPropertyName, const char * pFntFile, CCBReader * pCCBReader);
virtual void onHandlePropTypeString(Node * pNode, Node * pParent, const char* pPropertyName, const char * pString, CCBReader * pCCBReader); virtual void onHandlePropTypeString(Node * pNode, Node * pParent, const char* pPropertyName, const char * pString, CCBReader * pCCBReader);
virtual void onHandlePropTypeText(Node * pNode, Node * pParent, const char* pPropertyName, const char * pText, CCBReader * pCCBReader); virtual void onHandlePropTypeText(Node * pNode, Node * pParent, const char* pPropertyName, const char * pText, CCBReader * pCCBReader);

4
extensions/CCBReader/CCParticleSystemQuadLoader.cpp
View File

@ -105,7 +105,7 @@ void ParticleSystemQuadLoader::onHandlePropTypeFloatVar(Node * pNode, Node * pPa
} }
} }
void ParticleSystemQuadLoader::onHandlePropTypeColor4FVar(Node * pNode, Node * pParent, const char * pPropertyName, ccColor4F * pColor4FVar, CCBReader * pCCBReader) { void ParticleSystemQuadLoader::onHandlePropTypeColor4FVar(Node * pNode, Node * pParent, const char * pPropertyName, Color4F * pColor4FVar, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_STARTCOLOR) == 0) { if(strcmp(pPropertyName, PROPERTY_STARTCOLOR) == 0) {
((ParticleSystemQuad *)pNode)->setStartColor(pColor4FVar[0]); ((ParticleSystemQuad *)pNode)->setStartColor(pColor4FVar[0]);
((ParticleSystemQuad *)pNode)->setStartColorVar(pColor4FVar[1]); ((ParticleSystemQuad *)pNode)->setStartColorVar(pColor4FVar[1]);
@ -117,7 +117,7 @@ void ParticleSystemQuadLoader::onHandlePropTypeColor4FVar(Node * pNode, Node * p
} }
} }
void ParticleSystemQuadLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader) { void ParticleSystemQuadLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) { if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) {
((ParticleSystemQuad *)pNode)->setBlendFunc(pBlendFunc); ((ParticleSystemQuad *)pNode)->setBlendFunc(pBlendFunc);
} else { } else {

4
extensions/CCBReader/CCParticleSystemQuadLoader.h
View File

@ -21,8 +21,8 @@ class ParticleSystemQuadLoader : public NodeLoader {
virtual void onHandlePropTypeFloat(Node * pNode, Node * pParent, const char * pPropertyName, float pFloat, CCBReader * pCCBReader); virtual void onHandlePropTypeFloat(Node * pNode, Node * pParent, const char * pPropertyName, float pFloat, CCBReader * pCCBReader);
virtual void onHandlePropTypeInteger(Node * pNode, Node * pParent, const char * pPropertyName, int pInteger, CCBReader * pCCBReader); virtual void onHandlePropTypeInteger(Node * pNode, Node * pParent, const char * pPropertyName, int pInteger, CCBReader * pCCBReader);
virtual void onHandlePropTypeFloatVar(Node * pNode, Node * pParent, const char * pPropertyName, float * pFloatVar, CCBReader * pCCBReader); virtual void onHandlePropTypeFloatVar(Node * pNode, Node * pParent, const char * pPropertyName, float * pFloatVar, CCBReader * pCCBReader);
virtual void onHandlePropTypeColor4FVar(Node * pNode, Node * pParent, const char * pPropertyName, ccColor4F * pColor4FVar, CCBReader * pCCBReader); virtual void onHandlePropTypeColor4FVar(Node * pNode, Node * pParent, const char * pPropertyName, Color4F * pColor4FVar, CCBReader * pCCBReader);
virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader); virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader);
virtual void onHandlePropTypeTexture(Node * pNode, Node * pParent, const char * pPropertyName, Texture2D * pTexture2D, CCBReader * pCCBReader); virtual void onHandlePropTypeTexture(Node * pNode, Node * pParent, const char * pPropertyName, Texture2D * pTexture2D, CCBReader * pCCBReader);
}; };

4
extensions/CCBReader/CCScale9SpriteLoader.cpp
View File

@ -23,7 +23,7 @@ void Scale9SpriteLoader::onHandlePropTypeSpriteFrame(Node * pNode, Node * pParen
} }
} }
void Scale9SpriteLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader) { void Scale9SpriteLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_COLOR) == 0) { if(strcmp(pPropertyName, PROPERTY_COLOR) == 0) {
((Scale9Sprite *)pNode)->setColor(pColor3B); ((Scale9Sprite *)pNode)->setColor(pColor3B);
} else { } else {
@ -39,7 +39,7 @@ void Scale9SpriteLoader::onHandlePropTypeByte(Node * pNode, Node * pParent, cons
} }
} }
void Scale9SpriteLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader) { void Scale9SpriteLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) { if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) {
// TODO Not exported by CocosBuilder yet! // TODO Not exported by CocosBuilder yet!
// ((Scale9Sprite *)pNode)->setBlendFunc(pBlendFunc); // ((Scale9Sprite *)pNode)->setBlendFunc(pBlendFunc);

4
extensions/CCBReader/CCScale9SpriteLoader.h
View File

@ -18,9 +18,9 @@ class Scale9SpriteLoader : public NodeLoader {
protected: protected:
CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(Scale9Sprite); CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(Scale9Sprite);
virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader); virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader);
virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader); virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader);
virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader); virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader);
virtual void onHandlePropTypeSpriteFrame(Node * pNode, Node * pParent, const char * pPropertyName, SpriteFrame * pSpriteFrame, CCBReader * pCCBReader); virtual void onHandlePropTypeSpriteFrame(Node * pNode, Node * pParent, const char * pPropertyName, SpriteFrame * pSpriteFrame, CCBReader * pCCBReader);
virtual void onHandlePropTypeSize(Node * pNode, Node * pParent, const char * pPropertyName, Size pSize, CCBReader * pCCBReader); virtual void onHandlePropTypeSize(Node * pNode, Node * pParent, const char * pPropertyName, Size pSize, CCBReader * pCCBReader);
virtual void onHandlePropTypeFloat(Node * pNode, Node * pParent, const char * pPropertyName, float pFloat, CCBReader * pCCBReader); virtual void onHandlePropTypeFloat(Node * pNode, Node * pParent, const char * pPropertyName, float pFloat, CCBReader * pCCBReader);

4
extensions/CCBReader/CCSpriteLoader.cpp
View File

@ -29,7 +29,7 @@ void SpriteLoader::onHandlePropTypeFlip(Node * pNode, Node * pParent, const char
} }
} }
void SpriteLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader) { void SpriteLoader::onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_COLOR) == 0) { if(strcmp(pPropertyName, PROPERTY_COLOR) == 0) {
((Sprite *)pNode)->setColor(pColor3B); ((Sprite *)pNode)->setColor(pColor3B);
} else { } else {
@ -45,7 +45,7 @@ void SpriteLoader::onHandlePropTypeByte(Node * pNode, Node * pParent, const char
} }
} }
void SpriteLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pBlendFunc, CCBReader * pCCBReader) { void SpriteLoader::onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pBlendFunc, CCBReader * pCCBReader) {
if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) { if(strcmp(pPropertyName, PROPERTY_BLENDFUNC) == 0) {
((Sprite *)pNode)->setBlendFunc(pBlendFunc); ((Sprite *)pNode)->setBlendFunc(pBlendFunc);
} else { } else {

4
extensions/CCBReader/CCSpriteLoader.h
View File

@ -16,9 +16,9 @@ class SpriteLoader : public NodeLoader {
protected: protected:
CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(Sprite); CCB_VIRTUAL_NEW_AUTORELEASE_CREATECCNODE_METHOD(Sprite);
virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, ccColor3B pColor3B, CCBReader * pCCBReader); virtual void onHandlePropTypeColor3(Node * pNode, Node * pParent, const char * pPropertyName, Color3B pColor3B, CCBReader * pCCBReader);
virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader); virtual void onHandlePropTypeByte(Node * pNode, Node * pParent, const char * pPropertyName, unsigned char pByte, CCBReader * pCCBReader);
virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, ccBlendFunc pCCBBlendFunc, CCBReader * pCCBReader); virtual void onHandlePropTypeBlendFunc(Node * pNode, Node * pParent, const char * pPropertyName, BlendFunc pCCBBlendFunc, CCBReader * pCCBReader);
virtual void onHandlePropTypeSpriteFrame(Node * pNode, Node * pParent, const char * pPropertyName, SpriteFrame * pSpriteFrame, CCBReader * pCCBReader); virtual void onHandlePropTypeSpriteFrame(Node * pNode, Node * pParent, const char * pPropertyName, SpriteFrame * pSpriteFrame, CCBReader * pCCBReader);
virtual void onHandlePropTypeFlip(Node * pNode, Node * pParent, const char * pPropertyName, bool * pFlip, CCBReader * pCCBReader); virtual void onHandlePropTypeFlip(Node * pNode, Node * pParent, const char * pPropertyName, bool * pFlip, CCBReader * pCCBReader);
}; };

16
extensions/GUI/CCControlExtension/CCControlButton.cpp
View File

@ -44,7 +44,7 @@ enum
ControlButton::ControlButton() ControlButton::ControlButton()
: _currentTitle(NULL) : _currentTitle(NULL)
, _currentTitleColor(ccWHITE) , _currentTitleColor(Color3B::white)
, _doesAdjustBackgroundImage(false) , _doesAdjustBackgroundImage(false)
, _titleLabel(NULL) , _titleLabel(NULL)
, _backgroundSprite(NULL) , _backgroundSprite(NULL)
@ -118,7 +118,7 @@ bool ControlButton::initWithLabelAndBackgroundSprite(Node* node, Scale9Sprite* b
setBackgroundSprite(backgroundSprite); setBackgroundSprite(backgroundSprite);
// Set the default color and opacity // Set the default color and opacity
setColor(ccc3(255.0f, 255.0f, 255.0f)); setColor(Color3B(255.0f, 255.0f, 255.0f));
setOpacity(255.0f); setOpacity(255.0f);
setOpacityModifyRGB(true); setOpacityModifyRGB(true);
@ -321,9 +321,9 @@ void ControlButton::setTitleForState(String* title, ControlState state)
} }
const ccColor3B ControlButton::getTitleColorForState(ControlState state) const Color3B ControlButton::getTitleColorForState(ControlState state)
{ {
ccColor3B returnColor = ccWHITE; Color3B returnColor = Color3B::white;
do do
{ {
CC_BREAK_IF(NULL == _titleColorDispatchTable); CC_BREAK_IF(NULL == _titleColorDispatchTable);
@ -344,9 +344,9 @@ const ccColor3B ControlButton::getTitleColorForState(ControlState state)
return returnColor; return returnColor;
} }
void ControlButton::setTitleColorForState(ccColor3B color, ControlState state) void ControlButton::setTitleColorForState(Color3B color, ControlState state)
{ {
//ccColor3B* colorValue=&color; //Color3B* colorValue=&color;
_titleColorDispatchTable->removeObjectForKey(state); _titleColorDispatchTable->removeObjectForKey(state);
Color3bObject* pColor3bObject = new Color3bObject(color); Color3bObject* pColor3bObject = new Color3bObject(color);
pColor3bObject->autorelease(); pColor3bObject->autorelease();
@ -729,7 +729,7 @@ GLubyte ControlButton::getOpacity() const
return _realOpacity; return _realOpacity;
} }
void ControlButton::setColor(const ccColor3B & color) void ControlButton::setColor(const Color3B & color)
{ {
Control::setColor(color); Control::setColor(color);
@ -741,7 +741,7 @@ void ControlButton::setColor(const ccColor3B & color)
} }
} }
const ccColor3B& ControlButton::getColor() const const Color3B& ControlButton::getColor() const
{ {
return _realColor; return _realColor;
} }

10
extensions/GUI/CCControlExtension/CCControlButton.h
View File

@ -68,7 +68,7 @@ protected:
CC_SYNTHESIZE_READONLY(String*, _currentTitle, CurrentTitle); CC_SYNTHESIZE_READONLY(String*, _currentTitle, CurrentTitle);
/** The current color used to display the title. */ /** The current color used to display the title. */
CC_SYNTHESIZE_READONLY_PASS_BY_REF(ccColor3B, _currentTitleColor, CurrentTitleColor); CC_SYNTHESIZE_READONLY_PASS_BY_REF(Color3B, _currentTitleColor, CurrentTitleColor);
/** Adjust the background image. YES by default. If the property is set to NO, the /** Adjust the background image. YES by default. If the property is set to NO, the
background will use the prefered size of the background image. */ background will use the prefered size of the background image. */
@ -93,8 +93,8 @@ protected:
/* Override setter to affect a background sprite too */ /* Override setter to affect a background sprite too */
virtual GLubyte getOpacity(void) const; virtual GLubyte getOpacity(void) const;
virtual void setOpacity(GLubyte var); virtual void setOpacity(GLubyte var);
virtual const ccColor3B& getColor(void) const; virtual const Color3B& getColor(void) const;
virtual void setColor(const ccColor3B&); virtual void setColor(const Color3B&);
/** Flag to know if the button is currently pushed. */ /** Flag to know if the button is currently pushed. */
protected: protected:
@ -170,7 +170,7 @@ public:
* @return The color of the title for the specified state. * @return The color of the title for the specified state.
*/ */
virtual const ccColor3B getTitleColorForState(ControlState state); virtual const Color3B getTitleColorForState(ControlState state);
/** /**
* Sets the color of the title to use for the specified state. * Sets the color of the title to use for the specified state.
@ -179,7 +179,7 @@ public:
* @param state The state that uses the specified color. The values are described * @param state The state that uses the specified color. The values are described
* in "CCControlState". * in "CCControlState".
*/ */
virtual void setTitleColorForState(ccColor3B color, ControlState state); virtual void setTitleColorForState(Color3B color, ControlState state);
/** /**
* Returns the title label used for a state. * Returns the title label used for a state.

Some files were not shown because too many files have changed in this diff Show More